From d0c6cacd06183b980f7c51e7af956d5e486dc341 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Rafael=20Weing=C3=A4rtner?= Date: Mon, 16 Jul 2018 13:18:55 -0300 Subject: [PATCH] [CLOUDSTACK-9261] Upgrate jQuery-UI to 1.11 (JQuery UI 1.8.4 prone to XSS) (#2524) * [CLOUDSTACK-9261] Upgrate jQuery-UI to 1.11 (JQuery UI 1.8.4 prone to XSS) * fix problems in the UI for lbCertificatePolicy and StaticNAT * force jenkins build * Fix about dialog * Fix position of network service offering --- scripts/installer/windows/client.wxs | 60 - .../css/images/ui-bg_flat_0_aaaaaa_40x100.png | Bin 180 -> 0 bytes .../images/ui-bg_flat_75_ffffff_40x100.png | Bin 178 -> 0 bytes .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin 120 -> 0 bytes .../images/ui-bg_glass_65_ffffff_1x400.png | Bin 105 -> 0 bytes .../images/ui-bg_glass_75_dadada_1x400.png | Bin 111 -> 0 bytes .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin 110 -> 0 bytes .../ui-bg_highlight-hard_75_a7c1d2_1x100.png | Bin 121 -> 0 bytes .../ui-bg_inset-soft_95_fef1ec_1x100.png | Bin 123 -> 0 bytes .../css/images/ui-icons_222222_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_2e83ff_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_454545_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_888888_256x240.png | Bin 4369 -> 0 bytes .../css/images/ui-icons_cd0a0a_256x240.png | Bin 4369 -> 0 bytes ui/lib/jquery-ui/css/jquery-ui.css | 568 - ui/lib/jquery-ui/index.html | 367 - ui/lib/jquery-ui/js/jquery-ui.js | 17156 +++++++++++++++- ui/scripts/accounts.js | 1 - ui/scripts/configuration.js | 2 +- ui/scripts/lbCertificatePolicy.js | 7 + ui/scripts/sharedFunctions.js | 5 +- ui/scripts/ui-custom/accountsWizard.js | 9 +- ui/scripts/ui-custom/enableStaticNAT.js | 6 +- ui/scripts/ui-custom/instanceWizard.js | 15 +- ui/scripts/ui-custom/projects.js | 9 +- ui/scripts/ui-custom/zoneWizard.js | 7 +- ui/scripts/ui/core.js | 7 +- ui/scripts/ui/dialog.js | 22 +- ui/scripts/ui/utils.js | 19 + ui/scripts/ui/widgets/detailView.js | 18 +- ui/scripts/ui/widgets/listView.js | 5 +- ui/scripts/ui/widgets/multiEdit.js | 50 +- ui/scripts/ui/widgets/toolTip.js | 22 +- 33 files changed, 16622 insertions(+), 1733 deletions(-) delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_glass_75_e6e6e6_1x400.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_highlight-hard_75_a7c1d2_1x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_888888_256x240.png delete mode 100755 ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png delete mode 100755 ui/lib/jquery-ui/css/jquery-ui.css delete mode 100755 ui/lib/jquery-ui/index.html diff --git a/scripts/installer/windows/client.wxs b/scripts/installer/windows/client.wxs index 609d720a67e..8dfec67e462 100644 --- a/scripts/installer/windows/client.wxs +++ b/scripts/installer/windows/client.wxs @@ -242,52 +242,6 @@ - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - @@ -1889,20 +1843,6 @@ - - - - - - - - - - - - - - diff --git a/ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png b/ui/lib/jquery-ui/css/images/ui-bg_flat_0_aaaaaa_40x100.png deleted file mode 100755 index 5b5dab2ab7b1c50dea9cfe73dc5a269a92d2d4b4..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 180 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FscKIb$B>N1x91EQ4=4yQ7#`R^ z$vje}bP0l+XkK DSH>_4 diff --git a/ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png b/ui/lib/jquery-ui/css/images/ui-bg_flat_75_ffffff_40x100.png deleted file mode 100755 index ac8b229af950c29356abf64a6c4aa894575445f0..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 178 zcmeAS@N?(olHy`uVBq!ia0vp^8bF-F!3HG1q!d*FsY*{5$B>N1x91EQ4=4yQYz+E8 zPo9&<{J;c_6SHRil>2s{Zw^OT)6@jj2u|u!(plXsM>LJD`vD!n;OXk;vd$@?2>^GI BH@yG= diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_55_fbf9ee_1x400.png deleted file mode 100755 index ad3d6346e00f246102f72f2e026ed0491988b394..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 120 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnour0hLi978O6-<~(*I$*%ybaDOn z{W;e!B}_MSUQoPXhYd^Y6RUoS1yepnPx`2Kz)7OXQG!!=-jY=F+d2OOy?#DnJ32>z UEim$g7SJdLPgg&ebxsLQ09~*s;{X5v diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_65_ffffff_1x400.png deleted file mode 100755 index 42ccba269b6e91bef12ad0fa18be651b5ef0ee68..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 105 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouqzpV=978O6-=0?FV^9z|eBtf= z|7WztIJ;WT>{+tN>ySr~=F{k$>;_x^_y?afmf9pRKH0)6?eSP?3s5hEr>mdKI;Vst E0O;M1& diff --git a/ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png b/ui/lib/jquery-ui/css/images/ui-bg_glass_75_dadada_1x400.png deleted file mode 100755 index 5a46b47cb16631068aee9e0bd61269fc4e95e5cd..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 111 zcmeAS@N?(olHy`uVBq!ia0vp^j6gJjgAK^akKnouq|7{B978O6lPf+wIa#m9#>Unb zm^4K~wN3Zq+uP>V~E7myXQA@HYA8JKUDsG z{u#?PzmNO7dv`S|n8~xRJhV-o_rU%QLajY^Usjn;N@&CDX#zk diff --git a/ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png b/ui/lib/jquery-ui/css/images/ui-bg_inset-soft_95_fef1ec_1x100.png deleted file mode 100755 index 0e05810fffe0b6b8ac320e55d1eb4ba259b89d92..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 123 zcmeAS@N?(olHy`uVBq!ia0vp^j6j^i!3HGVb)pi0l#{26V~E7myXUR>S{Ou}E*`%9 zKPdOkfrN+ZlHSt7(uY{3{#;wiJb&Ugx1>W4qtrSDm(4hFaaY-$3p3x|sIU3`%J?Qj YcLn#R=pC)AfTl5cy85}Sb4q9e0MP_2(*OVf diff --git a/ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_222222_256x240.png deleted file mode 100755 index b273ff111d219c9b9a8b96d57683d0075fb7871a..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3^phOrG}UnfiUEn8(9QW1?MNkxXVDEpFin2{xWrLx5kBC;k~GmPmYTG^FX}c% zlGE{DS1Q;~I7-6ze&TN@+F-xsI6sd%SwK#*O5K|pDRZqEy< zJg0Nd8F@!OxqElm`~U#piM22@u@8B<moyKE%ct`B(jysxK+1m?G)UyIFs1t0}L zemGR&?jGaM1YQblj?v&@0iXS#fi-VbR9zLEnHLP?xQ|=%Ihrc7^yPWR!tW$yH!zrw z#I2}_!JnT^(qk)VgJr`NGdPtT^dmQIZc%=6nTAyJDXk+^3}wUOilJuwq>s=T_!9V) zr1)DT6VQ2~rgd@!Jlrte3}}m~j}juCS`J4(d-5+e-3@EzzTJNCE2z)w(kJ90z*QE) zBtnV@4mM>jTrZZ*$01SnGov0&=A-JrX5Ge%Pce1Vj}=5YQqBD^W@n4KmFxxpFK`uH zP;(xKV+6VJ2|g+?_Lct7`uElL<&jzGS8Gfva2+=8A@#V+xsAj9|Dkg)vL5yhX@~B= zN2KZSAUD%QH`x>H+@Ou(D1~Pyv#0nc&$!1kI?IO01yw3jD0@80qvc?T*Nr8?-%rC8 z@5$|WY?Hqp`ixmEkzeJTz_`_wsSRi1%Zivd`#+T{Aib6-rf$}M8sz6v zb6ERbr-SniO2wbOv!M4)nb}6UVzoVZEh5kQWh_5x4rYy3c!871NeaM(_p=4(kbS6U#x<*k8Wg^KHs2ttCz<+pBxQ$Z zQMv;kVm5_fF_vH`Mzrq$Y&6u?j6~ftIV0Yg)Nw7JysIN_ z-_n*K_v1c&D}-1{NbBwS2h#m1y0a5RiEcYil+58$8IDh49bPnzE7R8In6P%V{2IZU z7#clr=V4yyrRe@oXNqbqo^^LvlLE?%8XaI&N(Np90-psU}7kqmbWk zZ;YBwJNnNs$~d!mx9oMGyT( znaBoj0d}gpQ^aRr?6nW)$4god*`@Uh2e+YpS@0(Mw{|z|6ko3NbTvDiCu3YO+)egL z>uW(^ahKFj>iJ-JF!^KhKQyPTznJa;xyHYwxJgr16&Wid_9)-%*mEwo{B_|M9t@S1 zf@T@q?b2Qgl!~_(Roe;fdK)y|XG0;ls;ZbT)w-aOVttk#daQcY7$cpY496H*`m@+L zeP#$&yRbBjFWv}B)|5-1v=(66M_;V1SWv6MHnO}}1=vby&9l+gaP?|pXwp0AFDe#L z&MRJ^*qX6wgxhA_`*o=LGZ>G_NTX%AKHPz4bO^R72ZYK}ale3lffDgM8H!Wrw{B7A z{?c_|dh2J*y8b04c37OmqUw;#;G<* z@nz@dV`;7&^$)e!B}cd5tl0{g(Q>5_7H^@bEJi7;fQ4B$NGZerH#Ae1#8WDTH`iB&) zC6Et3BYY#mcJxh&)b2C^{aLq~psFN)Q1SucCaBaBUr%5PYX{~-q{KGEh)*;n;?75k z=hq%i^I}rd;z-#YyI`8-OfMpWz5kgJE3I!3ean6=UZi!BxG7i(YBk? z02HM7wS0)Wni{dWbQMRtd-A)_Az!t>F;IwWf~!*)-Az4}yryNkz&9)w>ElA80Oc`6 zHo#9H!Y3*Qx9n@Jn)!w6G^hb;e_n8zpIyXCN`JFkPc)^Q?2MsLNFhMgrcZI-<#1ne zjH;KFf?4eAT9mQZ}ZfHLGA#d%s;SZK4p0FwZT2S^{ zQ2BG1xJsbK6?yrHTjJi|5C0u=!|r!?*4FL%y%3q#(d+e>b_2I9!*iI!30}42Ia0bq zUf`Z?LGSEvtz8s``Tg5o_CP(FbR0X$FlE0yCnB7suDPmI2=yOg^*2#cY9o`X z;NY-3VBHZjnVcGS){GZ98{e+lq~O$u6pEcgd0CrnIsWffN1MbCZDH<7c^hv+Z0Ucf0{w zSzi^qKuUHD9Dgp0EAGg@@$zr32dQx>N=ws`MESEsmzgT2&L;?MSTo&ky&!-JR3g~1 zPGTt515X)wr+Bx(G9lWd;@Y3^Vl}50Wb&6-Tiy;HPS0drF`rC}qYq22K4)G#AoD0X zYw$E+Bz@Zr^50MAwu@$?%f9$r4WHH?*2|67&FXFhXBrVFGmg)6?h3^-1?t;UzH0*I zNVf9wQLNLnG2@q>6CGm>&y|lC`iCFfYd}9i%+xkl^5oBJ?<;aneCfcHqJh7Yl5uLS z9Fx-(kMdcNyZejXh22N{mCw_rX1O!cOE&3>e(ZH81PR95wQC37En4O{w;{3q9n1t&;p)D%&Z%Nw$gSPa!nz8Slh7=ko2am)XARwOWw zpsz0~K!s{(dM$NB=(A=kkp>T(*yU6<_dwIx>cH4+LWl282hXa6-EUq>R3t?G2623< z*RwTN%-fgBmD{fu*ejNn)1@KG?Sg*8z3hYtkQJQjB6 zQ|x>wA=o$=O)+nLmgTXW3_6diA;b4EY{*i*R%6dO2EMg z@6g?M3rpbnfB@hOdUeb96=~I?OIA3@BWAGmTwiQ{x5Cqq<8c10L!P zd@Qk^BseTX%$Q7^s}5n%HB|)gKx}H$d8Sb$bBnq9-AglT2dGR2(+I;_fL|R4p$odJ zllfb0NqI)7=^z~qAm1V{(PkpxXsQ#4*NH9yYZ`Vf@)?#ueGgtCmGGY|9U#v|hRdg- zQ%0#cGIfXCd{Y)JB~qykO;KPvHu|5Ck&(Hn%DF~cct@}j+87xhs2ew;fLm5#2+mb| z8{9e*YI(u|gt|{x1G+U=DA3y)9s2w7@cvQ($ZJIA)x$e~5_3LKFV~ASci8W}jF&VeJoPDUy(BB>ExJpck;%;!`0AAo zAcHgcnT8%OX&UW_n|%{2B|<6Wp2MMGvd5`T2KKv;ltt_~H+w00x6+SlAD`{K4!9zx z*1?EpQ%Lwiik){3n{-+YNrT;fH_niD_Ng9|58@m8RsKFVF!6pk@qxa{BH-&8tsim0 zdAQ(GyC^9ane7_KW*#^vMIoeQdpJqmPp%%px3GIftbwESu#+vPyI*YTuJ6+4`z{s? zpkv~0x4c_PFH`-tqafw5)>4AuQ78SkZ!$8}INLK;Egr;2tS18hEO5=t;QDmZ-qu?I zG+=DN`nR72Xto{{bJp||`k}-2G;5#xg8E~xgz22)^_Z;=K|4@(E&5J)SY2of=olcw z5)@L)_Ntcm!*5nEy0M9v0`S33;pO4TN;>4(Z+19p_0>u#e-vE zXCU(6gAvu~I7Cw(xd%0e59MNLw^U37ZDbsBrj%eDCexw8a3G`nTcXVNL6{B7Hj@i& zbVB{;ApEtHk76q08DJ48dSxd$C(;$K6=FpU<~l9pVoT9arW^Vu{%Bcn4`eIpkOVC| z$)AKYG_`ypM{0@BUb3^9lqi_c?ONH|4UJMJWDowMVjacycX7}9g={O7swOB+{;+?; zjBo!9?+nd)ie#x5IbFW-zBOo0c4q@9wGVt5;pNt`=-~Zgcw#*`m($6ibxtZ`H=e=} zF#GZ~5$%AUn};8U#tRem0J(JTR}d4vR(dgK2ML~lZsPhayJ2h1%sD4FVst| zKF)+@`iNzLRjg4=K8@**0=5cE>%?FDc({I^+g9USk<8$&^qD~@%W0i4b|yMG*p4`N zh}I!ltTRI8Ex$+@V{02Br%xq#O?UlhO{r8WsaZnZCZq0MK9%AXU%MDLT;3=0A9(BV z9VxxxJd7jo$hw3q;3o?yBLmA=azBUrd9>-<_ANs0n3?-Ic*6&ytb@H~?0E(*d>T5n z-HiH2jsDf6uWhID%#n>SzOqrFCPDfUcu5QPd?<(=w6pv1BE#nsxS{n!UnC9qAha1< z;3cpZ9A-e$+Y)%b;w@!!YRA9p%Kf9IHGGg^{+p`mh;q8i7}&e@V3EQaMsItEMS&=X plT@$;k0WcB_jb;cn%_Idz4HO$QU*abf4}+wi?e96N>fbq{{i|W0@(ln diff --git a/ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_2e83ff_256x240.png deleted file mode 100755 index 09d1cdc856c292c4ab6dd818c7543ac0828bd616..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3@pGmLE*`#M>&Z`mr_kcu#tBo!IbqU=l7VaSrbQrTh%5m}S08Obh0 zGL{*mi8RK}U~J#s@6Y%1S9~7lb?$xLU+y{go_o*h`AW1wUF3v{Kmh;%r@5J_9RL9Q zdj+hqg8o{9`K7(TZrR4t{=9O`!T-(~c=yEWZ{eswJJe->5bP8)t4;f(Y*i_HU*sLM z2=7-8guZ}@*(HhVC)Mqgr$3T8?#a(hu& z?Kzuw!O%PM>AicSW`_U(cbvJYv3{HfpIP~Q>@$^c588E$vv)V2c|Mr% zuFO$+I~Hg@u}wPm17n%}j1Y+Pbu!bt?iPkjGAo7>9eRN0FZz3X2_QZj+V!}+*8oBQ z_=iI^_TCA;Ea2tPmRNOeX3+VM>KL;o1(h`c@`6Ah`vdH<&+$yTg)jGWW72T}6J`kUAv?2CgyV zrs0y@Fpvpj@kWVE0TzL@Cy#qHn~kgensb{hIm6J&I8hkoNHOz6o1QQ3QM4NZyu?;= zLd>`wPT*uGr+6vAxYv3k8{gMDR>tO}UavDKzzyi6hvbuP=XQ4Y|A)r4#B$U(q7{1Z z0iLeSjo3;T*diS*me%4|!s23l@>R}rn@#Zc{<%CFt;?gd5S<)b=8Yz32U zBBLprntW3RE3f|uNX5Aw|I(IlJjW-Byd?QFFRk%hLU}O*YyYQel}WcXilLMJp9cB4 z)E?D+*Y4zai&XY!>niMfTW-2pp-^KFT93%Leig@uoQGPYRCva-`w#orm`is`p8b4s zxD462;f*^XO$=3by=VzN9i@xxr<1w=pcxl!$!fjWt|fYmq1@@badT?v`d zIi$|e$Ji}FXsiVYf)?pN1R0LBw;+)B5aUJj2fP+=m;=_Eho84g%Jq#@MLPSQEX*@T z6sZb)m?)zby>{j1)(;rRML|gKSs+9jorf-XhQJ2Jyt5Cqc*`S3iX@A5C3jvgAns|4 z*|)YQ%Kmsj+YZ53;nMqh|AFvehUV-9R;1ZZ;w5r9l}8hjSw@#k;>)$P*r%)=Extyu zB!$Kd-F?*50aJ2;TNTR-fc8B{KAq3!vW{g$LlGPfGW+%#CXU zJDcMsvyT2`x~v>>w8@yssoA`KuIZ98CLU{Ia%*nW3G4t}@ApsbC@o^WCqL>OXx>Y^ zSuVWEQ;3=A=@RxCnt0>G@#(VWBQ`0$qTwA#e>SX{_N~JWGsBxFHCw|5|?CzDi>92F-^=b*8sMXnhUJdb!>yGD2nhN@{582 zRPcxuDzs&;8De)>_J19z{0xppXQop#T_5ejGCKv@l>$O#DA-@X{y_1B-AsiU)H}DR z3xDZ8G`amV_WmA&8!W=@jgm|%bnwH%qkg(@J$hLaSV zC-rXIFMM%y<|Gb)o?j zpe-`dJ*N5tC-iH)d0CgLdBsw*C!ST9hY1EkI|Y(&=p&dH&q;a&7HXa5#_wtMsenQL zcpyhwx)Ppw@XmVz?P)DI#^ee1oC!i`>>Jq1ESk-OuQ(Pbv=s{A0AjM@rw#FaU;RUh z*At0{U*NtGVY_-JcuG$?zuuf%ZBTWxKU2yf?iN#-MRWs>A*2;p0G1Tp3d29u5RbnY zDOON-G|PidOOGeybnbzu7UVv71l!b=w7eU5l*{EdKuoKu`#LZ}|fnUr-+lSST9(MTT`0tqOG z#+Q_=lXe-=;rE4u8s~;%i~~ z8v&&+VPeXG=2zw9B5sR$e?R(n%nf?p-(BCZ8}x!_-9T+LT;2=Zu?Wv)j3#>35$6dR z4*7xmI)#06qjh#sXvX(%`#D1mD8fn1G~I;l%Dk{pw)}>_{+3^Fv_q)>2#de5qGCId zPz?ix-3954nM&u@vaw{o%-#HU%_bLJMO#@enR^&B{3ihWdoU6%pBJ`o>im+b-c6r-;c{vd0Z_)`75$jApy2?!9G4_FGa)iZ~9`6VELiYM+n!-mUfvfm{jt zC?!1=%pxJhF>vyQ47Q}R;O48pxgMs)rz$SbM&jkp<6X$r4DHWg>ZnGB-$r2o1*nL# zW0^*itcRY_^Uv^XgQP>W#>KQgM~l{;S(GkVW@&vld^AhWzG^m|9#0#USbM>^en{k2 za8~DTL`(Q~=ofsL&Fc`!L6r~qTnnGo8r98<(aG*<0%aNEr!!BIyY>VV82kxhR%d>V(lN&#BId#urK_i~Pe6?>C~J!pU_lRon#&S_cXoQv;poG8FK4atc

N)npz1~X%p6x{M(Gw!!H=!}lmO0Xr*8ewyH(Q+>oy`fxQkxJ zzzB$)%*xM4s_2(O>)T-QXhwP|&DZam#{O+47q|WKfz_ZL-MypRN~o{fE*I#6@eM?I zs%f-6{Lz6j7rB#U$%O$~TIT!j?|Ip1CpSmb=JA9qCY3-mQf|fVCxswPjok|VofUEP zW5^pTd5B;wRkyW%1a;nYHB$ef6Pv8^);`m0jv6p72iNJl+sVBqZugsq6cq_pyNREi z>GN!h6ZQ6`aOMr_2KI@j=XR@$aJj(2jcpY?>f=2kMV@di5W7Swj?ug10zRe}F1nR* ztMm6+T^)LJe^SzGgSxahQajq0h7#|8oMV0>D~*N}jl?9_X`ka42R4@rryDc3o(c$R?1*!1O9zleSOczw zYPS3~xbJ$~C(3+D7Zkrfjs_lneY^zv^kHmxt)aqZ!aeGABHZ`gvA&K`72z}ihI$Ht z9V&)wQy0g@R9irwbf!{uE&_J2l9jXz^Vj#=qA77*3Pd9OjrE_tKDHADd!AjFQv(ji zct-BMUt9()1Ox!dsI_h1(^F_U)_QJrx|%+y`zWWlD4=Nd?JQ=URh0*{fb1!o4tS(H z^r_T(8t1SAHf1oduG+X^*EC_kL(!QnXL6Hp);449yO&1xE>MXGqT)t10lzvALllX;;Q)RiJX$dm zlR8ep5-GdHmRm9?N#QCjNUA);vC03Gw6yds6^?c4;(MH>;O5xmQ2nGK3Dmk8i*v5t z-{jJsQq30%z}0`g7SN-yN`l-`@6rkJ|V|>18`MV zwUeH}DxWw&h+A+Dn|4|YNr&EfKS`Hz_NkeW3*sI5Rq-J&FzG=!{-K`n65#7O%^&f> z`PkqxyC_K)>781~7H${^Nj{`>XEa&OPqqQhySR5%w2{5+sEakXXHazJp6~LP2QKDx zpkvZrkDOa+A4BbqqX6ls&O)5-Q7`qkZ_?6~c-wQ9tseNtET;nhEOL^`*naKwcMX;R zbto&a;oTR0s;vjfj3wigUg)Sj)!OHQfZoJwAsWYI1A4ntz>X=W4s|y?tUk1r=>#Ct zf+?hq^>rQ3$KNboG$UhCdEmp{qAR13DK$f0ES7kAG~7q+g!jfVq`1b5+c62N^0%~o zKw91o@Wv;0EW*7fINAX3O~L-V{`;xB0q()#^HKZOlLrXVL*Dtw-$SUp8*_J{r( zW`6r`cz0yZQ#f0#*y+m64{bs7GP|2V$phf42rswJB?s@9qf;Bfc^pm-ZS#^5dkG{u zzv;l&B$NYcegSqAnjnPN1?17VUQbPummcWry((85IFB(pFQNGN{hhN$Fv?~l_fr?| z9=%dK(+;kZ(8=mwptjwC-ikBD$Z{l2++~*8wq5ynF<+PNlZI7ba5V#fg~L}kE;UH5 zJ;{P(`G{tNl&z5rUiH~e{I>GT8~9&*(J;Myx9z5P!db!F8RTII^I7c)HU=ss*bYB` zgwiIMZ_q>KEC$4lFm+Afvu6^$X1jm1rB*4H)-EIO5Rvz_p24?OkJ zovD4{-1KA6*oL?a;3qR7GZRB!cE5oAdA#M@{w+fGgsJ-lSmQ^-?8E&Q%tbmjd=@gZ z(}Mg*jsDf6Z)|7s%@9pc-tuw5W&zqUXjv2bVkC%-X?O3F72W4EsIl#1e>Mdz=X4k*_>VxCu_2?jjg16N*5fwC-36OW&;Sz}@jMn}hgJdEd pO;bST+>R{W-aENZYk%(=^(_R5N$LmL{Qc?!%+I4tt4z=_{|902Wu5>4 diff --git a/ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_454545_256x240.png deleted file mode 100755 index 59bd45b907c4fd965697774ce8c5fc6b2fd9c105..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3^p#%>toqJ#RmwV2==ic*rz7lOw=eaq=H~;_ux21)-Jpcgw zdj+hrf&W^f<%Qk9Zpqf#;jH;N^Z%VA?R|9mZ{esQd(2F=?y+!`XZ5CR?ue=UdHIfUDFM*m15I;g=VN2jw zQW9?wOhDI#+P0|`@JQoC3!pu=AzGMtYB>V&?8(2>_B5_p`1Sb1t{^|J%bZYv09RS? zQ*dcs7}$)taJ@vX0E<96P{ur)Eygr{&ALyNoMP%_94m}=qFVT)&CeG1DBBMLUSKP^ zp%%Q3$MEtKll)X*+$)3O_3x`4%cHY0uhy7U;5x^Ir}X1)mv&B%|A)@A$a>f}tP{5X z9-gkti`YyT+hk9)cZW7fAQhjT%$XLLI^&VR=qev36;`WGBOP!^&(?!sK6jSH0Dnz4 zoEMMNu}y&n=rd-GWI?rGBI8!GD*NJ$k&e5-6+~-9F^6tV<=5`FcY~t{iqRcncEU+F zkT~jww!oy(@~b~WGI8!lzjURX&IpJjFGxShOKUunP+rW$I{c|x0qM6!Gxf6n(;$D> z+QYiULqq)Fy4VDk&Mev)NyM@nvF z7O6M*A$C)kBi0HGMT_+xfQ^USTM)>*h_Rx%eSRxA%n|FuC&=F=Pz}E5uCqbcy;7j=%Qh`glqEA-jx0(a<)uKO5Fe|JLD-ndZ-vnW`G=O&^%pa}Ah(2%m?oANs{lJ`?RhrZ8n!`Q97TKw{YAw9 zD)=M{mD(~_jj`LTd%q6Veum)Cnd!7lw}(5h%ubHcg^2O`prn%u9es3C#&%TsnmSD3%3Ik^Yd@6-d%(I7kqT(B@dVX2 zIidXgd>qYT-oTZ=1sGI7^*_E9Q)1F2mooE0R zXopPnh^ci@+wz2ZDjo&Owyxh6t90Gt!u0miLxc!bue^LvHF?)O@Yf!dQUXfW$u8(f_n07^N)-vpIe;TrHv5uKm{h_v`-IN^zwWc>Lk ziGsSr89sDcdOR_wa~DjrqV&Nd*$18(vohPJ3hSzEJPF2d!u}415wrSMtS(zNa7 zbO0G4ajgKNp{`D7DO<(T?wowarQ0dIKLb<}#prQM)ytB73YNTPQgX^xoT zm>;yKSJ*c@QfD8HW`6&+mowOaA|A&~G0fO6&xwj;E3O9^Zu~ZXts~;-d%FyyeXrijORi<_S(dw_5@h&-fTY?#FJo% zQZZ1&ED%$if+n8JVM{s-ZoK@P>p@z4s`AoI6hYxE!Ie_Y)cpjZjc8@~uNMYVfy#J$ z)+sdEX7DK^{}kUAST8U6^p6#c>0Lc>T~9`0}`*2 zizaU)TFS4(u;BenUWZr?s{D)Z)rc9L5&gUvz3iSQaF#J)D)Ts{YgagdDcI1S`dtes zPqb4|h-RIkjhnpmn(Q2Je6Di5C?MkCUL)!WoKn|P#al41v#-Q8`K1$Gh64UhPQj|T zaZb%tJ}O{A?Cvl26!jeKS3OUkp5@8RDBYwh`Loxb5W<^m*R37+v}#*m-G{{ocF-#r z7!k3ZS^4Qu9sNRNZ3`laW2TqV{rsR#~gtVp6C zL0?}~gbLTv^jqtPQD@Cpq6{B6v&*Y)?tx})z=qQNB4Z_59 zpI2L)xQ`!|J8wWgs82jSw_8(;#}y7~Y^&hY9P1G)@`CGtIi*tZ%-%&;$PuG(!M%)E zQ?T#imBH8dCZxUBX^RWPwIh9LcnL3#$befQDr@UJl{=}o0){qIt52vU9X=3L_gvVW zPqp_YhhpM6XiE7Lvn-G0Wzo>0;g|$_-7|ucz~*w%bW@hr6M?~v9dT}L=>UotTj13& z?Uvt0_uOvzMq4iG6)gZqeU;W=P@EVod;}Vr7P*@=C19v;iz$4N+c5ewauTtKK5e;yIx(FQUec0 z`G)VlTUY|m2L=KusMRgMlapu#wt8MohK3=y`!J`tD6nYd%?xIZO`Q)skL)R%3Vf(P z__5Sx3h%fKF=sNdZo2p(w=_|}1M%ri7fO?8))sU1ySG;M4p4;zrr}4l0lzvA!WQ&a zrwX>%lJkv`Gr_u=K>kHOg6(AB(R3FOryElY)-vi|fRsBS<)$1;TC_?BnyScjY6>_ZD=T|bjcbjz@D6V+yfHd4SU+J*2Dh%n;$5ou zHh6R=)$>IH@%5js2KH#JkfFCVI}P>~U;|}>kk|06tA}^~B;|gJ$UvSF-l4GX43DAR z&M2mp8OgiTaK4li0|Q2qmGNYsm+Qq^JM8yfCP>5!31rjh4Mnq~+5X8+_$scfP1Fp!c zcQO*#6cfJ?ZRxn_$Se_|}Xo1oIF7s(7CllypCW@W8-y5%Bel_K*0G zd~8UWeYCWz>~^hF3ond|tQcClJ(8^9FW&&?U)a4O-pE;Y*u|FHGax>F*Kg_beOF5c z&?#xRN5Q?ckEwCnNr-${XC=w-te5%QH(6O~yxke=R!_ns))PU07Pu)CY`<>$+XicZ zCI=g^;q7NZnw=-vf;HoWLD+}`&Bph>kiqyX5jxjI1A41d$R3nahq@CHULV#9ItIwJ z0)^JGy{hB;@SD|}Zel8~2z;UjN96MR@dt;EV`9RP4X&zn8ib=n*107cICSp7z6srZ~4Qg|Vp$OB0By{IxAPaD7HGFw_HTza~wWN1A6 z3`7BZFse2a4{y#V^&;nRVcZOz*2>A?jm$%?)KawLR0cEz24qxxOOo9_2)9MrWpSg7 zPiPz+M7(zPRZ3$#11ti?uI!}bM!Dg%L#+uR+^2L2RX+QlMpL zg_DrR=GIT7C~b+^OZK)?l7*9c-78zWVbLo1oS}bItdscuF80}guwA8c^(47DfaBjV z^V@&JJHxYHqS+e7&X;ezZwsE2+t~n0?*m^(db@WnI{LgAnOqOa<8pRvo0E>*O&~J_ z&A)t2LOG)5=3$3n2_gi2Kpvgv)#LCUh2Y~ z!A&(~-8reT$sJk0=L;m~ES3k}k% zkF%gzzT(+nRU0IeUvuW8pq=8uzr&7HW>K5ZiD*8qL17AI^ zGqo>*mvIChU6+&t{A3|!W?~pi9_O$>k2d|#(Z721wcT{S1)_UFZ+}QS^KZ*u?5Y~bz z^cLI;2{$C_ZwWqM@sYMYwG+^N<^Ivq8ZOwV;7xT+WCh)I9PHC}ut;VNr?w z<@?HsG!Qg3zaV+-xQ3ldtad!U<6iGz_enGH*2akP_r)o1D&8p^5M)_c8IIj6Wy*7HJo&CBLuo~nj>(63pZzO(Vv^ZuB3 zMYigjkwA;FEy|G}1jpiMj6|NTm7Uyiw=@FDE*nX<>jR!W@9XIyf%$Fd*J5*D0Z0Lm z9}ZQxyT|x5ftNy?V>EbJz-K>bV9gs9RaXUP<^=;e?&Fqxj;6{ieR-a-@HycA1KMKhql8GOmcxwZ?_-(3hMK^^a*(gaFvBH ziIC!fgH4$W*NbKIaY&T?%&13``KbD@S-0`xQ%v3TV+B!;RC7O!+1a9QCA$H@3tR;k z)SSoR7(s4)f{zM}eWgFN{(ZH5d1O}l)f$ruT!)Q&NImXyZsTzOf9TwctcSfr+M)aJ z5otO+$jvm-P4)ykH)x|cO5xeb>?!`qGw$(>&axqLL6yoB${vsMXgL_-bz@2J_tS92 zdvZG-+vKl@K4Vr(EL{WQt@Z+Ea-hxX0}nTSZxnpi^#Kn8Ox8FgIS|hc}KJQ4tm*HO16ui{(O9} z1YN)GjiQt6fGq`Cj+^`zUf?8hk^(T{{cOQGWFP98am}is28A!5%{R#ENv8fCN!j69 zlMEK(2z?|BY=Je$XD9mB-Kkem*(d-j^9j$2#6r$Dz?s)-TCDCGCs z8>6Pvj{Y+YIeFA@qY22V$)awy@q!9A4rgk5b9TcC;s9Ig^G|6nDP+5=Fzg&?(L=vc zCbGd>fSu~@6!94td+o#d@sid!EIX$rx7*cawe6 z`dScJ+$HssdOjE)O#Ybs56vm-FQ$7yuJJD^Zqk%hMaIgAJ<2yb_MFQte_i;62ScT$ zpjifYyR_E=rQ+>H)pmlr-Udzg*-!|ssw(D7wJvC+Sf8bb9;;q8#z?0p!!bsd{wy|5 zpBaMHE-Ve>i#LLjHRaMLtp%9&(HCng7Sw96jVv!#0k%?F^K7&=T)mnYn)D9(i;4x5 z^NJTJwq~pv;kH@#ejTd*48~(J(r6j34|m`h9fEDj0im)~+%I5XphWymhT;_Zty|Q& zzjPg#-ufAHZ1M*Gccw?Kf|8Pnhtb0`!{N`Bqsa37J+>wC$!e z00k+2Egzz;rbcWoUB%Jvp8W1}$XD%e3>4y;;OZ1ccT-O#uW6Ys@C}Pa`nZrNKzR(2 z4e%3)@QI4SE&E!lW`5y14QhbepBG%_XBV-O(%5tj)@9#|;sC-MNev!zGDHk}JdpGC`iJF#8=8-P$Xoku_=Dw%Cv3{U7L>gf zRQ?<$t`cZ*MP5GQmbmx#!+*!zu>0MewRO9GFGS{b^m_fJ-N0?j@EqoFf>$khj+E|@ z7r3We&^tR^YZrxKe*d22agXqCO0l44&kqCv{u)T|(lv`~PK@DvE z{QI_TlCH5z*gR!>LO)k67{^R+vWx24U2^2ODXpwT;6y+6+$5m)_*w4WY&#do9dCeE z)>p+Ykdhq($DhmMiaYXey!@N%L26uz($aJ!QT{B^Wu}U$^9e#5)=c+XF9@Ill?ZmM zlNgHiz*9!vDc&uxOo;ZVxb`Q!Sk0*gnfxWzmbZh4(=%CD%qP?0=);n$&zaW_$UKV9 z8axdcN#AyZ{P)wj?V{P}vM)YY!>6@}^>U+iv$`9>nMTCPjN>z%yF&3yf%>+T@0vh4 zlC8Xa6zeo?%=o3}M8{aebLHcO{^1Ar8qiM=Gquf?Jo)q5`-+?sUpg?QXyEUpWSm+n z$K-UyqkIwHLquru~o(OF)hhz$Y*|X>ZIbswnxRvr~ z2=rdOGVuD|xRlpAZE<0!X1F(%Anpl^@V^D3vbM}qxe|NI;TTiZy7(IM;R69RkA>a& z6gwYE2sREzQ_LHmWqB+ogMk(fMaSFeoDq-!HkFB_nXt5+2ncFuk9BQL1I&oB1zZi) zYW{6_&-Ip1l*OVRA##1ILQS;5R{-K^0wGTiJbVSi@LA^$D$;@J>^G{6@&+%4{b3(s zC~LEHiTv(0b#zxt?YJ0r_~pUZM~mQ(??(n#>&tD%+@nq=Abj5*8R!~Ul1`G~=qFJ4 zfl|m8ZDCYgtr`4LcOpgiJYX9qRY5;DcWti~PmS$VB$E-Zt^f4)vLDOe_3XTq5^ylW zJ9PKm!V-8sAOJXnUfuFNIf0R9tK-pNs2hO04zr620}5B(Ok>yB)Of-3sP59qfQNbm zA4{w!2@cB;GbR(~szVrbO%(w=5S!X`o@o@x++wbN_tMPT0Vc)*I;Fgsbf^*g0 z2Di?HTApwKq3+YwfNsqd3iP%{hyK1iyuVZc@*0tO_3+N0#GFsz>8MjeJ2UJ%L!%hi zGYYAthH`E+ywA*u{(eJ=ia3h*%k?779rk-K<0VZAPkl;TFUbmei|$fqWO8!_zIvqt z$ly$VrlH46nnpX~X5Yk0iBJl;=WuA4>~X4-f&K0yWf42h&0b30t@NYX$7egQ1Fp!a zbui-D6cWCWV&|R1CY@G8(qOmWjWeX3eX7UggZPGimA}soOuQdXe4uZ#2>5zN>qlI0 z9xk}lE=tNpX1m6*nFr2EQ3xs79!^sCldDJYE$m(qYv3q7>}1R7?iZW7>$~*%zKaC| z=$N?ME$>#+%T&MZC`dW1wUl6Z)JgyCn~V%K&i0H|iwE%$>xsZW3tTfZxIUePci@p;cRu|d=ItIwF z1clVHy{hH?@SD|(Zfqi^0DQ1hczHN7xq85h)rzQqLHMX2^IkuK7FB!kI40s$|CY7~ zNX^{_UjN8}L%Med;|+=4RNTMozn8KT;2tb77bUPCmioh+rZBfIiM6f_P34cQ__o1G zWqQp3VL~~pE5?qODf%iiQQ3f42YF@09tQ*$4v_EKUx;t1KCPCBtgqg z@+Tn;O)a0uky_%jm+WjNB?=~VyH>V#L!*=l*@OS6SVyt_UEH&NA=?V2stHPyKkVNy z&jg<#cjros){#ji)dK z%)We0L_478=HZ8-@xnwsKrWs8)x`MB;(Y`Cmu2c-&SH(vN-F(*e`l?c%+l$|y_AJJ zhcDGnwLvN+bu;_sX|1AiePhx@u&%P$hf*xE+O=~D?_(_KGWQ!158YL-y9$*6mmPo;Rp*Dl5lm-mVM2i`h- zM@nxv590_tvMwPD_{l=b$iOm|+|S{D9&P%zeT$GgX6Akl-tfUF>tL@Ld!B&{pN39t zH>3Vhqkr}2Yul+jb7UiouWVGPNsxX7Ueba+9|~dz?d*QM$ng0DZfO0`7fAy?2yMm| zcnRzUhZ&IcwgjH9cuU!w+VStYa{p*)4IgBf|E8)sqMYtB2KH_}SfsFq(c9i(Q6S3U oBo%DI*Kv;w;*%(i9W@f3_WCF#rGn diff --git a/ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png b/ui/lib/jquery-ui/css/images/ui-icons_cd0a0a_256x240.png deleted file mode 100755 index 2ab019b73ec11a485fa09378f3a0e155194f6a5d..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 4369 zcmd^?`8O2)_s3@pGmLE*`#M>&Z`mr_kcwz5Nh&gy7G+@45H9p05OJ)J0CH2owMSaGIN$+5!N; z<11j56?ANg=9hMl-IBGX-T8hf$N$b*H?$f4Xt&I`oABt1nR=k%#z{{*a!Axm|t}hCz zJg0Ln7;M4Zjx{$mwhMW+kWN;|j>qTx_-zNX!GzqEZRa}QF8_0yk6+=w}$QD^&hM4%OkT=uh$q9;5u~NL-I+NQyaVc|3l+iWI5~|(hA-G z08i8AMr@{uY_cWTxo^y|Qyb33mlZLvc7H2Zm~>mB7&=-1X^@|D z&0*~i?GBE&NM(Pv&Vt^zWu_bD3e|R?wTL{cSFwD^Ij9v%g=aLY@1U2Bxn#Te*{>%D zOOW-O-bfnJ7T8jd<*>8`Z2DsFQi~S$%^npJwXam5>>p zMd}QEjM)@~##n$LXpz1Hkl|2UGXi-JFFePXBWL+-5f%!S>L#KL3>Vl0w#d^21Jn<~_7q zWx^Xg1(>PsPGO&cu{S;(pRQ;=Vw2J<9NdQVWx<+g-`ia=Q@puS)75M+?u>DTa95e9 zt#1T?#a)uWC>Mia!K6>g|InPW{&Kp9$tC_3*;R_Xsz6^Eu|xW1$6j#0?XLs7^l+%O zlxddE)h^|=K(2UqS*0ECuDe0ic|H_^t*VOoTCKx0Qmn_^LyJ|b8l$Jvl3{2=3x8&7 z$1ik&YG>w#@x@y~$r`fhlUDo;yXecc6$`30m`3K8s{k8G&3RVp8n#|l6h(Xw`Axw9 z%6Y^J6k0P@4YAuSd%q7=eg)&u8EMoEmq$CWj1GY|rGQWw3ida!FHk&wCqrQh_0Bcw z!ZBS3CbxgZ+}~wzgGIQ#QId%T_TE~_qdUqxjqS#8#jPxdwO@(@-5_nSP&uT?aGYYD z6km36K9=gjUjImwO=5Hl#u85VF?r0HbW)#h^SR|s_L47Tl$&Z&Rz*ksl!t*(2O2;D z+8`6$qpLn}LchhCmv*X}moGMX5?F@juGeHQAddAn}0~r zS_0|d3*0v%Y)8+8K{ zGyoYPb|W9Grm9M4E?vb^@16ePbI4omZv+(NoZ##fLUmKlB(G_jEbtDCM*27t$v`JovAZa+%*Q5dDXF*Ftt*n!O>#ohCM4lZ)h5rdKV-3A za}2AO6@!`W>ROk5FN*>2Zza^Z%}8KT%*jBGH|rml2X1LR{wZhWx8V4>|5i}; zMnLIHn3!^)`87GYh}&Y`KMwyLbA#^pch}Z!`@P_qH&N^LS9SxpEy8mc!wFusq&Z@` zeO}<6PC@VNaII|=n(^cNUiLseig*$;NjG7;IwvfYCBN>kzv@v-V2eBQZ@oIs^)NLqMR935k|1}U;5<{s(Ebdj4r`?QtrrAPfQooq zmPs_(YTy|??+nitNIFDoR7~qLPPFFCf^_~8OUt{#!|9o*3Q{!@9ZAI$7O~piD!;WX8#v&RxNH27i59$`1{o zEYU_zE{bKEI%f3BbE0Fc;f2!4LjUlC`wgh4@R{1?O78r5t$hWKiLV{#QWWq{QZiPx zm3?x$;&DDRVt0SByRiFczw$-e)GSvpCRbzk^=E zz=(+LjEc{Ps_2(OYg=G(93!oS=IeJ|WA8STv+LgI*Oj1c-QC06N~mvJ&KKx{arGp5 zswvJ6{%BvBYo>#2$%O$~TITuh?Rr^jCpAUXh)}m74`O|aOU>w2KI`k<#efwa5=-l4Xx!o>Z9Evg`RLN5W7SQp3$@D3_hY4EV!0( ztMm6>zBcgY{RvHZ{9Ey&&)jr2B4s0qDPBUh1ITaAp&>rj3ng*B=VGXz* zs@eR<;J(XkpD6Q1U3}#FR)wlafiFMU(-=&e9(eQ`isrS-9aNwJ)7frS8RiXM4*SbC zL|4*c?h^jfYvSOpn%Z$W?C|TuZ;uy2pFWHXuGW`ZkGV&kPJsKqJJQ!NswAE!!cb2k zumi=AE$YIkm})cVlg>nn&PBjBRI*@mfhhRMsa5U8k#A!ztfiw)d7I_UyAif8$5sJ9a7WUv5!o%fL z(J7-8EQzv1YIc)BNeWkLK~m%y4vqe&q@|_ZR5;eC3-9rkf*T{_19jtuWKhdW4Bn|~ zZ-YyFLN!k)0AKg{dO)|v3K?=oy+dzb4%T1F4}JsByncB1Z(`2p@O0!E!JQelouN^* z%Q^YfQUh66D$Zx-RDZvLctsr9`_+1p#tz&4SMd@i_-8()tyg3OyhU~?Gt#-a{NKFN z0VGf+AH%@o6;-_*?$$T4QX-f_>Ny-5CV8Ccq+@>gNSeovbFr0@b}RiTcJbLx>ws&r zsvY!rR{4al#MpVKut~?&kTmF>_v3UaC!gvuxgg%5-{l{20}~&F6CUarF9N=u)BG71 zoQDlAwT+T=mfo&$Xy%4-kmW;4wuh6{{ABClybHV6L>t&k4?9_Ny8A_^?)ff#dEjhL z2RbC~cFVbz^fJ`$I0%prYc0g-9(7X3eUp}^#Mzv)Z1EsGW;qr3cY$+e2HU5d_O9L% zpbljP*1!A0PqpzNo3W&y(hD87qgweq5YQWYEkxrOuSain2-q@Z*P`x*ht-9)Fr5Ho zSTKduvc9h6`S^#$i)LgjDi3_PQ+RbaGP!!di^Y;4kB0lGo$y{if)rJIaXTbpRgO#B z1El6|18;s}$0FRjgK-7~ZwmI`_1{a`32+Y>&O_iTpm%vz6hNkjGR(#*! zpfJ2>OAQbTFba9S3j9BlRHXaG{)Zt(J<3ppA?}j+7F#{bV{M7zU)5e@~R&J_xf$+GKK~ z3{R;Y9fZGe^ifEqKL;!VMXv26=R~^TG(#*2!JKCWoo&c^$utAs#Gfq-?t!c&9TH5- zj&i5L4NWbdNs*djvsY}bC&ddUbh=iyc0;3-@Y#d^s8|Ql{ax(yenFcG#i|K%lRxy| zFys4w!@EPXp2AsbMUGc*eP|7uliAq-O6~(+MR>V(EZTd&9G+MY&gF2lZ=I8j*o`OC z`AxrmOGMeD=H_9Cq47clT|h34>-EI=%;E!my;o&wU(aKV&PymBzrV9q2uA62XS@JrjKYANZAU>;8mag#BU?Nv`+ZVhlAPV`HF_gKY_O zhbV2L`8qvR&f=@M5vH~geD+L&*L2s<)|5)clA0yt9TM{X)iWtx@wJO_!{vR#|AD6t z*OAg2&P_i8jjW5y0DdtOGcqvrCHD*1Uq_q1ZQmngPnf!2fHizH%sSX>#$2Rh!>1ur z+s(*-)abDuePc6~XNG8m@|KMXHVM#G4?~+V z1z!An!D0GD-7WqXE8ddUXLkI%u01$fTEhhy - - - - jQuery UI Example Page - - - - - - - -

Welcome to jQuery UI!

-

This page demonstrates the widgets you downloaded using the theme you selected in the download builder. We've included and linked to minified versions of jQuery, your personalized copy of jQuery UI (js/jquery-ui-1.8.14.custom.min.js), and css/custom-theme/jquery-ui-1.8.14.custom.css which imports the entire jQuery UI CSS Framework. You can choose to link a subset of the CSS Framework depending on your needs.

-

You've downloaded components and a theme that are compatible with jQuery 1.3+. Please make sure you are using jQuery 1.3+ in your production environment.

- -

YOUR COMPONENTS:

- - -

Accordion

-
-
-

First

-
Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.
-
-
-

Second

-
Phasellus mattis tincidunt nibh.
-
-
-

Third

-
Nam dui erat, auctor a, dignissim quis.
-
-
- - -

Tabs

-
- -
Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.
-
Phasellus mattis tincidunt nibh. Cras orci urna, blandit id, pretium vel, aliquet ornare, felis. Maecenas scelerisque sem non nisl. Fusce sed lorem in enim dictum bibendum.
-
Nam dui erat, auctor a, dignissim quis, sollicitudin eu, felis. Pellentesque nisi urna, interdum eget, sagittis et, consequat vestibulum, lacus. Mauris porttitor ullamcorper augue.
-
- - -

Dialog

-

Open Dialog

- - -

Overlay and Shadow Classes (not currently used in UI widgets)

-
-

Lorem ipsum dolor sit amet, Nulla nec tortor. Donec id elit quis purus consectetur consequat.

Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci.

Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat.

Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam.

Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante.

Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi.

- - -
-
-
-

Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.

-
-
- -
- - - -
-

Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.

-
- - - -

Framework Icons (content color preview)

-
    - -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • -
  • - -
  • -
  • -
  • -
  • -
  • -
- - - -

Slider

-
- - -

Datepicker

-
- - -

Progressbar

-
- - -

Highlight / Error

-
-
-

- Hey! Sample ui-state-highlight style.

-
-
-
-
-
-

- Alert: Sample ui-state-error style.

-
-
- - - - - diff --git a/ui/lib/jquery-ui/js/jquery-ui.js b/ui/lib/jquery-ui/js/jquery-ui.js index 7ec85a5741b..31ee9cd8116 100755 --- a/ui/lib/jquery-ui/js/jquery-ui.js +++ b/ui/lib/jquery-ui/js/jquery-ui.js @@ -1,789 +1,16617 @@ +/*! jQuery UI - v1.11.4 - 2015-03-11 +* http://jqueryui.com +* Includes: core.js, widget.js, mouse.js, position.js, accordion.js, autocomplete.js, button.js, datepicker.js, dialog.js, draggable.js, droppable.js, effect.js, effect-blind.js, effect-bounce.js, effect-clip.js, effect-drop.js, effect-explode.js, effect-fade.js, effect-fold.js, effect-highlight.js, effect-puff.js, effect-pulsate.js, effect-scale.js, effect-shake.js, effect-size.js, effect-slide.js, effect-transfer.js, menu.js, progressbar.js, resizable.js, selectable.js, selectmenu.js, slider.js, sortable.js, spinner.js, tabs.js, tooltip.js +* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */ + +(function( factory ) { + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define([ "jquery" ], factory ); + } else { + + // Browser globals + factory( jQuery ); + } +}(function( $ ) { /*! - * jQuery UI 1.8.14 + * jQuery UI Core 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI + * http://api.jqueryui.com/category/ui-core/ */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); -b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, -"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", -function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, -outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); -return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= -0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + +// deprecated +$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); + +$.fn.extend({ + focus: (function( orig ) { + return function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + orig.apply( this, arguments ); + }; + })( $.fn.focus ), + + disableSelection: (function() { + var eventType = "onselectstart" in document.createElement( "div" ) ? + "selectstart" : + "mousedown"; + + return function() { + return this.bind( eventType + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }; + })(), + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
+ value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + } +}); + +// $.ui.plugin is deprecated. Use $.widget() extensions instead. +$.ui.plugin = { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args, allowDisconnected ) { + var i, + set = instance.plugins[ name ]; + + if ( !set ) { + return; + } + + if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } +}; + + +/*! + * jQuery UI Widget 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Widget + * http://api.jqueryui.com/jQuery.widget/ */ -(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, -a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; -e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, -this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, -widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, -enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -;/*! - * jQuery UI Mouse 1.8.14 + + +var widget_uuid = 0, + widget_slice = Array.prototype.slice; + +$.cleanData = (function( orig ) { + return function( elems ) { + var events, elem, i; + for ( i = 0; (elem = elems[i]) != null; i++ ) { + try { + + // Only trigger remove when necessary to save time + events = $._data( elem, "events" ); + if ( events && events.remove ) { + $( elem ).triggerHandler( "remove" ); + } + + // http://bugs.jquery.com/ticket/8235 + } catch ( e ) {} + } + orig( elems ); + }; +})( $.cleanData ); + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + // proxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + proxiedPrototype = {}, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( !$.isFunction( value ) ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? (basePrototype.widgetEventPrefix || name) : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); + + return constructor; +}; + +$.widget.extend = function( target ) { + var input = widget_slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = widget_slice.call( arguments, 1 ), + returnValue = this; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( options === "instance" ) { + returnValue = instance; + return false; + } + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + + // Allow multiple hashes to be passed on init + if ( args.length ) { + options = $.widget.extend.apply( null, [ options ].concat(args) ); + } + + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} ); + if ( instance._init ) { + instance._init(); + } + } else { + $.data( this, fullName, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = widget_uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( arguments.length === 1 ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( arguments.length === 1 ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled", !!value ); + + // If the widget is becoming disabled, then nothing is interactive + if ( value ) { + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + } + + return this; + }, + + enable: function() { + return this._setOptions({ disabled: false }); + }, + disable: function() { + return this._setOptions({ disabled: true }); + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^([\w:-]*)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + + // Clear the stack to avoid memory leaks (#10056) + this.bindings = $( this.bindings.not( element ).get() ); + this.focusable = $( this.focusable.not( element ).get() ); + this.hoverable = $( this.hoverable.not( element ).get() ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +var widget = $.widget; + + +/*! + * jQuery UI Mouse 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js + * http://api.jqueryui.com/mouse/ */ -(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ -this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== -false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& -!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.14 + + +var mouseHandled = false; +$( document ).mouseup( function() { + mouseHandled = false; +}); + +var mouse = $.widget("ui.mouse", { + version: "1.11.4", + options: { + cancel: "input,textarea,button,select,option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .bind("mousedown." + this.widgetName, function(event) { + return that._mouseDown(event); + }) + .bind("click." + this.widgetName, function(event) { + if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) { + $.removeData(event.target, that.widgetName + ".preventClickEvent"); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind("." + this.widgetName); + if ( this._mouseMoveDelegate ) { + this.document + .unbind("mousemove." + this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup." + this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if ( mouseHandled ) { + return; + } + + this._mouseMoved = false; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = (event.which === 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + that.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) { + $.removeData(event.target, this.widgetName + ".preventClickEvent"); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return that._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return that._mouseUp(event); + }; + + this.document + .bind( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .bind( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // Only check for mouseups outside the document if you've moved inside the document + // at least once. This prevents the firing of mouseup in the case of IE<9, which will + // fire a mousemove event if content is placed under the cursor. See #7778 + // Support: IE <9 + if ( this._mouseMoved ) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) { + return this._mouseUp(event); + + // Iframe mouseup check - mouseup occurred in another document + } else if ( !event.which ) { + return this._mouseUp( event ); + } + } + + if ( event.which || event.button ) { + this._mouseMoved = true; + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + this.document + .unbind( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .unbind( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + ".preventClickEvent", true); + } + + this._mouseStop(event); + } + + mouseHandled = false; + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(/* event */) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(/* event */) {}, + _mouseDrag: function(/* event */) {}, + _mouseStop: function(/* event */) {}, + _mouseCapture: function(/* event */) { return true; } +}); + + +/*! + * jQuery UI Position 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Position + * http://api.jqueryui.com/position/ */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Draggable 1.8.14 + +(function() { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, supportsOffsetFractions, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+(\.[\d]+)?%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function getDimensions( elem ) { + var raw = elem[0]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( $.isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
" ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-x" ), + overflowY = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowY ? $.position.scrollbarWidth() : 0, + height: hasOverflowX ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ), + isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9; + return { + element: withinElement, + isWindow: isWindow, + isDocument: isDocument, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + + // support: jQuery 1.6.x + // jQuery 1.6 doesn't support .outerWidth/Height() on documents or windows + width: isWindow || isDocument ? withinElement.width() : withinElement.outerWidth(), + height: isWindow || isDocument ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[0].preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !supportsOffsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem: elem + }); + } + }); + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) { + position.top += myOffset + atOffset + offset; + } + } else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function() { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + supportsOffsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +})(); + +var position = $.ui.position; + + +/*! + * jQuery UI Accordion 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js + * http://api.jqueryui.com/accordion/ */ -(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= -this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= -this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, -_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= -false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| -!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& -a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= -"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), -10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ -this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // callbacks + activate: null, + beforeActivate: null + }, + + hideProps: { + borderTopWidth: "hide", + borderBottomWidth: "hide", + paddingTop: "hide", + paddingBottom: "hide", + height: "hide" + }, + + showProps: { + borderTopWidth: "show", + borderBottomWidth: "show", + paddingTop: "show", + paddingBottom: "show", + height: "show" + }, + + _create: function() { + var options = this.options; + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ) + // ARIA + .attr( "role", "tablist" ); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + + this._processPanels(); + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + panel: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-state-default " + + "ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .removeUniqueId(); + + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom " + + "ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeUniqueId(); + + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.element + .toggleClass( "ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); + } + }, + + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, + + _panelKeyDown: function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || !this.headers.length ) { + options.active = false; + this.active = $(); + // active false only when collapsible is true + } else if ( options.active === false ) { + this._activate( 0 ); + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + // all remaining panel are disabled + if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) { + options.active = false; + this.active = $(); + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + // was active, active panel still exists + } else { + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + var prevHeaders = this.headers, + prevPanels = this.panels; + + this.headers = this.element.find( this.options.header ) + .addClass( "ui-accordion-header ui-state-default ui-corner-all" ); + + this.panels = this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .filter( ":not(.ui-accordion-content-active)" ) + .hide(); + + // Avoid memory leaks (#10056) + if ( prevPanels ) { + this._off( prevHeaders.not( this.headers ) ); + this._off( prevPanels.not( this.panels ) ); + } + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(); + + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ) + .removeClass( "ui-corner-all" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this.headers + .attr( "role", "tab" ) + .each(function() { + var header = $( this ), + headerId = header.uniqueId().attr( "id" ), + panel = header.next(), + panelId = panel.uniqueId().attr( "id" ); + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + "aria-expanded": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-hidden": "true" + }) + .hide(); + + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-hidden": "false" + }); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split( " " ), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } + + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr({ + "aria-hidden": "true" + }); + toHide.prev().attr({ + "aria-selected": "false", + "aria-expanded": "false" + }); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr({ + "tabIndex": -1, + "aria-expanded": "false" + }); + } else if ( toShow.length ) { + this.headers.filter(function() { + return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow + .attr( "aria-hidden", "false" ) + .prev() + .attr({ + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + }); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + boxSizing = toShow.css( "box-sizing" ), + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( this.showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( this.hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( this.hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( this.showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + if ( boxSizing === "content-box" ) { + adjust += fx.now; + } + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel; + + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className; + } + this._trigger( "activate", null, data ); + } +}); + + +/*! + * jQuery UI Menu 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Droppables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.mouse.js - * jquery.ui.draggable.js + * http://api.jqueryui.com/menu/ */ -(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); -a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b=j&&f<=l||h>=j&&h<=l||fl)&&(e>= -i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + items: "> *", + menus: "ul", + position: { + my: "left-1 top", + at: "right top" + }, + role: "menu", + + // callbacks + blur: null, + focus: null, + select: null + }, + + _create: function() { + this.activeMenu = this.element; + + // Flag used to prevent firing of the click handler + // as the event bubbles up through nested menus + this.mouseHandled = false; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }); + + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } + + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item": function( event ) { + var target = $( event.target ); + if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) { + this.select( event ); + + // Only set the mouseHandled flag if the event will bubble, see #9469. + if ( !event.isPropagationStopped() ) { + this.mouseHandled = true; + } + + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) && $( this.document[ 0 ].activeElement ).closest( ".ui-menu" ).length ) { + + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + // Ignore mouse events while typeahead is active, see #10458. + // Prevents focusing the wrong item when typeahead causes a scroll while the mouse + // is over an item in the menu + if ( this.previousFilter ) { + return; + } + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.find( this.options.items ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" + }); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( this._closeOnDocumentClick( event ) ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + this.mouseHandled = false; + } + }); + }, + + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).addBack() + .removeClass( "ui-menu ui-widget ui-widget-content ui-menu-icons ui-front" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .removeClass( "ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); + + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); + }, + + _keydown: function( event ) { + var match, prev, character, skip, + preventDefault = true; + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + match = this._filterMenuItems( character ); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + match = this._filterMenuItems( character ); + } + + if ( match.length ) { + this.focus( event, match ); + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } + + if ( preventDefault ) { + event.preventDefault(); + } + }, + + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.is( "[aria-haspopup='true']" ) ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, + + refresh: function() { + var menus, items, + that = this, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); + + this.element.toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ); + + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-front" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.parent(), + submenuCarat = $( "" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); + + menus = submenus.add( this.element ); + items = menus.find( this.options.items ); + + // Initialize menu-items containing spaces and/or dashes only as dividers + items.not( ".ui-menu-item" ).each(function() { + var item = $( this ); + if ( that._isDivider( item ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); + } + }); + + // Don't refresh list items that are already adapted + items.not( ".ui-menu-item, .ui-menu-divider" ) + .addClass( "ui-menu-item" ) + .uniqueId() + .attr({ + tabIndex: -1, + role: this._itemRole() + }); + + // Add aria-disabled attribute to any disabled menu item + items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, + + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + this.element.find( ".ui-menu-icon" ) + .removeClass( this.options.icons.submenu ) + .addClass( value.submenu ); + } + if ( key === "disabled" ) { + this.element + .toggleClass( "ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + } + this._super( key, value ); + }, + + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + focused = this.active.addClass( "ui-state-focus" ).removeClass( "ui-state-active" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .addClass( "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.outerHeight(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this.active.removeClass( "ui-state-focus" ); + this.active = null; + + this._trigger( "blur", event, { item: this.active } ); + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( ".ui-state-active" ).not( ".ui-state-focus" ) + .removeClass( "ui-state-active" ); + }, + + _closeOnDocumentClick: function( event ) { + return !$( event.target ).closest( ".ui-menu" ).length; + }, + + _isDivider: function( item ) { + + // Match hyphen, em dash, en dash + return !/[^\-\u2014\u2013\s]/.test( item.text() ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); + } + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .find( this.options.items ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); + } + }, + + next: function( event ) { + this._move( "next", "first", event ); + }, + + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.find( this.options.items )[ filter ](); + } + + this.focus( event, next ); + }, + + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ) + [ !this.active ? "first" : "last" ]() ); + } + }, + + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ).first() ); + } + }, + + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); + }, + + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + }, + + _filterMenuItems: function(character) { + var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ), + regex = new RegExp( "^" + escapedCharacter, "i" ); + + return this.activeMenu + .find( this.options.items ) + + // Only match on items, not dividers or other content (#10571) + .filter( ".ui-menu-item" ) + .filter(function() { + return regex.test( $.trim( $( this ).text() ) ); + }); + } +}); + + +/*! + * jQuery UI Autocomplete 1.11.4 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license * - * http://docs.jquery.com/UI/Resizables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js + * http://api.jqueryui.com/autocomplete/ */ -(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, -_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d
');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== -String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= -false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= -{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; -if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, -_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, -{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: -Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= -null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ -c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); -b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), -10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- -f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? -e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= -e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, -step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= -e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; -var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: -a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- -d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, -f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, -display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= -e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= -d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); -;/* - * jQuery UI Selectable 1.8.14 + + +$.widget( "ui.autocomplete", { + version: "1.11.4", + defaultElement: "", + options: { + appendTo: null, + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + requestIndex: 0, + pending: 0, + + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput, + nodeName = this.element[ 0 ].nodeName.toLowerCase(), + isTextarea = nodeName === "textarea", + isInput = nodeName === "input"; + + this.isMultiLine = + // Textareas are always multi-line + isTextarea ? true : + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + isInput ? false : + // All other element types are determined by whether or not they're contentEditable + this.element.prop( "isContentEditable" ); + + this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ]; + this.isNewMenu = true; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + if ( !this.isMultiLine ) { + this._value( this.term ); + } + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + event.preventDefault(); + } + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + }); + + this._initSource(); + this.menu = $( "