From fcbf00e84510737863c72f1bd94d0f643a0f3ab3 Mon Sep 17 00:00:00 2001 From: Pranav Saxena Date: Sat, 29 Dec 2012 00:53:18 +0530 Subject: [PATCH] Jquery-UI version upgrade from 1.6 to 1.8.3 development --- ui/lib/jquery-ui/js/jquery-ui-old.js | 789 ++ ui/lib/jquery-ui/js/jquery-ui.js | 15656 +++++++++++++++++++++++-- ui/lib/jquery.js | 10512 +++++++++-------- ui/lib/jquery_old.js | 8936 ++++++++++++++ ui/scripts/cloudStack.js | 2 +- ui/scripts/ui/dialog.js | 2 +- 6 files changed, 30124 insertions(+), 5773 deletions(-) create mode 100755 ui/lib/jquery-ui/js/jquery-ui-old.js create mode 100644 ui/lib/jquery_old.js diff --git a/ui/lib/jquery-ui/js/jquery-ui-old.js b/ui/lib/jquery-ui/js/jquery-ui-old.js new file mode 100755 index 00000000000..7ec85a5741b --- /dev/null +++ b/ui/lib/jquery-ui/js/jquery-ui-old.js @@ -0,0 +1,789 @@ +/*! + * jQuery UI 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); +b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, +"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", +function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, +outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); +return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= +0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= +this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= +1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? +(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- +m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= +this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= +this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); +c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); +if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout",function(b){b= +d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); +b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, +a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, +selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= +h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= +this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, +"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); +a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", +this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", +this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= +b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", +cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); +d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= +d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= +{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); +if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); +J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); +a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| +c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ +i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= +this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", +left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& +d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= +b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= +!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); +a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); +d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% +100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", +TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= +this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": +"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'
    ';var z=j?'": +"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+ +this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+r.getDate()+"":''+ +r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), +l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): +g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== +"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); +if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Effects 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); +c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, +a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); +a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", +"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* +((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= +e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= +e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/ui/lib/jquery-ui/js/jquery-ui.js b/ui/lib/jquery-ui/js/jquery-ui.js index 7ec85a5741b..6dc062e6ac8 100755 --- a/ui/lib/jquery-ui/js/jquery-ui.js +++ b/ui/lib/jquery-ui/js/jquery-ui.js @@ -1,789 +1,14879 @@ +/*! jQuery UI - v1.9.2 - 2012-11-23 +* http://jqueryui.com +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.effect.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.progressbar.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.slider.js, jquery.ui.sortable.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js +* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */ + +(function( $, undefined ) { + +var uuid = 0, + runiqueId = /^ui-id-\d+$/; + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.9.2", + + keyCode: { + BACKSPACE: 8, + COMMA: 188, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SPACE: 32, + TAB: 9, + UP: 38 + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.ui.ie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.css(this,'position')) && (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x')); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x')); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + uniqueId: function() { + return this.each(function() { + if ( !this.id ) { + this.id = "ui-id-" + (++uuid); + } + }); + }, + + removeUniqueId: function() { + return this.each(function() { + if ( runiqueId.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } + }); + } +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var map, mapName, img, + nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + map = element.parentNode; + mapName = map.name; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) ? + !element.disabled : + "a" === nodeName ? + element.href || isTabIndexNotNaN : + isTabIndexNotNaN) && + // the element and all of its ancestors must be visible + visible( element ); +} + +function visible( element ) { + return $.expr.filters.visible( element ) && + !$( element ).parents().andSelf().filter(function() { + return $.css( this, "visibility" ) === "hidden"; + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the element to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + + + + + +// deprecated + +(function() { + var uaMatch = /msie ([\w.]+)/.exec( navigator.userAgent.toLowerCase() ) || []; + $.ui.ie = uaMatch.length ? true : false; + $.ui.ie6 = parseFloat( uaMatch[ 1 ], 10 ) === 6; +})(); + +$.fn.extend({ + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var i, + set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + contains: $.contains, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +(function( $, undefined ) { + +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( $.isFunction( value ) ) { + prototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + } + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name + }, prototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + // TODO remove widgetBaseClass, see #8155 + widgetBaseClass: fullName, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.widget.extend.apply( null, [ options ].concat(args) ) : + options; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, fullName, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
    ", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + // 1.9 BC for #7810 + // TODO remove dual storage + $.data( element, this.widgetName, this ); + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + // accept selectors, DOM elements + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + $.Widget.prototype._getCreateOptions = function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }; +} + +})( jQuery ); +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + version: "1.9.2", + options: { + cancel: 'input,textarea,button,select,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return that._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, that.widgetName + '.preventClickEvent')) { + $.removeData(event.target, that.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = (event.which === 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + that.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return that._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return that._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.ui.ie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
    " ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ), + overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowX ? $.position.scrollbarWidth() : 0, + height: hasOverflowY ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ); + return { + element: withinElement, + isWindow: isWindow, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: isWindow ? withinElement.width() : withinElement.outerWidth(), + height: isWindow ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: 0, left: 0 }; + } else if ( $.isWindow( targetElem ) ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + targetOffset = { top: targetElem.pageY, left: targetElem.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + targetOffset = target.offset(); + } + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !$.support.offsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem : elem + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } + else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) { + position.top += myOffset + atOffset + offset; + } + } + else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function () { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // offset option + (function( $ ) { + var _position = $.fn.position; + $.fn.position = function( options ) { + if ( !options || !options.offset ) { + return _position.call( this, options ); + } + var offset = options.offset.split( " " ), + at = options.at.split( " " ); + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + if ( /^\d/.test( offset[ 0 ] ) ) { + offset[ 0 ] = "+" + offset[ 0 ]; + } + if ( /^\d/.test( offset[ 1 ] ) ) { + offset[ 1 ] = "+" + offset[ 1 ]; + } + if ( at.length === 1 ) { + if ( /left|center|right/.test( at[ 0 ] ) ) { + at[ 1 ] = "center"; + } else { + at[ 1 ] = at[ 0 ]; + at[ 0 ] = "center"; + } + } + return _position.call( this, $.extend( options, { + at: at[ 0 ] + offset[ 0 ] + " " + at[ 1 ] + offset[ 1 ], + offset: undefined + } ) ); + }; + }( jQuery ) ); +} + +}( jQuery ) ); +(function( $, undefined ) { + +var uid = 0, + hideProps = {}, + showProps = {}; + +hideProps.height = hideProps.paddingTop = hideProps.paddingBottom = + hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide"; +showProps.height = showProps.paddingTop = showProps.paddingBottom = + showProps.borderTopWidth = showProps.borderBottomWidth = "show"; + +$.widget( "ui.accordion", { + version: "1.9.2", + options: { + active: 0, + animate: {}, + collapsible: false, + event: "click", + header: "> li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // callbacks + activate: null, + beforeActivate: null + }, + + _create: function() { + var accordionId = this.accordionId = "ui-accordion-" + + (this.element.attr( "id" ) || ++uid), + options = this.options; + + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ); + + this.headers = this.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ); + this._hoverable( this.headers ); + this._focusable( this.headers ); + + this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .hide(); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active" ) + .toggleClass( "ui-corner-all ui-corner-top" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this._createIcons(); + this.refresh(); + + // ARIA + this.element.attr( "role", "tablist" ); + + this.headers + .attr( "role", "tab" ) + .each(function( i ) { + var header = $( this ), + headerId = header.attr( "id" ), + panel = header.next(), + panelId = panel.attr( "id" ); + if ( !headerId ) { + headerId = accordionId + "-header-" + i; + header.attr( "id", headerId ); + } + if ( !panelId ) { + panelId = accordionId + "-panel-" + i; + panel.attr( "id", panelId ); + } + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }) + .hide(); + + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + + this._on( this.headers, { keydown: "_keydown" }); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._setupEvents( options.event ); + }, + + _getCreateEventData: function() { + return { + header: this.active, + content: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); + } + }, + + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, + + _panelKeyDown : function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var maxHeight, overflow, + heightStyle = this.options.heightStyle, + parent = this.element.parent(); + + + if ( heightStyle === "fill" ) { + // IE 6 treats height like minHeight, so we need to turn off overflow + // in order to get a reliable height + // we use the minHeight support test because we assume that only + // browsers that don't support minHeight will treat height as minHeight + if ( !$.support.minHeight ) { + overflow = parent.css( "overflow" ); + parent.css( "overflow", "hidden"); + } + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + if ( overflow ) { + parent.css( "overflow", overflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = {}; + if ( !event ) { + return; + } + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + this._on( this.headers, events ); + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } + + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + toHide.prev().attr( "aria-selected", "false" ); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.headers.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }) + .prev() + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + adjust += fx.now; + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel; + + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[0].className = toHide.parent()[0].className; + } + + this._trigger( "activate", null, data ); + } +}); + + + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // navigation options + (function( $, prototype ) { + $.extend( prototype.options, { + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }); + + var _create = prototype._create; + prototype._create = function() { + if ( this.options.navigation ) { + var that = this, + headers = this.element.find( this.options.header ), + content = headers.next(), + current = headers.add( content ) + .find( "a" ) + .filter( this.options.navigationFilter ) + [ 0 ]; + if ( current ) { + headers.add( content ).each( function( index ) { + if ( $.contains( this, current ) ) { + that.options.active = Math.floor( index / 2 ); + return false; + } + }); + } + } + _create.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // height options + (function( $, prototype ) { + $.extend( prototype.options, { + heightStyle: null, // remove default so we fall back to old values + autoHeight: true, // use heightStyle: "auto" + clearStyle: false, // use heightStyle: "content" + fillSpace: false // use heightStyle: "fill" + }); + + var _create = prototype._create, + _setOption = prototype._setOption; + + $.extend( prototype, { + _create: function() { + this.options.heightStyle = this.options.heightStyle || + this._mergeHeightStyle(); + + _create.call( this ); + }, + + _setOption: function( key ) { + if ( key === "autoHeight" || key === "clearStyle" || key === "fillSpace" ) { + this.options.heightStyle = this._mergeHeightStyle(); + } + _setOption.apply( this, arguments ); + }, + + _mergeHeightStyle: function() { + var options = this.options; + + if ( options.fillSpace ) { + return "fill"; + } + + if ( options.clearStyle ) { + return "content"; + } + + if ( options.autoHeight ) { + return "auto"; + } + } + }); + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // icon options + (function( $, prototype ) { + $.extend( prototype.options.icons, { + activeHeader: null, // remove default so we fall back to old values + headerSelected: "ui-icon-triangle-1-s" + }); + + var _createIcons = prototype._createIcons; + prototype._createIcons = function() { + if ( this.options.icons ) { + this.options.icons.activeHeader = this.options.icons.activeHeader || + this.options.icons.headerSelected; + } + _createIcons.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // expanded active option, activate method + (function( $, prototype ) { + prototype.activate = prototype._activate; + + var _findActive = prototype._findActive; + prototype._findActive = function( index ) { + if ( index === -1 ) { + index = false; + } + if ( index && typeof index !== "number" ) { + index = this.headers.index( this.headers.filter( index ) ); + if ( index === -1 ) { + index = false; + } + } + return _findActive.call( this, index ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // resize method + jQuery.ui.accordion.prototype.resize = jQuery.ui.accordion.prototype.refresh; + + // change events + (function( $, prototype ) { + $.extend( prototype.options, { + change: null, + changestart: null + }); + + var _trigger = prototype._trigger; + prototype._trigger = function( type, event, data ) { + var ret = _trigger.apply( this, arguments ); + if ( !ret ) { + return false; + } + + if ( type === "beforeActivate" ) { + ret = _trigger.call( this, "changestart", event, { + oldHeader: data.oldHeader, + oldContent: data.oldPanel, + newHeader: data.newHeader, + newContent: data.newPanel + }); + } else if ( type === "activate" ) { + ret = _trigger.call( this, "change", event, { + oldHeader: data.oldHeader, + oldContent: data.oldPanel, + newHeader: data.newHeader, + newContent: data.newPanel + }); + } + return ret; + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // animated option + // NOTE: this only provides support for "slide", "bounceslide", and easings + // not the full $.ui.accordion.animations API + (function( $, prototype ) { + $.extend( prototype.options, { + animate: null, + animated: "slide" + }); + + var _create = prototype._create; + prototype._create = function() { + var options = this.options; + if ( options.animate === null ) { + if ( !options.animated ) { + options.animate = false; + } else if ( options.animated === "slide" ) { + options.animate = 300; + } else if ( options.animated === "bounceslide" ) { + options.animate = { + duration: 200, + down: { + easing: "easeOutBounce", + duration: 1000 + } + }; + } else { + options.animate = options.animated; + } + } + + _create.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); +} + +})( jQuery ); +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + version: "1.9.2", + defaultElement: "", + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + pending: 0, + + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput; + + this.isMultiLine = this._isMultiLine(); + this.valueMethod = this.element[ this.element.is( "input,textarea" ) ? "val" : "text" ]; + this.isNewMenu = true; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + this._value( this.term ); + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + }); + + this._initSource(); + this.menu = $( "
    ").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j"); -this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", -g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? -(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- -m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; -this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= -this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= -this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); -c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, -_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); -if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, -1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout",function(b){b= -d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); -b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, -a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, -selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= -h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= -this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, -"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", -function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); -a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", -this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", -this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= -b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", -cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); -d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= -d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= -{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); -if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); -J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); -a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| -c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ -i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= -this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", -left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& -d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= -b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= -!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); -a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); -d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% -100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", -TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= -a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), -b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= -this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= -this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": -"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'
    ';var z=j?'": -"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+ -this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+r.getDate()+"":''+ -r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), -l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): -g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== -"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); -if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); -c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, -"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= -function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, -[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); -;/* - * jQuery UI Progressbar 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Effects 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], -16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, -a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= -a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", -"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, -0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, -211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, -d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; -f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, -[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); -c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, -a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); -a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", -"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* -((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= -e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= -e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ -e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); -;/* - * jQuery UI Effects Fade 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fade - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Fold 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], -10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Highlight 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& -this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Pulsate 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * jquery.effects.core.js - */ -(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); -b.dequeue()})})}})(jQuery); -; \ No newline at end of file + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var that = $(this).data("resizable"), o = that.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var that = $(this).data("resizable"), o = that.options, os = that.originalSize, op = that.originalPosition; + + var delta = { + height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0, + top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var that = $(this).data("resizable"), o = that.options; + + var pr = that._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width; + + var style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) }, + left = (parseInt(that.element.css('left'), 10) + (that.position.left - that.originalPosition.left)) || null, + top = (parseInt(that.element.css('top'), 10) + (that.position.top - that.originalPosition.top)) || null; + + that.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(that.element.css('width'), 10), + height: parseInt(that.element.css('height'), 10), + top: parseInt(that.element.css('top'), 10), + left: parseInt(that.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + that._updateCache(data); + that._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, el = that.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + that.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + that.containerOffset = { left: 0, top: 0 }; + that.containerPosition = { left: 0, top: 0 }; + + that.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = that.containerOffset, ch = that.containerSize.height, cw = that.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + that.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, + ps = that.containerSize, co = that.containerOffset, cs = that.size, cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = that.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (that._helper ? co.left : 0)) { + that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left)); + if (pRatio) that.size.height = that.size.width / that.aspectRatio; + that.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (that._helper ? co.top : 0)) { + that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top); + if (pRatio) that.size.width = that.size.height * that.aspectRatio; + that.position.top = that._helper ? co.top : 0; + } + + that.offset.left = that.parentData.left+that.position.left; + that.offset.top = that.parentData.top+that.position.top; + + var woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width ), + hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height ); + + var isParent = that.containerElement.get(0) == that.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(that.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= that.parentData.left; + + if (woset + that.size.width >= that.parentData.width) { + that.size.width = that.parentData.width - woset; + if (pRatio) that.size.height = that.size.width / that.aspectRatio; + } + + if (hoset + that.size.height >= that.parentData.height) { + that.size.height = that.parentData.height - hoset; + if (pRatio) that.size.width = that.size.height * that.aspectRatio; + } + }, + + stop: function(event, ui){ + var that = $(this).data("resizable"), o = that.options, cp = that.position, + co = that.containerOffset, cop = that.containerPosition, ce = that.containerElement; + + var helper = $(that.helper), ho = helper.offset(), w = helper.outerWidth() - that.sizeDiff.width, h = helper.outerHeight() - that.sizeDiff.height; + + if (that._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (that._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var that = $(this).data("resizable"), o = that.options, cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + that.ghost.appendTo(that.helper); + + }, + + resize: function(event, ui){ + var that = $(this).data("resizable"), o = that.options; + if (that.ghost) that.ghost.css({ position: 'relative', height: that.size.height, width: that.size.width }); + }, + + stop: function(event, ui){ + var that = $(this).data("resizable"), o = that.options; + if (that.ghost && that.helper) that.helper.get(0).removeChild(that.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, cs = that.size, os = that.originalSize, op = that.originalPosition, a = that.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.left = op.left - ox; + } + else { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.top = op.top - oy; + that.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + version: "1.9.2", + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var that = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(that.options.filter, that.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + _destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var that = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + that._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var that = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == that.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + that._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var that = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +})(jQuery); +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var i, handleCount, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
    " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + handleCount = ( o.values && o.values.length ) || 1; + + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .mouseenter(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }) + .mouseleave(function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "ui-slider-handle-index", i ); + }); + + this._on( this.handles, { + keydown: function( event ) { + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !this._keySliding ) { + this._keySliding = true; + $( event.target ).addClass( "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = this.options.step; + if ( this.options.values && this.options.values.length ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); + break; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } + + this._slide( event, index, newVal ); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + $( event.target ).removeClass( "ui-state-active" ); + } + } + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + _destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - that.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + this._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function() { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.prop( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.prop( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + case "min": + case "max": + this._animateOff = true; + this._refreshValue(); + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i ) { + valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +}(jQuery)); +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + _destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget().toggleClass( "ui-sortable-disabled", !!value ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == that) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == that) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, this._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) continue; + + if (itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var that = this; + var cur = this.placeholder.offset(); + + this.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + that._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, this._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + this.items = $.grep(this.items, function (item) { + for (var j=0; j < list.length; j++) { + if(list[j] == item.item[0]) + return false; + }; + return true; + }); + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + that = that || this; + var o = that.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(that.currentItem[0].nodeName)) + .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css('paddingTop')||0, 10) - parseInt(that.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css('paddingLeft')||0, 10) - parseInt(that.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem)); + + //Append it after the actual current item + that.currentItem.after(that.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(that, that.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; + var posProperty = this.containers[innermostIndex].floating ? 'left' : 'top'; + var sizeProperty = this.containers[innermostIndex].floating ? 'width' : 'height'; + var base = this.positionAbs[posProperty] + this.offset.click[posProperty]; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + if(this.items[j].item[0] == this.currentItem[0]) continue; + var cur = this.items[j].item.offset()[posProperty]; + var nearBottom = false; + if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){ + nearBottom = true; + cur += this.items[j][sizeProperty]; + } + + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = nearBottom ? "up": "down"; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay(function() { + if(counter == this.counter) this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + }); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(_inst) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $([]), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } + +}); + +})(jQuery); +(function( $ ) { + +function modifier( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); + } + }; +} + +$.widget( "ui.spinner", { + version: "1.9.2", + defaultElement: "", + widgetEventPrefix: "spin", + options: { + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, + + change: null, + spin: null, + start: null, + stop: null + }, + + _create: function() { + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); + + // format the value, but don't constrain + this._value( this.element.val(), true ); + + this._draw(); + this._on( this._events ); + this._refresh(); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _getCreateOptions: function() { + var options = {}, + element = this.element; + + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value !== undefined && value.length ) { + options[ option ] = value; + } + }); + + return options; + }, + + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } + + this._spin( (delta > 0 ? 1 : -1) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay(function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[0] === this.document[0].activeElement ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[0] === this.document[0].activeElement; + if ( !isActive ) { + this.element.focus(); + this.previous = previous; + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay(function() { + this.previous = previous; + }); + } + } + + // ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + checkFocus.call( this ); + }); + + if ( this._start( event ) === false ) { + return; + } + + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } + + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, + + _draw: function() { + var uiSpinner = this.uiSpinner = this.element + .addClass( "ui-spinner-input" ) + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + // add buttons + .append( this._buttonHtml() ); + + this.element.attr( "role", "spinbutton" ); + + // button bindings + this.buttons = uiSpinner.find( ".ui-spinner-button" ) + .attr( "tabIndex", -1 ) + .button() + .removeClass( "ui-corner-all" ); + + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) && + uiSpinner.height() > 0 ) { + uiSpinner.height( uiSpinner.height() ); + } + + // disable spinner if element was already disabled + if ( this.options.disabled ) { + this.disable(); + } + }, + + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; + + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } + + return false; + }, + + _uiSpinnerHtml: function() { + return ""; + }, + + _buttonHtml: function() { + return "" + + "" + + ""; + }, + + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; + } + + if ( !this.counter ) { + this.counter = 1; + } + this.spinning = true; + return true; + }, + + _repeat: function( i, steps, event ) { + i = i || 500; + + clearTimeout( this.timer ); + this.timer = this._delay(function() { + this._repeat( 40, steps, event ); + }, i ); + + this._spin( steps * this.options.step, event ); + }, + + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; + } + + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) { + this._value( value ); + this.counter++; + } + }, + + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 ); + } + + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); + } + return precision; + }, + + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + // - round to the nearest step + aboveMin = Math.round(aboveMin / options.step) * options.step; + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // clamp the value + if ( options.max !== null && value > options.max) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; + } + + return value; + }, + + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); + }, + + _setOption: function( key, value ) { + if ( key === "culture" || key === "numberFormat" ) { + var prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } + + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } + + this._super( key, value ); + + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + this.buttons.button( "disable" ); + } else { + this.element.prop( "disabled", false ); + this.buttons.button( "enable" ); + } + } + }, + + _setOptions: modifier(function( options ) { + this._super( options ); + this._value( this.element.val() ); + }), + + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; + }, + + _format: function( value ) { + if ( value === "" ) { + return ""; + } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, + + _refresh: function() { + this.element.attr({ + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + }); + }, + + // update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); + } + } + this.element.val( value ); + this._refresh(); + }, + + _destroy: function() { + this.element + .removeClass( "ui-spinner-input" ) + .prop( "disabled", false ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + this.uiSpinner.replaceWith( this.element ); + }, + + stepUp: modifier(function( steps ) { + this._stepUp( steps ); + }), + _stepUp: function( steps ) { + this._spin( (steps || 1) * this.options.step ); + }, + + stepDown: modifier(function( steps ) { + this._stepDown( steps ); + }), + _stepDown: function( steps ) { + this._spin( (steps || 1) * -this.options.step ); + }, + + pageUp: modifier(function( pages ) { + this._stepUp( (pages || 1) * this.options.page ); + }), + + pageDown: modifier(function( pages ) { + this._stepDown( (pages || 1) * this.options.page ); + }), + + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + modifier( this._value ).call( this, newVal ); + }, + + widget: function() { + return this.uiSpinner; + } +}); + +}( jQuery ) ); +(function( $, undefined ) { + +var tabId = 0, + rhash = /#.*$/; + +function getNextTabId() { + return ++tabId; +} + +function isLocal( anchor ) { + return anchor.hash.length > 1 && + anchor.href.replace( rhash, "" ) === + location.href.replace( rhash, "" ) + // support: Safari 5.1 + // Safari 5.1 doesn't encode spaces in window.location + // but it does encode spaces from anchors (#8777) + .replace( /\s/g, "%20" ); +} + +$.widget( "ui.tabs", { + version: "1.9.2", + delay: 300, + options: { + active: null, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null + }, + + _create: function() { + var that = this, + options = this.options, + active = options.active, + locationHash = location.hash.substring( 1 ); + + this.running = false; + + this.element + .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-tabs-collapsible", options.collapsible ) + // Prevent users from focusing disabled tabs via click + .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); + } + }) + // support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); + } + }); + + this._processTabs(); + + if ( active === null ) { + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each(function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + }); + } + + // check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } + + // no active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } + } + + // handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = options.collapsible ? false : 0; + } + } + options.active = active; + + // don't allow collapsible: false and active: false + if ( !options.collapsible && options.active === false && this.anchors.length ) { + options.active = 0; + } + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + }) + ) ).sort(); + } + + // check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( this.options.active ); + } else { + this.active = $(); + } + + this._refresh(); + + if ( this.active.length ) { + this.load( options.active ); + } + }, + + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; + }, + + _tabKeydown: function( event ) { + var focusedTab = $( this.document[0].activeElement ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; + + if ( this._handlePageNav( event ) ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } + + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control key will prevent automatic activation + if ( !event.ctrlKey ) { + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay(function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } + }, + + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } + + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.focus(); + } + }, + + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, + + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; + } + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } + + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; + } + + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).focus(); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "disabled" ) { + // don't use the widget factory's disabled handling + this._setupDisabled( value ); + return; + } + + this._super( key, value); + + if ( key === "collapsible" ) { + this.element.toggleClass( "ui-tabs-collapsible", value ); + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } + + if ( key === "event" ) { + this._setupEvents( value ); + } + + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } + }, + + _tabId: function( tab ) { + return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; + }, + + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); + + // get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + }); + + this._processTabs(); + + // was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + // was active, active tab still exists + } else { + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } + + this._refresh(); + }, + + _refresh: function() { + this._setupDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); + + this.tabs.not( this.active ).attr({ + "aria-selected": "false", + tabIndex: -1 + }); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active + .addClass( "ui-tabs-active ui-state-active" ) + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + this._getPanelForTab( this.active ) + .show() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + }, + + _processTabs: function() { + var that = this; + + this.tablist = this._getList() + .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .attr( "role", "tablist" ); + + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .addClass( "ui-state-default ui-corner-top" ) + .attr({ + role: "tab", + tabIndex: -1 + }); + + this.anchors = this.tabs.map(function() { + return $( "a", this )[ 0 ]; + }) + .addClass( "ui-tabs-anchor" ) + .attr({ + role: "presentation", + tabIndex: -1 + }); + + this.panels = $(); + + this.anchors.each(function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); + + // inline tab + if ( isLocal( anchor ) ) { + selector = anchor.hash; + panel = that.element.find( that._sanitizeSelector( selector ) ); + // remote tab + } else { + panelId = that._tabId( tab ); + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); + } + + if ( panel.length) { + that.panels = that.panels.add( panel ); + } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); + } + tab.attr({ + "aria-controls": selector.substring( 1 ), + "aria-labelledby": anchorId + }); + panel.attr( "aria-labelledby", anchorId ); + }); + + this.panels + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .attr( "role", "tabpanel" ); + }, + + // allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.element.find( "ol,ul" ).eq( 0 ); + }, + + _createPanel: function( id ) { + return $( "
    " ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); + }, + + _setupDisabled: function( disabled ) { + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; + } + } + + // disable tabs + for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) { + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + $( li ) + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } else { + $( li ) + .removeClass( "ui-state-disabled" ) + .removeAttr( "aria-disabled" ); + } + } + + this.options.disabled = disabled; + }, + + _setupEvents: function( event ) { + var events = { + click: function( event ) { + event.preventDefault(); + } + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); + }, + + _setupHeightStyle: function( heightStyle ) { + var maxHeight, overflow, + parent = this.element.parent(); + + if ( heightStyle === "fill" ) { + // IE 6 treats height like minHeight, so we need to turn off overflow + // in order to get a reliable height + // we use the minHeight support test because we assume that only + // browsers that don't support minHeight will treat height as minHeight + if ( !$.support.minHeight ) { + overflow = parent.css( "overflow" ); + parent.css( "overflow", "hidden"); + } + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + if ( overflow ) { + parent.css( "overflow", overflow ); + } + + this.element.children().not( this.panels ).each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.panels.each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }).height( maxHeight ); + } + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; + + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + // can't switch durning an animation + this.running || + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.tabs.index( tab ); + + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); + } + + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } + + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); + }, + + // handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; + + this.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); + } + } + + // start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + eventData.oldTab.attr( "aria-selected", "false" ); + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow.attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + eventData.newTab.attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; + } + + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler({ + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + }); + }, + + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); + } + + this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ); + + this.tablist + .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .removeAttr( "role" ); + + this.anchors + .removeClass( "ui-tabs-anchor" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeData( "href.tabs" ) + .removeData( "load.tabs" ) + .removeUniqueId(); + + this.tabs.add( this.panels ).each(function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ) + .removeClass( "ui-state-default ui-state-active ui-state-disabled " + + "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-live" ) + .removeAttr( "aria-busy" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "role" ); + } + }); + + this.tabs.each(function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li.attr( "aria-controls", prev ); + } else { + li.removeAttr( "aria-controls" ); + } + }); + + this.panels.show(); + + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } + }, + + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + }); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + }); + } + } + this._setupDisabled( disabled ); + }, + + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { + return; + } + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } + } + this._setupDisabled( disabled ); + }, + + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }; + + // not remote + if ( isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + tab.addClass( "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .success(function( response ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + }, 1 ); + }) + .complete(function( jqXHR, status ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + tab.removeClass( "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }, 1 ); + }); + } + }, + + // TODO: Remove this function in 1.10 when ajaxOptions is removed + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + url: anchor.attr( "href" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; + }, + + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + + // helper method for a lot of the back compat extensions + $.ui.tabs.prototype._ui = function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }; + + // url method + $.widget( "ui.tabs", $.ui.tabs, { + url: function( index, url ) { + this.anchors.eq( index ).attr( "href", url ); + } + }); + + // TODO: Remove _ajaxSettings() method when removing this extension + // ajaxOptions and cache options + $.widget( "ui.tabs", $.ui.tabs, { + options: { + ajaxOptions: null, + cache: false + }, + + _create: function() { + this._super(); + + var that = this; + + this._on({ tabsbeforeload: function( event, ui ) { + // tab is already cached + if ( $.data( ui.tab[ 0 ], "cache.tabs" ) ) { + event.preventDefault(); + return; + } + + ui.jqXHR.success(function() { + if ( that.options.cache ) { + $.data( ui.tab[ 0 ], "cache.tabs", true ); + } + }); + }}); + }, + + _ajaxSettings: function( anchor, event, ui ) { + var ajaxOptions = this.options.ajaxOptions; + return $.extend( {}, ajaxOptions, { + error: function( xhr, status ) { + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + ajaxOptions.error( + xhr, status, ui.tab.closest( "li" ).index(), ui.tab[ 0 ] ); + } + catch ( error ) {} + } + }, this._superApply( arguments ) ); + }, + + _setOption: function( key, value ) { + // reset cache if switching from cached to not cached + if ( key === "cache" && value === false ) { + this.anchors.removeData( "cache.tabs" ); + } + this._super( key, value ); + }, + + _destroy: function() { + this.anchors.removeData( "cache.tabs" ); + this._super(); + }, + + url: function( index ){ + this.anchors.eq( index ).removeData( "cache.tabs" ); + this._superApply( arguments ); + } + }); + + // abort method + $.widget( "ui.tabs", $.ui.tabs, { + abort: function() { + if ( this.xhr ) { + this.xhr.abort(); + } + } + }); + + // spinner + $.widget( "ui.tabs", $.ui.tabs, { + options: { + spinner: "Loading…" + }, + _create: function() { + this._super(); + this._on({ + tabsbeforeload: function( event, ui ) { + // Don't react to nested tabs or tabs that don't use a spinner + if ( event.target !== this.element[ 0 ] || + !this.options.spinner ) { + return; + } + + var span = ui.tab.find( "span" ), + html = span.html(); + span.html( this.options.spinner ); + ui.jqXHR.complete(function() { + span.html( html ); + }); + } + }); + } + }); + + // enable/disable events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + enable: null, + disable: null + }, + + enable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === true || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) !== -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + }, + + disable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === false || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) === -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + } + }); + + // add/remove methods and events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + add: null, + remove: null, + tabTemplate: "
  • #{label}
    • " + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var doInsertAfter, panel, + options = this.options, + li = $( options.tabTemplate + .replace( /#\{href\}/g, url ) + .replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? + url.replace( "#", "" ) : + this._tabId( li ); + + li.addClass( "ui-state-default ui-corner-top" ).data( "ui-tabs-destroy", true ); + li.attr( "aria-controls", id ); + + doInsertAfter = index >= this.tabs.length; + + // try to find an existing element before creating a new one + panel = this.element.find( "#" + id ); + if ( !panel.length ) { + panel = this._createPanel( id ); + if ( doInsertAfter ) { + if ( index > 0 ) { + panel.insertAfter( this.panels.eq( -1 ) ); + } else { + panel.appendTo( this.element ); + } + } else { + panel.insertBefore( this.panels[ index ] ); + } + } + panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ).hide(); + + if ( doInsertAfter ) { + li.appendTo( this.tablist ); + } else { + li.insertBefore( this.tabs[ index ] ); + } + + options.disabled = $.map( options.disabled, function( n ) { + return n >= index ? ++n : n; + }); + + this.refresh(); + if ( this.tabs.length === 1 && options.active === false ) { + this.option( "active", 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var options = this.options, + tab = this.tabs.eq( index ).remove(), + panel = this._getPanelForTab( tab ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + // We check for more than 2 tabs, because if there are only 2, + // then when we remove this tab, there will only be one tab left + // so we don't need to detect which tab to activate. + if ( tab.hasClass( "ui-tabs-active" ) && this.anchors.length > 2 ) { + this._activate( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + options.disabled = $.map( + $.grep( options.disabled, function( n ) { + return n !== index; + }), + function( n ) { + return n >= index ? --n : n; + }); + + this.refresh(); + + this._trigger( "remove", null, this._ui( tab.find( "a" )[ 0 ], panel[ 0 ] ) ); + return this; + } + }); + + // length method + $.widget( "ui.tabs", $.ui.tabs, { + length: function() { + return this.anchors.length; + } + }); + + // panel ids (idPrefix option + title attribute) + $.widget( "ui.tabs", $.ui.tabs, { + options: { + idPrefix: "ui-tabs-" + }, + + _tabId: function( tab ) { + var a = tab.is( "li" ) ? tab.find( "a[href]" ) : tab; + a = a[0]; + return $( a ).closest( "li" ).attr( "aria-controls" ) || + a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF\-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + } + }); + + // _createPanel method + $.widget( "ui.tabs", $.ui.tabs, { + options: { + panelTemplate: "
    " + }, + + _createPanel: function( id ) { + return $( this.options.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); + } + }); + + // selected option + $.widget( "ui.tabs", $.ui.tabs, { + _create: function() { + var options = this.options; + if ( options.active === null && options.selected !== undefined ) { + options.active = options.selected === -1 ? false : options.selected; + } + this._super(); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; + } + }, + + _setOption: function( key, value ) { + if ( key !== "selected" ) { + return this._super( key, value ); + } + + var options = this.options; + this._super( "active", value === -1 ? false : value ); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; + } + }, + + _eventHandler: function() { + this._superApply( arguments ); + this.options.selected = this.options.active; + if ( this.options.selected === false ) { + this.options.selected = -1; + } + } + }); + + // show and select event + $.widget( "ui.tabs", $.ui.tabs, { + options: { + show: null, + select: null + }, + _create: function() { + this._super(); + if ( this.options.active !== false ) { + this._trigger( "show", null, this._ui( + this.active.find( ".ui-tabs-anchor" )[ 0 ], + this._getPanelForTab( this.active )[ 0 ] ) ); + } + }, + _trigger: function( type, event, data ) { + var tab, panel, + ret = this._superApply( arguments ); + + if ( !ret ) { + return false; + } + + if ( type === "beforeActivate" ) { + tab = data.newTab.length ? data.newTab : data.oldTab; + panel = data.newPanel.length ? data.newPanel : data.oldPanel; + ret = this._super( "select", event, { + tab: tab.find( ".ui-tabs-anchor" )[ 0], + panel: panel[ 0 ], + index: tab.closest( "li" ).index() + }); + } else if ( type === "activate" && data.newTab.length ) { + ret = this._super( "show", event, { + tab: data.newTab.find( ".ui-tabs-anchor" )[ 0 ], + panel: data.newPanel[ 0 ], + index: data.newTab.closest( "li" ).index() + }); + } + return ret; + } + }); + + // select method + $.widget( "ui.tabs", $.ui.tabs, { + select: function( index ) { + index = this._getIndex( index ); + if ( index === -1 ) { + if ( this.options.collapsible && this.options.selected !== -1 ) { + index = this.options.selected; + } else { + return; + } + } + this.anchors.eq( index ).trigger( this.options.event + this.eventNamespace ); + } + }); + + // cookie option + (function() { + + var listId = 0; + + $.widget( "ui.tabs", $.ui.tabs, { + options: { + cookie: null // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + }, + _create: function() { + var options = this.options, + active; + if ( options.active == null && options.cookie ) { + active = parseInt( this._cookie(), 10 ); + if ( active === -1 ) { + active = false; + } + options.active = active; + } + this._super(); + }, + _cookie: function( active ) { + var cookie = [ this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + (++listId) ) ]; + if ( arguments.length ) { + cookie.push( active === false ? -1 : active ); + cookie.push( this.options.cookie ); + } + return $.cookie.apply( null, cookie ); + }, + _refresh: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _eventHandler: function() { + this._superApply( arguments ); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _destroy: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( null, this.options.cookie ); + } + } + }); + + })(); + + // load event + $.widget( "ui.tabs", $.ui.tabs, { + _trigger: function( type, event, data ) { + var _data = $.extend( {}, data ); + if ( type === "load" ) { + _data.panel = _data.panel[ 0 ]; + _data.tab = _data.tab.find( ".ui-tabs-anchor" )[ 0 ]; + } + return this._super( type, event, _data ); + } + }); + + // fx option + // The new animation options (show, hide) conflict with the old show callback. + // The old fx option wins over show/hide anyway (always favor back-compat). + // If a user wants to use the new animation API, they must give up the old API. + $.widget( "ui.tabs", $.ui.tabs, { + options: { + fx: null // e.g. { height: "toggle", opacity: "toggle", duration: 200 } + }, + + _getFx: function() { + var hide, show, + fx = this.options.fx; + + if ( fx ) { + if ( $.isArray( fx ) ) { + hide = fx[ 0 ]; + show = fx[ 1 ]; + } else { + hide = show = fx; + } + } + + return fx ? { show: show, hide: hide } : null; + }, + + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel, + fx = this._getFx(); + + if ( !fx ) { + return this._super( event, eventData ); + } + + that.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && fx.show ) { + toShow + .animate( fx.show, fx.show.duration, function() { + complete(); + }); + } else { + toShow.show(); + complete(); + } + } + + // start out by hiding, then showing, then completing + if ( toHide.length && fx.hide ) { + toHide.animate( fx.hide, fx.hide.duration, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); + } + } + }); +} + +})( jQuery ); +(function( $ ) { + +var increments = 0; + +function addDescribedBy( elem, id ) { + var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); +} + +function removeDescribedBy( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ), + index = $.inArray( id, describedby ); + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } + + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } +} + +$.widget( "ui.tooltip", { + version: "1.9.2", + options: { + content: function() { + return $( this ).attr( "title" ); + }, + hide: true, + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + tooltipClass: null, + track: false, + + // callbacks + close: null, + open: null + }, + + _create: function() { + this._on({ + mouseover: "open", + focusin: "open" + }); + + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; + + if ( this.options.disabled ) { + this._disable(); + } + }, + + _setOption: function( key, value ) { + var that = this; + + if ( key === "disabled" ) { + this[ value ? "_disable" : "_enable" ](); + this.options[ key ] = value; + // disable element style changes + return; + } + + this._super( key, value ); + + if ( key === "content" ) { + $.each( this.tooltips, function( id, element ) { + that._updateContent( element ); + }); + } + }, + + _disable: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + }); + + // remove title attributes to prevent native tooltips + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .attr( "title", "" ); + } + }); + }, + + _enable: function() { + // restore title attributes + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + }); + }, + + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); + + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; + } + + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); + } + + target.data( "ui-tooltip-open", true ); + + // kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each(function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + }); + } + + this._updateContent( target, event ); + }, + + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[0], function( response ) { + // ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; + } + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay(function() { + // jQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + }); + }); + if ( content ) { + this._open( event, target, content ); + } + }, + + _open: function( event, target, content ) { + var tooltip, events, delayedShow, + positionOption = $.extend( {}, this.options.position ); + + if ( !content ) { + return; + } + + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltip = this._find( target ); + if ( tooltip.length ) { + tooltip.find( ".ui-tooltip-content" ).html( content ); + return; + } + + // if we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } + + tooltip = this._tooltip( target ); + addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); + + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + }); + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend({ + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + if ( this.options.show && this.options.show.delay ) { + delayedShow = setInterval(function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); + } + }, $.fx.interval ); + } + + this._trigger( "open", event, { tooltip: tooltip } ); + + events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event(event); + fakeEvent.currentTarget = target[0]; + this.close( fakeEvent, true ); + } + }, + remove: function() { + this._removeTooltip( tooltip ); + } + }; + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, + + close: function( event ) { + var that = this, + target = $( event ? event.currentTarget : this.element ), + tooltip = this._find( target ); + + // disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( this.closing ) { + return; + } + + // only set title if we had one before (see comment in _open()) + if ( target.data( "ui-tooltip-title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } + + removeDescribedBy( target ); + + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + }); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + // Remove 'remove' binding only on delegated targets + if ( target[0] !== this.element[0] ) { + this._off( target, "remove" ); + } + this._off( this.document, "mousemove" ); + + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + }); + } + + this.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + this.closing = false; + }, + + _tooltip: function( element ) { + var id = "ui-tooltip-" + increments++, + tooltip = $( "
    " ) + .attr({ + id: id, + role: "tooltip" + }) + .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " + + ( this.options.tooltipClass || "" ) ); + $( "
    " ) + .addClass( "ui-tooltip-content" ) + .appendTo( tooltip ); + tooltip.appendTo( this.document[0].body ); + if ( $.fn.bgiframe ) { + tooltip.bgiframe(); + } + this.tooltips[ id ] = element; + return tooltip; + }, + + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? $( "#" + id ) : $(); + }, + + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, + + _destroy: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); + + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + element.removeData( "ui-tooltip-title" ); + } + }); + } +}); + +}( jQuery ) ); diff --git a/ui/lib/jquery.js b/ui/lib/jquery.js index 5d5a1d58ee5..a86bf797a8b 100644 --- a/ui/lib/jquery.js +++ b/ui/lib/jquery.js @@ -1,31 +1,28 @@ /*! - * jQuery JavaScript Library v1.6.1 + * jQuery JavaScript Library v1.8.3 * http://jquery.com/ * - * Copyright 2011, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * * Includes Sizzle.js * http://sizzlejs.com/ - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. * - * Date: Thu May 12 15:04:36 2011 -0400 + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: Tue Nov 13 2012 08:20:33 GMT-0500 (Eastern Standard Time) */ (function( window, undefined ) { +var + // A central reference to the root jQuery(document) + rootjQuery, -// Use the correct document accordingly with window argument (sandbox) -var document = window.document, + // The deferred used on DOM ready + readyList, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, navigator = window.navigator, - location = window.location; -var jQuery = (function() { - -// Define a local copy of jQuery -var jQuery = function( selector, context ) { - // The jQuery object is actually just the init constructor 'enhanced' - return new jQuery.fn.init( selector, context, rootjQuery ); - }, // Map over jQuery in case of overwrite _jQuery = window.jQuery, @@ -33,57 +30,64 @@ var jQuery = function( selector, context ) { // Map over the $ in case of overwrite _$ = window.$, - // A central reference to the root jQuery(document) - rootjQuery, + // Save a reference to some core methods + core_push = Array.prototype.push, + core_slice = Array.prototype.slice, + core_indexOf = Array.prototype.indexOf, + core_toString = Object.prototype.toString, + core_hasOwn = Object.prototype.hasOwnProperty, + core_trim = String.prototype.trim, - // A simple way to check for HTML strings or ID strings - // (both of which we optimize for) - quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, - // Check if a string has a non-whitespace character in it - rnotwhite = /\S/, + // Used for matching numbers + core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source, - // Used for trimming whitespace - trimLeft = /^\s+/, - trimRight = /\s+$/, + // Used for detecting and trimming whitespace + core_rnotwhite = /\S/, + core_rspace = /\s+/, - // Check for digits - rdigit = /\d/, + // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE) + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, // Match a standalone tag - rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, // JSON RegExp rvalidchars = /^[\],:{}\s]*$/, - rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, - rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g, - // Useragent RegExp - rwebkit = /(webkit)[ \/]([\w.]+)/, - ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, - rmsie = /(msie) ([\w.]+)/, - rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, - // Keep a UserAgent string for use with jQuery.browser - userAgent = navigator.userAgent, + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, - // For matching the engine and version of the browser - browserMatch, - - // The deferred used on DOM ready - readyList, - - // The ready event handler - DOMContentLoaded, - - // Save a reference to some core methods - toString = Object.prototype.toString, - hasOwn = Object.prototype.hasOwnProperty, - push = Array.prototype.push, - slice = Array.prototype.slice, - trim = String.prototype.trim, - indexOf = Array.prototype.indexOf, + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + } else if ( document.readyState === "complete" ) { + // we're here because readyState === "complete" in oldIE + // which is good enough for us to call the dom ready! + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }, // [[Class]] -> type pairs class2type = {}; @@ -93,7 +97,7 @@ jQuery.fn = jQuery.prototype = { init: function( selector, context, rootjQuery ) { var match, elem, ret, doc; - // Handle $(""), $(null), or $(undefined) + // Handle $(""), $(null), $(undefined), $(false) if ( !selector ) { return this; } @@ -105,55 +109,33 @@ jQuery.fn = jQuery.prototype = { return this; } - // The body element only exists once, optimize finding it - if ( selector === "body" && !context && document.body ) { - this.context = document; - this[0] = document.body; - this.selector = selector; - this.length = 1; - return this; - } - // Handle HTML strings if ( typeof selector === "string" ) { - // Are we dealing with HTML string or an ID? if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { // Assume that strings that start and end with <> are HTML and skip the regex check match = [ null, selector, null ]; } else { - match = quickExpr.exec( selector ); + match = rquickExpr.exec( selector ); } - // Verify a match, and that no context was specified for #id + // Match html or make sure no context is specified for #id if ( match && (match[1] || !context) ) { // HANDLE: $(html) -> $(array) if ( match[1] ) { context = context instanceof jQuery ? context[0] : context; - doc = (context ? context.ownerDocument || context : document); + doc = ( context && context.nodeType ? context.ownerDocument || context : document ); - // If a single string is passed in and it's a single tag - // just do a createElement and skip the rest - ret = rsingleTag.exec( selector ); - - if ( ret ) { - if ( jQuery.isPlainObject( context ) ) { - selector = [ document.createElement( ret[1] ) ]; - jQuery.fn.attr.call( selector, context, true ); - - } else { - selector = [ doc.createElement( ret[1] ) ]; - } - - } else { - ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); - selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + // scripts is true for back-compat + selector = jQuery.parseHTML( match[1], doc, true ); + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + this.attr.call( selector, context, true ); } return jQuery.merge( this, selector ); - // HANDLE: $("#id") + // HANDLE: $(#id) } else { elem = document.getElementById( match[2] ); @@ -178,7 +160,7 @@ jQuery.fn = jQuery.prototype = { // HANDLE: $(expr, $(...)) } else if ( !context || context.jquery ) { - return (context || rootjQuery).find( selector ); + return ( context || rootjQuery ).find( selector ); // HANDLE: $(expr, context) // (which is just equivalent to: $(context).find(expr) @@ -192,7 +174,7 @@ jQuery.fn = jQuery.prototype = { return rootjQuery.ready( selector ); } - if (selector.selector !== undefined) { + if ( selector.selector !== undefined ) { this.selector = selector.selector; this.context = selector.context; } @@ -204,7 +186,7 @@ jQuery.fn = jQuery.prototype = { selector: "", // The current version of jQuery being used - jquery: "1.6.1", + jquery: "1.8.3", // The default length of a jQuery object is 0 length: 0, @@ -215,7 +197,7 @@ jQuery.fn = jQuery.prototype = { }, toArray: function() { - return slice.call( this, 0 ); + return core_slice.call( this ); }, // Get the Nth element in the matched element set OR @@ -233,15 +215,9 @@ jQuery.fn = jQuery.prototype = { // Take an array of elements and push it onto the stack // (returning the new matched element set) pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set - var ret = this.constructor(); - - if ( jQuery.isArray( elems ) ) { - push.apply( ret, elems ); - - } else { - jQuery.merge( ret, elems ); - } + var ret = jQuery.merge( this.constructor(), elems ); // Add the old object onto the stack (as a reference) ret.prevObject = this; @@ -249,7 +225,7 @@ jQuery.fn = jQuery.prototype = { ret.context = this.context; if ( name === "find" ) { - ret.selector = this.selector + (this.selector ? " " : "") + selector; + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; } else if ( name ) { ret.selector = this.selector + "." + name + "(" + selector + ")"; } @@ -266,19 +242,17 @@ jQuery.fn = jQuery.prototype = { }, ready: function( fn ) { - // Attach the listeners - jQuery.bindReady(); - // Add the callback - readyList.done( fn ); + jQuery.ready.promise().done( fn ); return this; }, eq: function( i ) { + i = +i; return i === -1 ? this.slice( i ) : - this.slice( i, +i + 1 ); + this.slice( i, i + 1 ); }, first: function() { @@ -290,8 +264,8 @@ jQuery.fn = jQuery.prototype = { }, slice: function() { - return this.pushStack( slice.apply( this, arguments ), - "slice", slice.call(arguments).join(",") ); + return this.pushStack( core_slice.apply( this, arguments ), + "slice", core_slice.call(arguments).join(",") ); }, map: function( callback ) { @@ -306,7 +280,7 @@ jQuery.fn = jQuery.prototype = { // For internal use only. // Behaves like an Array's method, not like a jQuery method. - push: push, + push: core_push, sort: [].sort, splice: [].splice }; @@ -409,73 +383,31 @@ jQuery.extend({ // Handle when the DOM is ready ready: function( wait ) { - // Either a released hold or an DOMready/load event and not yet ready - if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( !document.body ) { - return setTimeout( jQuery.ready, 1 ); - } - // Remember that the DOM is ready - jQuery.isReady = true; - - // If a normal DOM Ready event fired, decrement, and wait if need be - if ( wait !== true && --jQuery.readyWait > 0 ) { - return; - } - - // If there are functions bound, to execute - readyList.resolveWith( document, [ jQuery ] ); - - // Trigger any bound ready events - if ( jQuery.fn.trigger ) { - jQuery( document ).trigger( "ready" ).unbind( "ready" ); - } - } - }, - - bindReady: function() { - if ( readyList ) { + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { return; } - readyList = jQuery._Deferred(); - - // Catch cases where $(document).ready() is called after the - // browser event has already occurred. - if ( document.readyState === "complete" ) { - // Handle it asynchronously to allow scripts the opportunity to delay ready + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { return setTimeout( jQuery.ready, 1 ); } - // Mozilla, Opera and webkit nightlies currently support this event - if ( document.addEventListener ) { - // Use the handy event callback - document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + // Remember that the DOM is ready + jQuery.isReady = true; - // A fallback to window.onload, that will always work - window.addEventListener( "load", jQuery.ready, false ); + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } - // If IE event model is used - } else if ( document.attachEvent ) { - // ensure firing before onload, - // maybe late but safe also for iframes - document.attachEvent( "onreadystatechange", DOMContentLoaded ); + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); - // A fallback to window.onload, that will always work - window.attachEvent( "onload", jQuery.ready ); - - // If IE and not a frame - // continually check to see if the document is ready - var toplevel = false; - - try { - toplevel = window.frameElement == null; - } catch(e) {} - - if ( document.documentElement.doScroll && toplevel ) { - doScrollCheck(); - } + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); } }, @@ -490,19 +422,18 @@ jQuery.extend({ return jQuery.type(obj) === "array"; }, - // A crude way of determining if an object is a window isWindow: function( obj ) { - return obj && typeof obj === "object" && "setInterval" in obj; + return obj != null && obj == obj.window; }, - isNaN: function( obj ) { - return obj == null || !rdigit.test( obj ) || isNaN( obj ); + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); }, type: function( obj ) { return obj == null ? String( obj ) : - class2type[ toString.call(obj) ] || "object"; + class2type[ core_toString.call(obj) ] || "object"; }, isPlainObject: function( obj ) { @@ -513,10 +444,15 @@ jQuery.extend({ return false; } - // Not own constructor property must be Object - if ( obj.constructor && - !hasOwn.call(obj, "constructor") && - !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 return false; } @@ -526,22 +462,47 @@ jQuery.extend({ var key; for ( key in obj ) {} - return key === undefined || hasOwn.call( obj, key ); + return key === undefined || core_hasOwn.call( obj, key ); }, isEmptyObject: function( obj ) { - for ( var name in obj ) { + var name; + for ( name in obj ) { return false; } return true; }, error: function( msg ) { - throw msg; + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // scripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, scripts ) { + var parsed; + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + scripts = context; + context = 0; + } + context = context || document; + + // Single tag + if ( (parsed = rsingleTag.exec( data )) ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] ); + return jQuery.merge( [], + (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes ); }, parseJSON: function( data ) { - if ( typeof data !== "string" || !data ) { + if ( !data || typeof data !== "string") { return null; } @@ -559,31 +520,33 @@ jQuery.extend({ .replace( rvalidtokens, "]" ) .replace( rvalidbraces, "")) ) { - return (new Function( "return " + data ))(); + return ( new Function( "return " + data ) )(); } jQuery.error( "Invalid JSON: " + data ); }, // Cross-browser xml parsing - // (xml & tmp used internally) - parseXML: function( data , xml , tmp ) { - - if ( window.DOMParser ) { // Standard - tmp = new DOMParser(); - xml = tmp.parseFromString( data , "text/xml" ); - } else { // IE - xml = new ActiveXObject( "Microsoft.XMLDOM" ); - xml.async = "false"; - xml.loadXML( data ); + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; } - - tmp = xml.documentElement; - - if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { jQuery.error( "Invalid XML: " + data ); } - return xml; }, @@ -593,7 +556,7 @@ jQuery.extend({ // Workarounds based on findings by Jim Driscoll // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context globalEval: function( data ) { - if ( data && rnotwhite.test( data ) ) { + if ( data && core_rnotwhite.test( data ) ) { // We use execScript on Internet Explorer // We use an anonymous function so that context is window // rather than jQuery in Firefox @@ -603,26 +566,33 @@ jQuery.extend({ } }, + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + nodeName: function( elem, name ) { - return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); }, // args is for internal usage only - each: function( object, callback, args ) { - var name, i = 0, - length = object.length, - isObj = length === undefined || jQuery.isFunction( object ); + each: function( obj, callback, args ) { + var name, + i = 0, + length = obj.length, + isObj = length === undefined || jQuery.isFunction( obj ); if ( args ) { if ( isObj ) { - for ( name in object ) { - if ( callback.apply( object[ name ], args ) === false ) { + for ( name in obj ) { + if ( callback.apply( obj[ name ], args ) === false ) { break; } } } else { for ( ; i < length; ) { - if ( callback.apply( object[ i++ ], args ) === false ) { + if ( callback.apply( obj[ i++ ], args ) === false ) { break; } } @@ -631,68 +601,74 @@ jQuery.extend({ // A special, fast, case for the most common use of each } else { if ( isObj ) { - for ( name in object ) { - if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + for ( name in obj ) { + if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) { break; } } } else { for ( ; i < length; ) { - if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) { break; } } } } - return object; + return obj; }, // Use native String.trim function wherever possible - trim: trim ? + trim: core_trim && !core_trim.call("\uFEFF\xA0") ? function( text ) { return text == null ? "" : - trim.call( text ); + core_trim.call( text ); } : // Otherwise use our own trimming functionality function( text ) { return text == null ? "" : - text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + ( text + "" ).replace( rtrim, "" ); }, // results is for internal usage only - makeArray: function( array, results ) { - var ret = results || []; + makeArray: function( arr, results ) { + var type, + ret = results || []; - if ( array != null ) { + if ( arr != null ) { // The window, strings (and functions) also have 'length' - // The extra typeof function check is to prevent crashes - // in Safari 2 (See: #3039) // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 - var type = jQuery.type( array ); + type = jQuery.type( arr ); - if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { - push.call( ret, array ); + if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) { + core_push.call( ret, arr ); } else { - jQuery.merge( ret, array ); + jQuery.merge( ret, arr ); } } return ret; }, - inArray: function( elem, array ) { + inArray: function( elem, arr, i ) { + var len; - if ( indexOf ) { - return indexOf.call( array, elem ); - } + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } - for ( var i = 0, length = array.length; i < length; i++ ) { - if ( array[ i ] === elem ) { - return i; + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } } } @@ -700,11 +676,12 @@ jQuery.extend({ }, merge: function( first, second ) { - var i = first.length, + var l = second.length, + i = first.length, j = 0; - if ( typeof second.length === "number" ) { - for ( var l = second.length; j < l; j++ ) { + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { first[ i++ ] = second[ j ]; } @@ -720,12 +697,15 @@ jQuery.extend({ }, grep: function( elems, callback, inv ) { - var ret = [], retVal; + var retVal, + ret = [], + i = 0, + length = elems.length; inv = !!inv; // Go through the array, only saving the items // that pass the validator function - for ( var i = 0, length = elems.length; i < length; i++ ) { + for ( ; i < length; i++ ) { retVal = !!callback( elems[ i ], i ); if ( inv !== retVal ) { ret.push( elems[ i ] ); @@ -737,7 +717,8 @@ jQuery.extend({ // arg is for internal usage only map: function( elems, callback, arg ) { - var value, key, ret = [], + var value, key, + ret = [], i = 0, length = elems.length, // jquery objects are treated as arrays @@ -774,8 +755,10 @@ jQuery.extend({ // Bind a function to a context, optionally partially applying any // arguments. proxy: function( fn, context ) { + var tmp, args, proxy; + if ( typeof context === "string" ) { - var tmp = fn[ context ]; + tmp = fn[ context ]; context = fn; fn = tmp; } @@ -787,401 +770,519 @@ jQuery.extend({ } // Simulated bind - var args = slice.call( arguments, 2 ), - proxy = function() { - return fn.apply( context, args.concat( slice.call( arguments ) ) ); - }; + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context, args.concat( core_slice.call( arguments ) ) ); + }; // Set the guid of unique handler to the same of original handler, so it can be removed - proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + proxy.guid = fn.guid = fn.guid || jQuery.guid++; return proxy; }, - // Mutifunctional method to get and set values to a collection - // The value/s can be optionally by executed if its a function - access: function( elems, key, value, exec, fn, pass ) { - var length = elems.length; + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, pass ) { + var exec, + bulk = key == null, + i = 0, + length = elems.length; - // Setting many attributes - if ( typeof key === "object" ) { - for ( var k in key ) { - jQuery.access( elems, k, key[k], exec, fn, value ); + // Sets many values + if ( key && typeof key === "object" ) { + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); } - return elems; - } + chainable = 1; - // Setting one attribute - if ( value !== undefined ) { + // Sets one value + } else if ( value !== undefined ) { // Optionally, function values get executed if exec is true - exec = !pass && exec && jQuery.isFunction(value); + exec = pass === undefined && jQuery.isFunction( value ); - for ( var i = 0; i < length; i++ ) { - fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + if ( bulk ) { + // Bulk operations only iterate when executing function values + if ( exec ) { + exec = fn; + fn = function( elem, key, value ) { + return exec.call( jQuery( elem ), value ); + }; + + // Otherwise they run against the entire set + } else { + fn.call( elems, value ); + fn = null; + } } - return elems; + if ( fn ) { + for (; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + } + + chainable = 1; } - // Getting an attribute - return length ? fn( elems[0], key ) : undefined; + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; }, now: function() { - return (new Date()).getTime(); - }, - - // Use of jQuery.browser is frowned upon. - // More details: http://docs.jquery.com/Utilities/jQuery.browser - uaMatch: function( ua ) { - ua = ua.toLowerCase(); - - var match = rwebkit.exec( ua ) || - ropera.exec( ua ) || - rmsie.exec( ua ) || - ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || - []; - - return { browser: match[1] || "", version: match[2] || "0" }; - }, - - sub: function() { - function jQuerySub( selector, context ) { - return new jQuerySub.fn.init( selector, context ); - } - jQuery.extend( true, jQuerySub, this ); - jQuerySub.superclass = this; - jQuerySub.fn = jQuerySub.prototype = this(); - jQuerySub.fn.constructor = jQuerySub; - jQuerySub.sub = this.sub; - jQuerySub.fn.init = function init( selector, context ) { - if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { - context = jQuerySub( context ); - } - - return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); - }; - jQuerySub.fn.init.prototype = jQuerySub.fn; - var rootjQuerySub = jQuerySub(document); - return jQuerySub; - }, - - browser: {} + return ( new Date() ).getTime(); + } }); +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready, 1 ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + // Populate the class2type map jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { class2type[ "[object " + name + "]" ] = name.toLowerCase(); }); -browserMatch = jQuery.uaMatch( userAgent ); -if ( browserMatch.browser ) { - jQuery.browser[ browserMatch.browser ] = true; - jQuery.browser.version = browserMatch.version; -} - -// Deprecated, use jQuery.browser.webkit instead -if ( jQuery.browser.webkit ) { - jQuery.browser.safari = true; -} - -// IE doesn't match non-breaking spaces with \s -if ( rnotwhite.test( "\xA0" ) ) { - trimLeft = /^[\s\xA0]+/; - trimRight = /[\s\xA0]+$/; -} - // All jQuery objects should point back to these rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; -// Cleanup functions for the document ready method -if ( document.addEventListener ) { - DOMContentLoaded = function() { - document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); - jQuery.ready(); - }; - -} else if ( document.attachEvent ) { - DOMContentLoaded = function() { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( document.readyState === "complete" ) { - document.detachEvent( "onreadystatechange", DOMContentLoaded ); - jQuery.ready(); - } - }; +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.split( core_rspace ), function( _, flag ) { + object[ flag ] = true; + }); + return object; } -// The DOM ready check for Internet Explorer -function doScrollCheck() { - if ( jQuery.isReady ) { - return; - } +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { - try { - // If IE is used, use the trick by Diego Perini - // http://javascript.nwbox.com/IEContentLoaded/ - document.documentElement.doScroll("left"); - } catch(e) { - setTimeout( doScrollCheck, 1 ); - return; - } + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); - // and execute any waiting functions - jQuery.ready(); -} - -// Expose jQuery to the global object -return jQuery; - -})(); - - -var // Promise methods - promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), - // Static reference to slice - sliceDeferred = [].slice; - -jQuery.extend({ - // Create a simple deferred (one callbacks list) - _Deferred: function() { - var // callbacks list - callbacks = [], - // stored [ context , args ] - fired, - // to avoid firing when already doing so - firing, - // flag to know if the deferred has been cancelled - cancelled, - // the deferred itself - deferred = { - - // done( f1, f2, ...) - done: function() { - if ( !cancelled ) { - var args = arguments, - i, - length, - elem, - type, - _fired; - if ( fired ) { - _fired = fired; - fired = 0; - } - for ( i = 0, length = args.length; i < length; i++ ) { - elem = args[ i ]; - type = jQuery.type( elem ); - if ( type === "array" ) { - deferred.done.apply( deferred, elem ); - } else if ( type === "function" ) { - callbacks.push( elem ); - } - } - if ( _fired ) { - deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); - } - } - return this; - }, - - // resolve with given context and args - resolveWith: function( context, args ) { - if ( !cancelled && !fired && !firing ) { - // make sure args are available (#8421) - args = args || []; - firing = 1; - try { - while( callbacks[ 0 ] ) { - callbacks.shift().apply( context, args ); - } - } - finally { - fired = [ context, args ]; - firing = 0; - } - } - return this; - }, - - // resolve with this as context and given arguments - resolve: function() { - deferred.resolveWith( this, arguments ); - return this; - }, - - // Has this deferred been resolved? - isResolved: function() { - return !!( firing || fired ); - }, - - // Cancel - cancel: function() { - cancelled = 1; - callbacks = []; - return this; + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } } - }; - - return deferred; - }, - - // Full fledged deferred (two callbacks list) - Deferred: function( func ) { - var deferred = jQuery._Deferred(), - failDeferred = jQuery._Deferred(), - promise; - // Add errorDeferred methods, then and promise - jQuery.extend( deferred, { - then: function( doneCallbacks, failCallbacks ) { - deferred.done( doneCallbacks ).fail( failCallbacks ); return this; }, - always: function() { - return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); - }, - fail: failDeferred.done, - rejectWith: failDeferred.resolveWith, - reject: failDeferred.resolve, - isRejected: failDeferred.isResolved, - pipe: function( fnDone, fnFail ) { - return jQuery.Deferred(function( newDefer ) { - jQuery.each( { - done: [ fnDone, "resolve" ], - fail: [ fnFail, "reject" ] - }, function( handler, data ) { - var fn = data[ 0 ], - action = data[ 1 ], - returned; - if ( jQuery.isFunction( fn ) ) { - deferred[ handler ](function() { - returned = fn.apply( this, arguments ); - if ( returned && jQuery.isFunction( returned.promise ) ) { - returned.promise().then( newDefer.resolve, newDefer.reject ); - } else { - newDefer[ action ]( returned ); + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; } - }); - } else { - deferred[ handler ]( newDefer[ action ] ); + if ( index <= firingIndex ) { + firingIndex--; + } + } } }); - }).promise(); + } + return this; }, - // Get a promise for this deferred - // If obj is provided, the promise aspect is added to the object - promise: function( obj ) { - if ( obj == null ) { - if ( promise ) { - return promise; + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); } - promise = obj = {}; } - var i = promiseMethods.length; - while( i-- ) { - obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; - } - return obj; + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] = list.fire + deferred[ tuple[0] ] = list.fire; + deferred[ tuple[0] + "With" ] = list.fireWith; }); - // Make sure only one callback list will be used - deferred.done( failDeferred.cancel ).fail( deferred.cancel ); - // Unexpose cancel - delete deferred.cancel; + + // Make the deferred a promise + promise.promise( deferred ); + // Call given func if any if ( func ) { func.call( deferred, deferred ); } + + // All done! return deferred; }, // Deferred helper - when: function( firstParam ) { - var args = arguments, - i = 0, - length = args.length, - count = length, - deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? - firstParam : - jQuery.Deferred(); - function resolveFunc( i ) { - return function( value ) { - args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; - if ( !( --count ) ) { - // Strange bug in FF4: - // Values changed onto the arguments object sometimes end up as undefined values - // outside the $.when method. Cloning the object into a fresh array solves the issue - deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); - } - }; - } + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved if ( length > 1 ) { - for( ; i < length; i++ ) { - if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { - args[ i ].promise().then( resolveFunc(i), deferred.reject ); + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); } else { - --count; + --remaining; } } - if ( !count ) { - deferred.resolveWith( deferred, args ); - } - } else if ( deferred !== firstParam ) { - deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + return deferred.promise(); } }); - - - jQuery.support = (function() { - var div = document.createElement( "div" ), - documentElement = document.documentElement, + var support, all, a, select, opt, input, - marginDiv, - support, fragment, - body, - bodyStyle, - tds, - events, eventName, i, - isSupported; + isSupported, + clickFn, + div = document.createElement("div"); - // Preliminary tests - div.setAttribute("className", "t"); - div.innerHTML = "
    a"; + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = "
    a"; - all = div.getElementsByTagName( "*" ); - a = div.getElementsByTagName( "a" )[ 0 ]; - - // Can't get basic test support - if ( !all || !all.length || !a ) { + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { return {}; } - // First batch of supports tests - select = document.createElement( "select" ); + // First batch of tests + select = document.createElement("select"); opt = select.appendChild( document.createElement("option") ); - input = div.getElementsByTagName( "input" )[ 0 ]; + input = div.getElementsByTagName("input")[ 0 ]; + a.style.cssText = "top:1px;float:left;opacity:.5"; support = { // IE strips leading whitespace when .innerHTML is used leadingWhitespace: ( div.firstChild.nodeType === 3 ), // Make sure that tbody elements aren't automatically inserted // IE will insert them into empty tables - tbody: !div.getElementsByTagName( "tbody" ).length, + tbody: !div.getElementsByTagName("tbody").length, // Make sure that link elements get serialized correctly by innerHTML // This requires a wrapper element in IE - htmlSerialize: !!div.getElementsByTagName( "link" ).length, + htmlSerialize: !!div.getElementsByTagName("link").length, // Get the style information from getAttribute // (IE uses .cssText instead) @@ -1189,12 +1290,12 @@ jQuery.support = (function() { // Make sure that URLs aren't manipulated // (IE normalizes it by default) - hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + hrefNormalized: ( a.getAttribute("href") === "/a" ), // Make sure that element opacity exists // (IE uses filter instead) // Use a regex to work around a WebKit issue. See #5145 - opacity: /^0.55$/.test( a.style.opacity ), + opacity: /^0.5/.test( a.style.opacity ), // Verify style float existence // (IE uses styleFloat instead of cssFloat) @@ -1212,6 +1313,16 @@ jQuery.support = (function() { // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) getSetAttribute: div.className !== "t", + // Tests for enctype support on a form (#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + // Will be defined later submitBubbles: true, changeBubbles: true, @@ -1220,7 +1331,9 @@ jQuery.support = (function() { noCloneEvent: true, inlineBlockNeedsLayout: false, shrinkWrapBlocks: false, - reliableMarginRight: true + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false }; // Make sure checked status is properly cloned @@ -1241,124 +1354,53 @@ jQuery.support = (function() { } if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { - div.attachEvent( "onclick", function click() { + div.attachEvent( "onclick", clickFn = function() { // Cloning a node shouldn't copy over any // bound event handlers (IE does this) support.noCloneEvent = false; - div.detachEvent( "onclick", click ); }); - div.cloneNode( true ).fireEvent( "onclick" ); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); } - // Check if a radio maintains it's value + // Check if a radio maintains its value // after being appended to the DOM input = document.createElement("input"); input.value = "t"; - input.setAttribute("type", "radio"); + input.setAttribute( "type", "radio" ); support.radioValue = input.value === "t"; - input.setAttribute("checked", "checked"); + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + div.appendChild( input ); fragment = document.createDocumentFragment(); - fragment.appendChild( div.firstChild ); + fragment.appendChild( div.lastChild ); // WebKit doesn't clone checked state correctly in fragments support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; - div.innerHTML = ""; - - // Figure out if the W3C box model works as expected - div.style.width = div.style.paddingLeft = "1px"; - - // We use our own, invisible, body - body = document.createElement( "body" ); - bodyStyle = { - visibility: "hidden", - width: 0, - height: 0, - border: 0, - margin: 0, - // Set background to avoid IE crashes when removing (#9028) - background: "none" - }; - for ( i in bodyStyle ) { - body.style[ i ] = bodyStyle[ i ]; - } - body.appendChild( div ); - documentElement.insertBefore( body, documentElement.firstChild ); - // Check if a disconnected checkbox will retain its checked // value of true after appended to the DOM (IE6/7) support.appendChecked = input.checked; - support.boxModel = div.offsetWidth === 2; - - if ( "zoom" in div.style ) { - // Check if natively block-level elements act like inline-block - // elements when setting their display to 'inline' and giving - // them layout - // (IE < 8 does this) - div.style.display = "inline"; - div.style.zoom = 1; - support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); - - // Check if elements with layout shrink-wrap their children - // (IE 6 does this) - div.style.display = ""; - div.innerHTML = "
    "; - support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); - } - - div.innerHTML = "
    t
    "; - tds = div.getElementsByTagName( "td" ); - - // Check if table cells still have offsetWidth/Height when they are set - // to display:none and there are still other visible table cells in a - // table row; if so, offsetWidth/Height are not reliable for use when - // determining if an element has been hidden directly using - // display:none (it is still safe to use offsets if a parent element is - // hidden; don safety goggles and see bug #4512 for more information). - // (only IE 8 fails this test) - isSupported = ( tds[ 0 ].offsetHeight === 0 ); - - tds[ 0 ].style.display = ""; - tds[ 1 ].style.display = "none"; - - // Check if empty table cells still have offsetWidth/Height - // (IE < 8 fail this test) - support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); - div.innerHTML = ""; - - // Check if div with explicit width and no margin-right incorrectly - // gets computed margin-right based on width of container. For more - // info see bug #3333 - // Fails in WebKit before Feb 2011 nightlies - // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right - if ( document.defaultView && document.defaultView.getComputedStyle ) { - marginDiv = document.createElement( "div" ); - marginDiv.style.width = "0"; - marginDiv.style.marginRight = "0"; - div.appendChild( marginDiv ); - support.reliableMarginRight = - ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; - } - - // Remove the body element we added - body.innerHTML = ""; - documentElement.removeChild( body ); + fragment.removeChild( input ); + fragment.appendChild( div ); // Technique from Juriy Zaytsev - // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ // We only care about the case where non-standard event systems // are used, namely in IE. Short-circuiting here helps us to // avoid an eval call (in setAttribute) which can cause CSP // to go haywire. See: https://developer.mozilla.org/en/Security/CSP if ( div.attachEvent ) { - for( i in { - submit: 1, - change: 1, - focusin: 1 - } ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { eventName = "on" + i; isSupported = ( eventName in div ); if ( !isSupported ) { @@ -1369,22 +1411,110 @@ jQuery.support = (function() { } } + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
    t
    "; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, we've window.getComputedStyle + // because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "
    "; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + return support; })(); - -// Keep track of boxModel -jQuery.boxModel = jQuery.support.boxModel; - - - - -var rbrace = /^(?:\{.*\}|\[.*\])$/, - rmultiDash = /([a-z])([A-Z])/g; +var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; jQuery.extend({ cache: {}, - // Please use with caution + deletedIds: [], + + // Remove at next major release (1.9/2.0) uuid: 0, // Unique for each copy of jQuery on the page @@ -1402,7 +1532,6 @@ jQuery.extend({ hasData: function( elem ) { elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; - return !!elem && !isEmptyDataObject( elem ); }, @@ -1411,7 +1540,9 @@ jQuery.extend({ return; } - var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", // We have to handle DOM nodes and JS objects differently because IE6-7 // can't GC object references properly across the DOM-JS boundary @@ -1423,11 +1554,11 @@ jQuery.extend({ // Only defining an ID for JS objects if its cache already exists allows // the code to shortcut on the same path as a DOM node with no cache - id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; // Avoid doing any more work than we need to when trying to get data on an // object that has no data at all - if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { return; } @@ -1435,18 +1566,17 @@ jQuery.extend({ // Only DOM nodes need a new unique ID for each element since their data // ends up in the global cache if ( isNode ) { - elem[ jQuery.expando ] = id = ++jQuery.uuid; + elem[ internalKey ] = id = jQuery.deletedIds.pop() || jQuery.guid++; } else { - id = jQuery.expando; + id = internalKey; } } if ( !cache[ id ] ) { cache[ id ] = {}; - // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery - // metadata on plain JS objects when the object is serialized using - // JSON.stringify + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify if ( !isNode ) { cache[ id ].toJSON = jQuery.noop; } @@ -1456,37 +1586,47 @@ jQuery.extend({ // shallow copied over onto the existing cache if ( typeof name === "object" || typeof name === "function" ) { if ( pvt ) { - cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + cache[ id ] = jQuery.extend( cache[ id ], name ); } else { - cache[ id ] = jQuery.extend(cache[ id ], name); + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); } } thisCache = cache[ id ]; - // Internal jQuery data is stored in a separate object inside the object's data + // jQuery data() is stored in a separate object inside the object's internal data // cache in order to avoid key collisions between internal data and user-defined - // data - if ( pvt ) { - if ( !thisCache[ internalKey ] ) { - thisCache[ internalKey ] = {}; + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; } - thisCache = thisCache[ internalKey ]; + thisCache = thisCache.data; } if ( data !== undefined ) { thisCache[ jQuery.camelCase( name ) ] = data; } - // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should - // not attempt to inspect the internal events object using jQuery.data, as this - // internal data object is undocumented and subject to change. - if ( name === "events" && !thisCache[name] ) { - return thisCache[ internalKey ] && thisCache[ internalKey ].events; + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; } - return getByName ? thisCache[ jQuery.camelCase( name ) ] : thisCache; + return ret; }, removeData: function( elem, name, pvt /* Internal Use Only */ ) { @@ -1494,12 +1634,12 @@ jQuery.extend({ return; } - var internalKey = jQuery.expando, isNode = elem.nodeType, + var thisCache, i, l, + + isNode = elem.nodeType, // See jQuery.data for more information cache = isNode ? jQuery.cache : elem, - - // See jQuery.data for more information id = isNode ? elem[ jQuery.expando ] : jQuery.expando; // If there is already no cache entry for this object, there is no @@ -1509,69 +1649,64 @@ jQuery.extend({ } if ( name ) { - var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + thisCache = pvt ? cache[ id ] : cache[ id ].data; if ( thisCache ) { - delete thisCache[ name ]; + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } // If there is no data left in the cache, we want to continue // and let the cache object itself get destroyed - if ( !isEmptyDataObject(thisCache) ) { + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { return; } } } // See jQuery.data for more information - if ( pvt ) { - delete cache[ id ][ internalKey ]; + if ( !pvt ) { + delete cache[ id ].data; // Don't destroy the parent cache unless the internal data object // had been the only thing left in it - if ( !isEmptyDataObject(cache[ id ]) ) { + if ( !isEmptyDataObject( cache[ id ] ) ) { return; } } - var internalCache = cache[ id ][ internalKey ]; + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); - // Browsers that fail expando deletion also refuse to delete expandos on - // the window, but it will allow it on all other JS objects; other browsers - // don't care - if ( jQuery.support.deleteExpando || cache != window ) { + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { delete cache[ id ]; + + // When all else fails, null } else { cache[ id ] = null; } - - // We destroyed the entire user cache at once because it's faster than - // iterating through each key, but we need to continue to persist internal - // data if it existed - if ( internalCache ) { - cache[ id ] = {}; - // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery - // metadata on plain JS objects when the object is serialized using - // JSON.stringify - if ( !isNode ) { - cache[ id ].toJSON = jQuery.noop; - } - - cache[ id ][ internalKey ] = internalCache; - - // Otherwise, we need to eliminate the expando on the node to avoid - // false lookups in the cache for entries that no longer exist - } else if ( isNode ) { - // IE does not allow us to delete expando properties from nodes, - // nor does it have a removeAttribute function on Document nodes; - // we must handle all of these cases - if ( jQuery.support.deleteExpando ) { - delete elem[ jQuery.expando ]; - } else if ( elem.removeAttribute ) { - elem.removeAttribute( jQuery.expando ); - } else { - elem[ jQuery.expando ] = null; - } - } }, // For internal use only. @@ -1581,74 +1716,79 @@ jQuery.extend({ // A method for determining if a DOM node can handle the data expando acceptData: function( elem ) { - if ( elem.nodeName ) { - var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; - if ( match ) { - return !(match === true || elem.getAttribute("classid") !== match); - } - } - - return true; + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; } }); jQuery.fn.extend({ data: function( key, value ) { - var data = null; + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; - if ( typeof key === "undefined" ) { + // Gets all values + if ( key === undefined ) { if ( this.length ) { - data = jQuery.data( this[0] ); + data = jQuery.data( elem ); - if ( this[0].nodeType === 1 ) { - var attr = this[0].attributes, name; - for ( var i = 0, l = attr.length; i < l; i++ ) { + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { name = attr[i].name; - if ( name.indexOf( "data-" ) === 0 ) { + if ( !name.indexOf( "data-" ) ) { name = jQuery.camelCase( name.substring(5) ); - dataAttr( this[0], name, data[ name ] ); + dataAttr( elem, name, data[ name ] ); } } + jQuery._data( elem, "parsedAttrs", true ); } } return data; + } - } else if ( typeof key === "object" ) { + // Sets multiple values + if ( typeof key === "object" ) { return this.each(function() { jQuery.data( this, key ); }); } - var parts = key.split("."); + parts = key.split( ".", 2 ); parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; - if ( value === undefined ) { - data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + return jQuery.access( this, function( value ) { - // Try to fetch any internally stored data first - if ( data === undefined && this.length ) { - data = jQuery.data( this[0], key ); - data = dataAttr( this[0], key, data ); + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; } - return data === undefined && parts[1] ? - this.data( parts[0] ) : - data; + parts[1] = value; + this.each(function() { + var self = jQuery( this ); - } else { - return this.each(function() { - var $this = jQuery( this ), - args = [ parts[0], value ]; - - $this.triggerHandler( "setData" + parts[1] + "!", args ); + self.triggerHandler( "setData" + part, parts ); jQuery.data( this, key, value ); - $this.triggerHandler( "changeData" + parts[1] + "!", args ); + self.triggerHandler( "changeData" + part, parts ); }); - } + }, null, value, arguments.length > 1, null, false ); }, removeData: function( key ) { @@ -1662,7 +1802,8 @@ function dataAttr( elem, key, data ) { // If nothing was found internally, try to fetch any // data from the HTML5 data-* attribute if ( data === undefined && elem.nodeType === 1 ) { - var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); data = elem.getAttribute( name ); @@ -1671,8 +1812,9 @@ function dataAttr( elem, key, data ) { data = data === "true" ? true : data === "false" ? false : data === "null" ? null : - !jQuery.isNaN( data ) ? parseFloat( data ) : - rbrace.test( data ) ? jQuery.parseJSON( data ) : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : data; } catch( e ) {} @@ -1687,11 +1829,15 @@ function dataAttr( elem, key, data ) { return data; } -// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON -// property to be considered empty objects; this property always exists in -// order to make sure JSON.stringify does not expose internal metadata +// checks a cache object for emptiness function isEmptyDataObject( obj ) { - for ( var name in obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } if ( name !== "toJSON" ) { return false; } @@ -1699,71 +1845,23 @@ function isEmptyDataObject( obj ) { return true; } - - - - -function handleQueueMarkDefer( elem, type, src ) { - var deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - defer = jQuery.data( elem, deferDataKey, undefined, true ); - if ( defer && - ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && - ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { - // Give room for hard-coded callbacks to fire first - // and eventually mark/queue something else on the element - setTimeout( function() { - if ( !jQuery.data( elem, queueDataKey, undefined, true ) && - !jQuery.data( elem, markDataKey, undefined, true ) ) { - jQuery.removeData( elem, deferDataKey, true ); - defer.resolve(); - } - }, 0 ); - } -} - jQuery.extend({ - - _mark: function( elem, type ) { - if ( elem ) { - type = (type || "fx") + "mark"; - jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); - } - }, - - _unmark: function( force, elem, type ) { - if ( force !== true ) { - type = elem; - elem = force; - force = false; - } - if ( elem ) { - type = type || "fx"; - var key = type + "mark", - count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); - if ( count ) { - jQuery.data( elem, key, count, true ); - } else { - jQuery.removeData( elem, key, true ); - handleQueueMarkDefer( elem, type, "mark" ); - } - } - }, - queue: function( elem, type, data ) { + var queue; + if ( elem ) { - type = (type || "fx") + "queue"; - var q = jQuery.data( elem, type, undefined, true ); + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + // Speed up dequeue by getting out quickly if this is just a lookup if ( data ) { - if ( !q || jQuery.isArray(data) ) { - q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); } else { - q.push( data ); + queue.push( data ); } } - return q || []; + return queue || []; } }, @@ -1771,50 +1869,75 @@ jQuery.extend({ type = type || "fx"; var queue = jQuery.queue( elem, type ), + startLength = queue.length, fn = queue.shift(), - defer; + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; // If the fx queue is dequeued, always remove the progress sentinel if ( fn === "inprogress" ) { fn = queue.shift(); + startLength--; } if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being // automatically dequeued if ( type === "fx" ) { - queue.unshift("inprogress"); + queue.unshift( "inprogress" ); } - fn.call(elem, function() { - jQuery.dequeue(elem, type); - }); + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); } - if ( !queue.length ) { - jQuery.removeData( elem, type + "queue", true ); - handleQueueMarkDefer( elem, type, "queue" ); + if ( !startLength && hooks ) { + hooks.empty.fire(); } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); } }); jQuery.fn.extend({ queue: function( type, data ) { + var setter = 2; + if ( typeof type !== "string" ) { data = type; type = "fx"; + setter--; } - if ( data === undefined ) { + if ( arguments.length < setter ) { return jQuery.queue( this[0], type ); } - return this.each(function() { - var queue = jQuery.queue( this, type, data ); - if ( type === "fx" && queue[0] !== "inprogress" ) { - jQuery.dequeue( this, type ); - } - }); + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); }, dequeue: function( type ) { return this.each(function() { @@ -1824,14 +1947,14 @@ jQuery.fn.extend({ // Based off of the plugin by Clint Helfers, with permission. // http://blindsignals.com/index.php/2009/07/jquery-delay/ delay: function( time, type ) { - time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; type = type || "fx"; - return this.queue( type, function() { - var elem = this; - setTimeout(function() { - jQuery.dequeue( elem, type ); - }, time ); + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; }); }, clearQueue: function( type ) { @@ -1839,55 +1962,47 @@ jQuery.fn.extend({ }, // Get a promise resolved when queues of a certain type // are emptied (fx is the type by default) - promise: function( type, object ) { + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + if ( typeof type !== "string" ) { - object = type; + obj = type; type = undefined; } type = type || "fx"; - var defer = jQuery.Deferred(), - elements = this, - i = elements.length, - count = 1, - deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - tmp; - function resolve() { - if ( !( --count ) ) { - defer.resolveWith( elements, [ elements ] ); - } - } + while( i-- ) { - if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || - ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || - jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && - jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { count++; - tmp.done( resolve ); + tmp.empty.add( resolve ); } } resolve(); - return defer.promise(); + return defer.promise( obj ); } }); - - - - -var rclass = /[\n\t\r]/g, - rspace = /\s+/, +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, rreturn = /\r/g, rtype = /^(?:button|input)$/i, rfocusable = /^(?:button|input|object|select|textarea)$/i, - rclickable = /^a(?:rea)?$/i, + rclickable = /^a(?:rea|)$/i, rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, - rinvalidChar = /\:/, - formHook, boolHook; + getSetAttribute = jQuery.support.getSetAttribute; jQuery.fn.extend({ attr: function( name, value ) { - return jQuery.access( this, name, value, true, jQuery.attr ); + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); }, removeAttr: function( name ) { @@ -1895,11 +2010,11 @@ jQuery.fn.extend({ jQuery.removeAttr( this, name ); }); }, - + prop: function( name, value ) { - return jQuery.access( this, name, value, true, jQuery.prop ); + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); }, - + removeProp: function( name ) { name = jQuery.propFix[ name ] || name; return this.each(function() { @@ -1912,30 +2027,31 @@ jQuery.fn.extend({ }, addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + if ( jQuery.isFunction( value ) ) { - return this.each(function(i) { - var self = jQuery(this); - self.addClass( value.call(this, i, self.attr("class") || "") ); + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); }); } if ( value && typeof value === "string" ) { - var classNames = (value || "").split( rspace ); + classNames = value.split( core_rspace ); - for ( var i = 0, l = this.length; i < l; i++ ) { - var elem = this[i]; + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; if ( elem.nodeType === 1 ) { - if ( !elem.className ) { + if ( !elem.className && classNames.length === 1 ) { elem.className = value; } else { - var className = " " + elem.className + " ", - setClass = elem.className; + setClass = " " + elem.className + " "; - for ( var c = 0, cl = classNames.length; c < cl; c++ ) { - if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { - setClass += " " + classNames[c]; + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( setClass.indexOf( " " + classNames[ c ] + " " ) < 0 ) { + setClass += classNames[ c ] + " "; } } elem.className = jQuery.trim( setClass ); @@ -1948,30 +2064,30 @@ jQuery.fn.extend({ }, removeClass: function( value ) { - if ( jQuery.isFunction(value) ) { - return this.each(function(i) { - var self = jQuery(this); - self.removeClass( value.call(this, i, self.attr("class")) ); + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); }); } - if ( (value && typeof value === "string") || value === undefined ) { - var classNames = (value || "").split( rspace ); - - for ( var i = 0, l = this.length; i < l; i++ ) { - var elem = this[i]; + removes = ( value || "" ).split( core_rspace ); + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; if ( elem.nodeType === 1 && elem.className ) { - if ( value ) { - var className = (" " + elem.className + " ").replace(rclass, " "); - for ( var c = 0, cl = classNames.length; c < cl; c++ ) { - className = className.replace(" " + classNames[c] + " ", " "); - } - elem.className = jQuery.trim( className ); - } else { - elem.className = ""; + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") >= 0 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } } + elem.className = value ? jQuery.trim( className ) : ""; } } } @@ -1984,9 +2100,8 @@ jQuery.fn.extend({ isBool = typeof stateVal === "boolean"; if ( jQuery.isFunction( value ) ) { - return this.each(function(i) { - var self = jQuery(this); - self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); }); } @@ -1997,10 +2112,10 @@ jQuery.fn.extend({ i = 0, self = jQuery( this ), state = stateVal, - classNames = value.split( rspace ); + classNames = value.split( core_rspace ); while ( (className = classNames[ i++ ]) ) { - // check each className given, space seperated list + // check each className given, space separated list state = isBool ? state : !self.hasClass( className ); self[ state ? "addClass" : "removeClass" ]( className ); } @@ -2018,9 +2133,11 @@ jQuery.fn.extend({ }, hasClass: function( selector ) { - var className = " " + selector + " "; - for ( var i = 0, l = this.length; i < l; i++ ) { - if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { return true; } } @@ -2029,27 +2146,34 @@ jQuery.fn.extend({ }, val: function( value ) { - var hooks, ret, + var hooks, ret, isFunction, elem = this[0]; - + if ( !arguments.length ) { if ( elem ) { - hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { return ret; } - return (elem.value || "").replace(rreturn, ""); + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; } - return undefined; + return; } - var isFunction = jQuery.isFunction( value ); + isFunction = jQuery.isFunction( value ); return this.each(function( i ) { - var self = jQuery(this), val; + var val, + self = jQuery(this); if ( this.nodeType !== 1 ) { return; @@ -2072,7 +2196,7 @@ jQuery.fn.extend({ }); } - hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; // If set returns undefined, fall back to normal setting if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { @@ -2094,24 +2218,25 @@ jQuery.extend({ }, select: { get: function( elem ) { - var value, - index = elem.selectedIndex, - values = [], + var value, option, options = elem.options, - one = elem.type === "select-one"; - - // Nothing was selected - if ( index < 0 ) { - return null; - } + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; // Loop through all the selected options - for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { - var option = options[ i ]; + for ( ; i < max; i++ ) { + option = options[ i ]; - // Don't return options that are disabled or in a disabled optgroup - if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && - (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { // Get the specific value for the option value = jQuery( option ).val(); @@ -2126,11 +2251,6 @@ jQuery.extend({ } } - // Fixes Bug #2551 -- select.val() broken in IE after form.reset() - if ( one && !values.length && options.length ) { - return jQuery( options[ index ] ).val(); - } - return values; }, @@ -2149,76 +2269,52 @@ jQuery.extend({ } }, - attrFn: { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true - }, - - attrFix: { - // Always normalize to ensure hook usage - tabindex: "tabIndex" - }, - + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + attr: function( elem, name, value, pass ) { - var nType = elem.nodeType; - + var ret, hooks, notxml, + nType = elem.nodeType; + // don't get/set attributes on text, comment and attribute nodes if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return undefined; + return; } - if ( pass && name in jQuery.attrFn ) { + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { return jQuery( elem )[ name ]( value ); } // Fallback to prop when attributes are not supported - if ( !("getAttribute" in elem) ) { + if ( typeof elem.getAttribute === "undefined" ) { return jQuery.prop( elem, name, value ); } - var ret, hooks, - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); - // Normalize the name if needed - name = notxml && jQuery.attrFix[ name ] || name; - - hooks = jQuery.attrHooks[ name ]; - - if ( !hooks ) { - // Use boolHook for boolean attributes - if ( rboolean.test( name ) && - (typeof value === "boolean" || value === undefined || value.toLowerCase() === name.toLowerCase()) ) { - - hooks = boolHook; - - // Use formHook for forms and if the name contains certain characters - } else if ( formHook && (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) { - hooks = formHook; - } + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); } if ( value !== undefined ) { if ( value === null ) { jQuery.removeAttr( elem, name ); - return undefined; + return; } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { return ret; } else { - elem.setAttribute( name, "" + value ); + elem.setAttribute( name, value + "" ); return value; } - } else if ( hooks && "get" in hooks && notxml ) { - return hooks.get( elem, name ); + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; } else { @@ -2231,22 +2327,33 @@ jQuery.extend({ } }, - removeAttr: function( elem, name ) { - var propName; - if ( elem.nodeType === 1 ) { - name = jQuery.attrFix[ name ] || name; - - if ( jQuery.support.getSetAttribute ) { - // Use removeAttribute in browsers that support it - elem.removeAttribute( name ); - } else { - jQuery.attr( elem, name, "" ); - elem.removeAttributeNode( elem.getAttributeNode( name ) ); - } + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; - // Set corresponding property to false for boolean attributes - if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { - elem[ propName ] = false; + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } } } }, @@ -2270,17 +2377,23 @@ jQuery.extend({ } } }, - tabIndex: { - get: function( elem ) { - // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set - // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ - var attributeNode = elem.getAttributeNode("tabIndex"); - - return attributeNode && attributeNode.specified ? - parseInt( attributeNode.value, 10 ) : - rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? - 0 : - undefined; + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; } } }, @@ -2299,33 +2412,34 @@ jQuery.extend({ frameborder: "frameBorder", contenteditable: "contentEditable" }, - + prop: function( elem, name, value ) { - var nType = elem.nodeType; + var ret, hooks, notxml, + nType = elem.nodeType; // don't get/set properties on text, comment and attribute nodes if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return undefined; + return; } - var ret, hooks, - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); - // Try to normalize/fix the name - name = notxml && jQuery.propFix[ name ] || name; - - hooks = jQuery.propHooks[ name ]; + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } if ( value !== undefined ) { if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { return ret; } else { - return (elem[ name ] = value); + return ( elem[ name ] = value ); } } else { - if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { return ret; } else { @@ -2333,15 +2447,32 @@ jQuery.extend({ } } }, - - propHooks: {} + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } }); // Hook for boolean attributes boolHook = { get: function( elem, name ) { // Align boolean attributes with corresponding properties - return elem[ jQuery.propFix[ name ] || name ] ? + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? name.toLowerCase() : undefined; }, @@ -2356,7 +2487,7 @@ boolHook = { propName = jQuery.propFix[ name ] || name; if ( propName in elem ) { // Only set the IDL specifically if it already exists on the element - elem[ propName ] = value; + elem[ propName ] = true; } elem.setAttribute( name, name.toLowerCase() ); @@ -2365,48 +2496,33 @@ boolHook = { } }; -// Use the value property for back compat -// Use the formHook for button elements in IE6/7 (#1954) -jQuery.attrHooks.value = { - get: function( elem, name ) { - if ( formHook && jQuery.nodeName( elem, "button" ) ) { - return formHook.get( elem, name ); - } - return elem.value; - }, - set: function( elem, value, name ) { - if ( formHook && jQuery.nodeName( elem, "button" ) ) { - return formHook.set( elem, value, name ); - } - // Does not return so that setAttribute is also used - elem.value = value; - } -}; - // IE6/7 do not support getting/setting some attributes with get/setAttribute -if ( !jQuery.support.getSetAttribute ) { +if ( !getSetAttribute ) { - // propFix is more comprehensive and contains all fixes - jQuery.attrFix = jQuery.propFix; - - // Use this for any attribute on a form in IE6/7 - formHook = jQuery.attrHooks.name = jQuery.valHooks.button = { + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { get: function( elem, name ) { var ret; ret = elem.getAttributeNode( name ); - // Return undefined if nodeValue is empty string - return ret && ret.nodeValue !== "" ? - ret.nodeValue : + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : undefined; }, set: function( elem, value, name ) { - // Check form objects in IE (multiple bugs related) - // Only use nodeValue if the attribute node exists on the form + // Set the existing or create a new attribute node var ret = elem.getAttributeNode( name ); - if ( ret ) { - ret.nodeValue = value; - return value; + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); } + return ( ret.value = value + "" ); } }; @@ -2422,6 +2538,18 @@ if ( !jQuery.support.getSetAttribute ) { } }); }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; } @@ -2445,7 +2573,7 @@ if ( !jQuery.support.style ) { return elem.style.cssText.toLowerCase() || undefined; }, set: function( elem, value ) { - return (elem.style.cssText = "" + value); + return ( elem.style.cssText = value + "" ); } }; } @@ -2465,10 +2593,16 @@ if ( !jQuery.support.optSelected ) { parent.parentNode.selectedIndex; } } + return null; } }); } +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + // Radios and checkboxes getter/setter if ( !jQuery.support.checkOn ) { jQuery.each([ "radio", "checkbox" ], function() { @@ -2484,126 +2618,105 @@ jQuery.each([ "radio", "checkbox" ], function() { jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { set: function( elem, value ) { if ( jQuery.isArray( value ) ) { - return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); } } }); }); - - - - -var hasOwn = Object.prototype.hasOwnProperty, - rnamespaces = /\.(.*)$/, - rformElems = /^(?:textarea|input|select)$/i, - rperiod = /\./g, - rspaces = / /g, - rescape = /[^\w\s.|`]/g, - fcleanup = function( nm ) { - return nm.replace(rescape, "\\$&"); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); }; /* - * A number of helper functions used for managing events. - * Many of the ideas behind this code originated from - * Dean Edwards' addEvent library. + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. */ jQuery.event = { - // Bind an event to an element - // Original by Dean Edwards - add: function( elem, types, handler, data ) { - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { return; } - if ( handler === false ) { - handler = returnFalse; - } else if ( !handler ) { - // Fixes bug #7229. Fix recommended by jdalton - return; - } - - var handleObjIn, handleObj; - + // Caller can pass in an object of custom data in lieu of the handler if ( handler.handler ) { handleObjIn = handler; handler = handleObjIn.handler; + selector = handleObjIn.selector; } - // Make sure that the function being executed has a unique ID + // Make sure that the handler has a unique ID, used to find/remove it later if ( !handler.guid ) { handler.guid = jQuery.guid++; } - // Init the element's event structure - var elemData = jQuery._data( elem ); - - // If no elemData is found then we must be trying to bind to one of the - // banned noData elements - if ( !elemData ) { - return; - } - - var events = elemData.events, - eventHandle = elemData.handle; - + // Init the element's event structure and main handler, if this is the first + events = elemData.events; if ( !events ) { elemData.events = events = {}; } - + eventHandle = elemData.handle; if ( !eventHandle ) { elemData.handle = eventHandle = function( e ) { // Discard the second event of a jQuery.event.trigger() and // when an event is called after a page has unloaded return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? - jQuery.event.handle.apply( eventHandle.elem, arguments ) : + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : undefined; }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; } - // Add elem as a property of the handle function - // This is to prevent a memory leak with non-native events in IE. - eventHandle.elem = elem; - // Handle multiple events separated by a space // jQuery(...).bind("mouseover mouseout", fn); - types = types.split(" "); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { - var type, i = 0, namespaces; + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); - while ( (type = types[ i++ ]) ) { - handleObj = handleObjIn ? - jQuery.extend({}, handleObjIn) : - { handler: handler, data: data }; + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; - // Namespaced event handlers - if ( type.indexOf(".") > -1 ) { - namespaces = type.split("."); - type = namespaces.shift(); - handleObj.namespace = namespaces.slice(0).sort().join("."); + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; - } else { - namespaces = []; - handleObj.namespace = ""; - } + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; - handleObj.type = type; - if ( !handleObj.guid ) { - handleObj.guid = handler.guid; - } + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); - // Get the current list of functions bound to this event - var handlers = events[ type ], - special = jQuery.event.special[ type ] || {}; - - // Init the event handler queue + // Init the event handler queue if we're the first + handlers = events[ type ]; if ( !handlers ) { handlers = events[ type ] = []; + handlers.delegateCount = 0; - // Check for a special event handler - // Only use addEventListener/attachEvent if the special - // events handler returns false + // Only use addEventListener/attachEvent if the special events handler returns false if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { // Bind the global event handler to the element if ( elem.addEventListener ) { @@ -2623,10 +2736,14 @@ jQuery.event = { } } - // Add the function to the element's handler list - handlers.push( handleObj ); + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } - // Keep track of which events have been used, for event optimization + // Keep track of which events have ever been used, for event optimization jQuery.event.global[ type ] = true; } @@ -2637,129 +2754,77 @@ jQuery.event = { global: {}, // Detach an event or set of events from an element - remove: function( elem, types, handler, pos ) { - // don't do events on text and comment nodes - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { return; } - if ( handler === false ) { - handler = returnFalse; - } + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; - var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, - elemData = jQuery.hasData( elem ) && jQuery._data( elem ), - events = elemData && elemData.events; - - if ( !elemData || !events ) { - return; - } - - // types is actually an event object here - if ( types && types.type ) { - handler = types.handler; - types = types.type; - } - - // Unbind all events for the element - if ( !types || typeof types === "string" && types.charAt(0) === "." ) { - types = types || ""; - - for ( type in events ) { - jQuery.event.remove( elem, type + types ); - } - - return; - } - - // Handle multiple events separated by a space - // jQuery(...).unbind("mouseover mouseout", fn); - types = types.split(" "); - - while ( (type = types[ i++ ]) ) { - origType = type; - handleObj = null; - all = type.indexOf(".") < 0; - namespaces = []; - - if ( !all ) { - // Namespaced event handlers - namespaces = type.split("."); - type = namespaces.shift(); - - namespace = new RegExp("(^|\\.)" + - jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); - } - - eventType = events[ type ]; - - if ( !eventType ) { - continue; - } - - if ( !handler ) { - for ( j = 0; j < eventType.length; j++ ) { - handleObj = eventType[ j ]; - - if ( all || namespace.test( handleObj.namespace ) ) { - jQuery.event.remove( elem, origType, handleObj.handler, j ); - eventType.splice( j--, 1 ); - } + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); } - continue; } special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; - for ( j = pos || 0; j < eventType.length; j++ ) { + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { handleObj = eventType[ j ]; - if ( handler.guid === handleObj.guid ) { - // remove the given handler for the given type - if ( all || namespace.test( handleObj.namespace ) ) { - if ( pos == null ) { - eventType.splice( j--, 1 ); - } + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); - if ( special.remove ) { - special.remove.call( elem, handleObj ); - } + if ( handleObj.selector ) { + eventType.delegateCount--; } - - if ( pos != null ) { - break; + if ( special.remove ) { + special.remove.call( elem, handleObj ); } } } - // remove generic event handler if no more handlers exist - if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { - if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { jQuery.removeEvent( elem, type, elemData.handle ); } - ret = null; delete events[ type ]; } } // Remove the expando if it's no longer used if ( jQuery.isEmptyObject( events ) ) { - var handle = elemData.handle; - if ( handle ) { - handle.elem = null; - } - - delete elemData.events; delete elemData.handle; - if ( jQuery.isEmptyObject( elemData ) ) { - jQuery.removeData( elem, undefined, true ); - } + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); } }, - + // Events that are safe to short-circuit if no handlers are attached. // Native DOM events should not be added, they may have inline handlers. customEvent: { @@ -2769,18 +2834,28 @@ jQuery.event = { }, trigger: function( event, data, elem, onlyHandlers ) { - // Event object or event type - var type = event.type || event, - namespaces = [], - exclusive; + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } - if ( type.indexOf("!") >= 0 ) { + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { // Exclusive events trigger only for the exact event (no namespaces) type = type.slice(0, -1); exclusive = true; } - if ( type.indexOf(".") >= 0 ) { + if ( type.indexOf( "." ) >= 0 ) { // Namespaced trigger; create a regexp to match event type in handle() namespaces = type.split("."); type = namespaces.shift(); @@ -2802,230 +2877,301 @@ jQuery.event = { new jQuery.Event( type ); event.type = type; + event.isTrigger = true; event.exclusive = exclusive; - event.namespace = namespaces.join("."); - event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); - - // triggerHandler() and global events don't bubble or run the default action - if ( onlyHandlers || !elem ) { - event.preventDefault(); - event.stopPropagation(); - } + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; // Handle a global trigger if ( !elem ) { - // TODO: Stop taunting the data cache; remove global events and always attach to document - jQuery.each( jQuery.cache, function() { - // internalKey variable is just used to make it easier to find - // and potentially change this stuff later; currently it just - // points to jQuery.expando - var internalKey = jQuery.expando, - internalCache = this[ internalKey ]; - if ( internalCache && internalCache.events && internalCache.events[ type ] ) { - jQuery.event.trigger( event, data, internalCache.handle.elem ); - } - }); - return; - } - // Don't do events on text and comment nodes - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } return; } // Clean up the event in case it is being reused event.result = undefined; - event.target = elem; + if ( !event.target ) { + event.target = elem; + } // Clone any incoming data and prepend the event, creating the handler arg list - data = data ? jQuery.makeArray( data ) : []; + data = data != null ? jQuery.makeArray( data ) : []; data.unshift( event ); - var cur = elem, - // IE doesn't like method names with a colon (#3533, #8272) - ontype = type.indexOf(":") < 0 ? "on" + type : ""; + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } - // Fire event on the current element, then bubble up the DOM tree - do { - var handle = jQuery._data( cur, "handle" ); + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { - event.currentTarget = cur; + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); if ( handle ) { handle.apply( cur, data ); } - - // Trigger an inline bound script - if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { - event.result = false; + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { event.preventDefault(); } - - // Bubble up to document, then to window - cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; - } while ( cur && !event.isPropagationStopped() ); + } + event.type = type; // If nobody prevented the default action, do it now - if ( !event.isDefaultPrevented() ) { - var old, - special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && !event.isDefaultPrevented() ) { - if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { // Call a native DOM method on the target with the same name name as the event. - // Can't use an .isFunction)() check here because IE6/7 fails that test. - // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. - try { - if ( ontype && elem[ type ] ) { - // Don't re-trigger an onFOO event when we call its FOO() method - old = elem[ ontype ]; + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { - if ( old ) { - elem[ ontype ] = null; - } + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; - jQuery.event.triggered = type; - elem[ type ](); + if ( old ) { + elem[ ontype ] = null; } - } catch ( ieError ) {} - if ( old ) { - elem[ ontype ] = old; + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } } - - jQuery.event.triggered = undefined; } } - + return event.result; }, - handle: function( event ) { + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object event = jQuery.event.fix( event || window.event ); - // Snapshot the handlers list since a called handler may add/remove events. - var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), run_all = !event.exclusive && !event.namespace, - args = Array.prototype.slice.call( arguments, 0 ); + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; - // Use the fix-ed Event rather than the (read-only) native event + // Use the fix-ed jQuery.Event rather than the (read-only) native event args[0] = event; - event.currentTarget = this; + event.delegateTarget = this; - for ( var j = 0, l = handlers.length; j < l; j++ ) { - var handleObj = handlers[ j ]; + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } - // Triggered event must 1) be non-exclusive and have no namespace, or - // 2) have namespace(s) a subset or equal to those in the bound event. - if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { - // Pass in a reference to the handler function itself - // So that we can later remove it - event.handler = handleObj.handler; - event.data = handleObj.data; - event.handleObj = handleObj; + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { - var ret = handleObj.handler.apply( this, args ); + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { - if ( ret !== undefined ) { - event.result = ret; - if ( ret === false ) { - event.preventDefault(); - event.stopPropagation(); + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); } - } - - if ( event.isImmediatePropagationStopped() ) { - break; } } } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + return event.result; }, - props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, fix: function( event ) { if ( event[ jQuery.expando ] ) { return event; } - // store a copy of the original event object - // and "clone" to set read-only properties - var originalEvent = event; + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + event = jQuery.Event( originalEvent ); - for ( var i = this.props.length, prop; i; ) { - prop = this.props[ --i ]; + for ( i = copy.length; i; ) { + prop = copy[ --i ]; event[ prop ] = originalEvent[ prop ]; } - // Fix target property, if necessary + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) if ( !event.target ) { - // Fixes #1925 where srcElement might not be defined either - event.target = event.srcElement || document; + event.target = originalEvent.srcElement || document; } - // check if target is a textnode (safari) + // Target should not be a text node (#504, Safari) if ( event.target.nodeType === 3 ) { event.target = event.target.parentNode; } - // Add relatedTarget, if necessary - if ( !event.relatedTarget && event.fromElement ) { - event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; - } + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; - // Calculate pageX/Y if missing and clientX/Y available - if ( event.pageX == null && event.clientX != null ) { - var eventDocument = event.target.ownerDocument || document, - doc = eventDocument.documentElement, - body = eventDocument.body; - - event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); - event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); - } - - // Add which for key events - if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { - event.which = event.charCode != null ? event.charCode : event.keyCode; - } - - // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) - if ( !event.metaKey && event.ctrlKey ) { - event.metaKey = event.ctrlKey; - } - - // Add which for click: 1 === left; 2 === middle; 3 === right - // Note: button is not normalized, so don't use it - if ( !event.which && event.button !== undefined ) { - event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); - } - - return event; + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; }, - // Deprecated, use jQuery.guid instead - guid: 1E8, - - // Deprecated, use jQuery.proxy instead - proxy: jQuery.proxy, - special: { - ready: { - // Make sure the ready event is setup - setup: jQuery.bindReady, - teardown: jQuery.noop + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true }, - live: { - add: function( handleObj ) { - jQuery.event.add( this, - liveConvert( handleObj.origType, handleObj.selector ), - jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); - }, - - remove: function( handleObj ) { - jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); - } + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" }, beforeunload: { @@ -3042,9 +3188,35 @@ jQuery.event = { } } } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } } }; +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + jQuery.removeEvent = document.removeEventListener ? function( elem, type, handle ) { if ( elem.removeEventListener ) { @@ -3052,14 +3224,23 @@ jQuery.removeEvent = document.removeEventListener ? } } : function( elem, type, handle ) { + var name = "on" + type; + if ( elem.detachEvent ) { - elem.detachEvent( "on" + type, handle ); + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); } }; jQuery.Event = function( src, props ) { // Allow instantiation without the 'new' keyword - if ( !this.preventDefault ) { + if ( !(this instanceof jQuery.Event) ) { return new jQuery.Event( src, props ); } @@ -3070,8 +3251,8 @@ jQuery.Event = function( src, props ) { // Events bubbling up the document may have been marked as prevented // by a handler lower down the tree; reflect the correct value. - this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || - src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; // Event type } else { @@ -3083,9 +3264,8 @@ jQuery.Event = function( src, props ) { jQuery.extend( this, props ); } - // timeStamp is buggy for some events on Firefox(#3843) - // So we won't rely on the native value - this.timeStamp = jQuery.now(); + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); // Mark it as fixed this[ jQuery.expando ] = true; @@ -3141,221 +3321,138 @@ jQuery.Event.prototype = { isImmediatePropagationStopped: returnFalse }; -// Checks if an event happened on an element within another element -// Used in jQuery.event.special.mouseenter and mouseleave handlers -var withinElement = function( event ) { - // Check if mouse(over|out) are still within the same parent element - var parent = event.relatedTarget; - - // set the correct event type - event.type = event.data; - - // Firefox sometimes assigns relatedTarget a XUL element - // which we cannot access the parentNode property of - try { - - // Chrome does something similar, the parentNode property - // can be accessed but is null. - if ( parent && parent !== document && !parent.parentNode ) { - return; - } - - // Traverse up the tree - while ( parent && parent !== this ) { - parent = parent.parentNode; - } - - if ( parent !== this ) { - // handle event if we actually just moused on to a non sub-element - jQuery.event.handle.apply( this, arguments ); - } - - // assuming we've left the element since we most likely mousedover a xul element - } catch(e) { } -}, - -// In case of event delegation, we only need to rename the event.type, -// liveHandler will take care of the rest. -delegate = function( event ) { - event.type = event.data; - jQuery.event.handle.apply( this, arguments ); -}; - -// Create mouseenter and mouseleave events +// Create mouseenter/leave events using mouseover/out and event-time checks jQuery.each({ mouseenter: "mouseover", mouseleave: "mouseout" }, function( orig, fix ) { jQuery.event.special[ orig ] = { - setup: function( data ) { - jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); - }, - teardown: function( data ) { - jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; } }; }); -// submit delegation +// IE submit delegation if ( !jQuery.support.submitBubbles ) { jQuery.event.special.submit = { - setup: function( data, namespaces ) { - if ( !jQuery.nodeName( this, "form" ) ) { - jQuery.event.add(this, "click.specialSubmit", function( e ) { - var elem = e.target, - type = elem.type; - - if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { - trigger( "submit", this, arguments ); - } - }); - - jQuery.event.add(this, "keypress.specialSubmit", function( e ) { - var elem = e.target, - type = elem.type; - - if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { - trigger( "submit", this, arguments ); - } - }); - - } else { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { return false; } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } }, - teardown: function( namespaces ) { - jQuery.event.remove( this, ".specialSubmit" ); + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); } }; - } -// change delegation, happens here so we have bind. +// IE change delegation and checkbox/radio fix if ( !jQuery.support.changeBubbles ) { - var changeFilters, - - getVal = function( elem ) { - var type = elem.type, val = elem.value; - - if ( type === "radio" || type === "checkbox" ) { - val = elem.checked; - - } else if ( type === "select-multiple" ) { - val = elem.selectedIndex > -1 ? - jQuery.map( elem.options, function( elem ) { - return elem.selected; - }).join("-") : - ""; - - } else if ( jQuery.nodeName( elem, "select" ) ) { - val = elem.selectedIndex; - } - - return val; - }, - - testChange = function testChange( e ) { - var elem = e.target, data, val; - - if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { - return; - } - - data = jQuery._data( elem, "_change_data" ); - val = getVal(elem); - - // the current data will be also retrieved by beforeactivate - if ( e.type !== "focusout" || elem.type !== "radio" ) { - jQuery._data( elem, "_change_data", val ); - } - - if ( data === undefined || val === data ) { - return; - } - - if ( data != null || val ) { - e.type = "change"; - e.liveFired = undefined; - jQuery.event.trigger( e, arguments[1], elem ); - } - }; - jQuery.event.special.change = { - filters: { - focusout: testChange, - beforedeactivate: testChange, + setup: function() { - click: function( e ) { - var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; - - if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { - testChange.call( this, e ); + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); } - }, - - // Change has to be called before submit - // Keydown will be called before keypress, which is used in submit-event delegation - keydown: function( e ) { - var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; - - if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || - (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || - type === "select-multiple" ) { - testChange.call( this, e ); - } - }, - - // Beforeactivate happens also before the previous element is blurred - // with this event you can't trigger a change event, but you can store - // information - beforeactivate: function( e ) { - var elem = e.target; - jQuery._data( elem, "_change_data", getVal(elem) ); - } - }, - - setup: function( data, namespaces ) { - if ( this.type === "file" ) { return false; } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; - for ( var type in changeFilters ) { - jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); - } - - return rformElems.test( this.nodeName ); + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); }, - teardown: function( namespaces ) { - jQuery.event.remove( this, ".specialChange" ); + handle: function( event ) { + var elem = event.target; - return rformElems.test( this.nodeName ); + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return !rformElems.test( this.nodeName ); } }; - - changeFilters = jQuery.event.special.change.filters; - - // Handle when the input is .focus()'d - changeFilters.focus = changeFilters.beforeactivate; -} - -function trigger( type, elem, args ) { - // Piggyback on a donor event to simulate a different one. - // Fake originalEvent to avoid donor's stopPropagation, but if the - // simulated event prevents default then we do the same on the donor. - // Don't pass args or remember liveFired; they apply to the donor event. - var event = jQuery.extend( {}, args[ 0 ] ); - event.type = type; - event.originalEvent = {}; - event.liveFired = undefined; - jQuery.event.handle.call( elem, event ); - if ( event.isDefaultPrevented() ) { - args[ 0 ].preventDefault(); - } } // Create "bubbling" focus and blur events @@ -3363,7 +3460,10 @@ if ( !jQuery.support.focusinBubbles ) { jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { // Attach a single capturing handler while someone wants focusin/focusout - var attaches = 0; + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; jQuery.event.special[ fix ] = { setup: function() { @@ -3377,89 +3477,121 @@ if ( !jQuery.support.focusinBubbles ) { } } }; - - function handler( donor ) { - // Donor event is always a native one; fix it and switch its type. - // Let focusin/out handler cancel the donor focus/blur event. - var e = jQuery.event.fix( donor ); - e.type = fix; - e.originalEvent = {}; - jQuery.event.trigger( e, null, e.target ); - if ( e.isDefaultPrevented() ) { - donor.preventDefault(); - } - } }); } -jQuery.each(["bind", "one"], function( i, name ) { - jQuery.fn[ name ] = function( type, data, fn ) { - var handler; +jQuery.fn.extend({ - // Handle object literals - if ( typeof type === "object" ) { - for ( var key in type ) { - this[ name ](key, data, type[key], fn); + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); } return this; } - if ( arguments.length === 2 || data === false ) { - fn = data; - data = undefined; + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; } - if ( name === "one" ) { - handler = function( event ) { - jQuery( this ).unbind( event, handler ); - return fn.apply( this, arguments ); + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); }; - handler.guid = fn.guid || jQuery.guid++; - } else { - handler = fn; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); } - - if ( type === "unload" && name !== "one" ) { - this.one( type, data, fn ); - - } else { - for ( var i = 0, l = this.length; i < l; i++ ) { - jQuery.event.add( this[i], type, handler, data ); + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); } + return this; } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); return this; - }; -}); - -jQuery.fn.extend({ - unbind: function( type, fn ) { - // Handle object literals - if ( typeof type === "object" && !type.preventDefault ) { - for ( var key in type ) { - this.unbind(key, type[key]); - } - - } else { - for ( var i = 0, l = this.length; i < l; i++ ) { - jQuery.event.remove( this[i], type, fn ); - } - } - + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); return this; }, delegate: function( selector, types, data, fn ) { - return this.live( types, data, fn, selector ); + return this.on( types, selector, data, fn ); }, - undelegate: function( selector, types, fn ) { - if ( arguments.length === 0 ) { - return this.unbind( "live" ); - - } else { - return this.die( types, null, fn, selector ); - } + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); }, trigger: function( type, data ) { @@ -3467,7 +3599,6 @@ jQuery.fn.extend({ jQuery.event.trigger( type, data, this ); }); }, - triggerHandler: function( type, data ) { if ( this[0] ) { return jQuery.event.trigger( type, data, this[0], true ); @@ -3481,8 +3612,8 @@ jQuery.fn.extend({ i = 0, toggler = function( event ) { // Figure out which function to execute - var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; - jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); // Make sure that clicks stop event.preventDefault(); @@ -3505,178 +3636,9 @@ jQuery.fn.extend({ } }); -var liveMap = { - focus: "focusin", - blur: "focusout", - mouseenter: "mouseover", - mouseleave: "mouseout" -}; - -jQuery.each(["live", "die"], function( i, name ) { - jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { - var type, i = 0, match, namespaces, preType, - selector = origSelector || this.selector, - context = origSelector ? this : jQuery( this.context ); - - if ( typeof types === "object" && !types.preventDefault ) { - for ( var key in types ) { - context[ name ]( key, data, types[key], selector ); - } - - return this; - } - - if ( name === "die" && !types && - origSelector && origSelector.charAt(0) === "." ) { - - context.unbind( origSelector ); - - return this; - } - - if ( data === false || jQuery.isFunction( data ) ) { - fn = data || returnFalse; - data = undefined; - } - - types = (types || "").split(" "); - - while ( (type = types[ i++ ]) != null ) { - match = rnamespaces.exec( type ); - namespaces = ""; - - if ( match ) { - namespaces = match[0]; - type = type.replace( rnamespaces, "" ); - } - - if ( type === "hover" ) { - types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); - continue; - } - - preType = type; - - if ( liveMap[ type ] ) { - types.push( liveMap[ type ] + namespaces ); - type = type + namespaces; - - } else { - type = (liveMap[ type ] || type) + namespaces; - } - - if ( name === "live" ) { - // bind live handler - for ( var j = 0, l = context.length; j < l; j++ ) { - jQuery.event.add( context[j], "live." + liveConvert( type, selector ), - { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); - } - - } else { - // unbind live handler - context.unbind( "live." + liveConvert( type, selector ), fn ); - } - } - - return this; - }; -}); - -function liveHandler( event ) { - var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, - elems = [], - selectors = [], - events = jQuery._data( this, "events" ); - - // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) - if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { - return; - } - - if ( event.namespace ) { - namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); - } - - event.liveFired = this; - - var live = events.live.slice(0); - - for ( j = 0; j < live.length; j++ ) { - handleObj = live[j]; - - if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { - selectors.push( handleObj.selector ); - - } else { - live.splice( j--, 1 ); - } - } - - match = jQuery( event.target ).closest( selectors, event.currentTarget ); - - for ( i = 0, l = match.length; i < l; i++ ) { - close = match[i]; - - for ( j = 0; j < live.length; j++ ) { - handleObj = live[j]; - - if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { - elem = close.elem; - related = null; - - // Those two events require additional checking - if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { - event.type = handleObj.preType; - related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; - - // Make sure not to accidentally match a child element with the same selector - if ( related && jQuery.contains( elem, related ) ) { - related = elem; - } - } - - if ( !related || related !== elem ) { - elems.push({ elem: elem, handleObj: handleObj, level: close.level }); - } - } - } - } - - for ( i = 0, l = elems.length; i < l; i++ ) { - match = elems[i]; - - if ( maxLevel && match.level > maxLevel ) { - break; - } - - event.currentTarget = match.elem; - event.data = match.handleObj.data; - event.handleObj = match.handleObj; - - ret = match.handleObj.origHandler.apply( match.elem, arguments ); - - if ( ret === false || event.isPropagationStopped() ) { - maxLevel = match.level; - - if ( ret === false ) { - stop = false; - } - if ( event.isImmediatePropagationStopped() ) { - break; - } - } - } - - return stop; -} - -function liveConvert( type, selector ) { - return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); -} - jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + - "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { // Handle event binding jQuery.fn[ name ] = function( data, fn ) { @@ -3686,1445 +3648,1713 @@ jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblcl } return arguments.length > 0 ? - this.bind( name, data, fn ) : + this.on( name, null, data, fn ) : this.trigger( name ); }; - if ( jQuery.attrFn ) { - jQuery.attrFn[ name ] = true; + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; } }); - - - -/*! - * Sizzle CSS Selector Engine - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * More information: http://sizzlejs.com/ - */ -(function(){ - -var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, - done = 0, - toString = Object.prototype.toString, - hasDuplicate = false, - baseHasDuplicate = true, - rBackslash = /\\/g, - rNonWord = /\W/; - -// Here we check if the JavaScript engine is using some sort of -// optimization where it does not always call our comparision -// function. If that is the case, discard the hasDuplicate value. -// Thus far that includes Google Chrome. -[0, 0].sort(function() { - baseHasDuplicate = false; - return 0; -}); - -var Sizzle = function( selector, context, results, seed ) { - results = results || []; - context = context || document; - - var origContext = context; - - if ( context.nodeType !== 1 && context.nodeType !== 9 ) { - return []; - } - - if ( !selector || typeof selector !== "string" ) { - return results; - } - - var m, set, checkSet, extra, ret, cur, pop, i, - prune = true, - contextXML = Sizzle.isXML( context ), - parts = [], - soFar = selector; - - // Reset the position of the chunker regexp (start from head) - do { - chunker.exec( "" ); - m = chunker.exec( soFar ); - - if ( m ) { - soFar = m[3]; - - parts.push( m[1] ); - - if ( m[2] ) { - extra = m[3]; - break; - } - } - } while ( m ); - - if ( parts.length > 1 && origPOS.exec( selector ) ) { - - if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { - set = posProcess( parts[0] + parts[1], context ); - - } else { - set = Expr.relative[ parts[0] ] ? - [ context ] : - Sizzle( parts.shift(), context ); - - while ( parts.length ) { - selector = parts.shift(); - - if ( Expr.relative[ selector ] ) { - selector += parts.shift(); - } - - set = posProcess( selector, set ); - } - } - - } else { - // Take a shortcut and set the context if the root selector is an ID - // (but not if it'll be faster if the inner selector is an ID) - if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && - Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { - - ret = Sizzle.find( parts.shift(), context, contextXML ); - context = ret.expr ? - Sizzle.filter( ret.expr, ret.set )[0] : - ret.set[0]; - } - - if ( context ) { - ret = seed ? - { expr: parts.pop(), set: makeArray(seed) } : - Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); - - set = ret.expr ? - Sizzle.filter( ret.expr, ret.set ) : - ret.set; - - if ( parts.length > 0 ) { - checkSet = makeArray( set ); - - } else { - prune = false; - } - - while ( parts.length ) { - cur = parts.pop(); - pop = cur; - - if ( !Expr.relative[ cur ] ) { - cur = ""; - } else { - pop = parts.pop(); - } - - if ( pop == null ) { - pop = context; - } - - Expr.relative[ cur ]( checkSet, pop, contextXML ); - } - - } else { - checkSet = parts = []; - } - } - - if ( !checkSet ) { - checkSet = set; - } - - if ( !checkSet ) { - Sizzle.error( cur || selector ); - } - - if ( toString.call(checkSet) === "[object Array]" ) { - if ( !prune ) { - results.push.apply( results, checkSet ); - - } else if ( context && context.nodeType === 1 ) { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { - results.push( set[i] ); - } - } - - } else { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && checkSet[i].nodeType === 1 ) { - results.push( set[i] ); - } - } - } - - } else { - makeArray( checkSet, results ); - } - - if ( extra ) { - Sizzle( extra, origContext, results, seed ); - Sizzle.uniqueSort( results ); - } - - return results; -}; - -Sizzle.uniqueSort = function( results ) { - if ( sortOrder ) { - hasDuplicate = baseHasDuplicate; - results.sort( sortOrder ); - - if ( hasDuplicate ) { - for ( var i = 1; i < results.length; i++ ) { - if ( results[i] === results[ i - 1 ] ) { - results.splice( i--, 1 ); - } - } - } - } - - return results; -}; - -Sizzle.matches = function( expr, set ) { - return Sizzle( expr, null, null, set ); -}; - -Sizzle.matchesSelector = function( node, expr ) { - return Sizzle( expr, null, null, [node] ).length > 0; -}; - -Sizzle.find = function( expr, context, isXML ) { - var set; - - if ( !expr ) { - return []; - } - - for ( var i = 0, l = Expr.order.length; i < l; i++ ) { - var match, - type = Expr.order[i]; - - if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { - var left = match[1]; - match.splice( 1, 1 ); - - if ( left.substr( left.length - 1 ) !== "\\" ) { - match[1] = (match[1] || "").replace( rBackslash, "" ); - set = Expr.find[ type ]( match, context, isXML ); - - if ( set != null ) { - expr = expr.replace( Expr.match[ type ], "" ); - break; - } - } - } - } - - if ( !set ) { - set = typeof context.getElementsByTagName !== "undefined" ? - context.getElementsByTagName( "*" ) : - []; - } - - return { set: set, expr: expr }; -}; - -Sizzle.filter = function( expr, set, inplace, not ) { - var match, anyFound, - old = expr, - result = [], - curLoop = set, - isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); - - while ( expr && set.length ) { - for ( var type in Expr.filter ) { - if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { - var found, item, - filter = Expr.filter[ type ], - left = match[1]; - - anyFound = false; - - match.splice(1,1); - - if ( left.substr( left.length - 1 ) === "\\" ) { - continue; - } - - if ( curLoop === result ) { - result = []; - } - - if ( Expr.preFilter[ type ] ) { - match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); - - if ( !match ) { - anyFound = found = true; - - } else if ( match === true ) { - continue; - } - } - - if ( match ) { - for ( var i = 0; (item = curLoop[i]) != null; i++ ) { - if ( item ) { - found = filter( item, match, i, curLoop ); - var pass = not ^ !!found; - - if ( inplace && found != null ) { - if ( pass ) { - anyFound = true; - - } else { - curLoop[i] = false; - } - - } else if ( pass ) { - result.push( item ); - anyFound = true; - } - } - } - } - - if ( found !== undefined ) { - if ( !inplace ) { - curLoop = result; - } - - expr = expr.replace( Expr.match[ type ], "" ); - - if ( !anyFound ) { - return []; - } - - break; - } - } - } - - // Improper expression - if ( expr === old ) { - if ( anyFound == null ) { - Sizzle.error( expr ); - - } else { - break; - } - } - - old = expr; - } - - return curLoop; -}; - -Sizzle.error = function( msg ) { - throw "Syntax error, unrecognized expression: " + msg; -}; - -var Expr = Sizzle.selectors = { - order: [ "ID", "NAME", "TAG" ], - - match: { - ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, - ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, - TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, - CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, - POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, - PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ - }, - - leftMatch: {}, - - attrMap: { - "class": "className", - "for": "htmlFor" - }, - - attrHandle: { - href: function( elem ) { - return elem.getAttribute( "href" ); - }, - type: function( elem ) { - return elem.getAttribute( "type" ); - } - }, - - relative: { - "+": function(checkSet, part){ - var isPartStr = typeof part === "string", - isTag = isPartStr && !rNonWord.test( part ), - isPartStrNotTag = isPartStr && !isTag; - - if ( isTag ) { - part = part.toLowerCase(); - } - - for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { - if ( (elem = checkSet[i]) ) { - while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} - - checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? - elem || false : - elem === part; - } - } - - if ( isPartStrNotTag ) { - Sizzle.filter( part, checkSet, true ); - } - }, - - ">": function( checkSet, part ) { - var elem, - isPartStr = typeof part === "string", - i = 0, - l = checkSet.length; - - if ( isPartStr && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - - for ( ; i < l; i++ ) { - elem = checkSet[i]; - - if ( elem ) { - var parent = elem.parentNode; - checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; - } - } - - } else { - for ( ; i < l; i++ ) { - elem = checkSet[i]; - - if ( elem ) { - checkSet[i] = isPartStr ? - elem.parentNode : - elem.parentNode === part; - } - } - - if ( isPartStr ) { - Sizzle.filter( part, checkSet, true ); - } - } - }, - - "": function(checkSet, part, isXML){ - var nodeCheck, - doneName = done++, - checkFn = dirCheck; - - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } - - checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); - }, - - "~": function( checkSet, part, isXML ) { - var nodeCheck, - doneName = done++, - checkFn = dirCheck; - - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } - - checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); - } - }, - - find: { - ID: function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - return m && m.parentNode ? [m] : []; - } - }, - - NAME: function( match, context ) { - if ( typeof context.getElementsByName !== "undefined" ) { - var ret = [], - results = context.getElementsByName( match[1] ); - - for ( var i = 0, l = results.length; i < l; i++ ) { - if ( results[i].getAttribute("name") === match[1] ) { - ret.push( results[i] ); - } - } - - return ret.length === 0 ? null : ret; - } - }, - - TAG: function( match, context ) { - if ( typeof context.getElementsByTagName !== "undefined" ) { - return context.getElementsByTagName( match[1] ); - } - } - }, - preFilter: { - CLASS: function( match, curLoop, inplace, result, not, isXML ) { - match = " " + match[1].replace( rBackslash, "" ) + " "; - - if ( isXML ) { - return match; - } - - for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { - if ( elem ) { - if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { - if ( !inplace ) { - result.push( elem ); - } - - } else if ( inplace ) { - curLoop[i] = false; - } - } - } - - return false; - }, - - ID: function( match ) { - return match[1].replace( rBackslash, "" ); - }, - - TAG: function( match, curLoop ) { - return match[1].replace( rBackslash, "" ).toLowerCase(); - }, - - CHILD: function( match ) { - if ( match[1] === "nth" ) { - if ( !match[2] ) { - Sizzle.error( match[0] ); - } - - match[2] = match[2].replace(/^\+|\s*/g, ''); - - // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' - var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( - match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || - !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); - - // calculate the numbers (first)n+(last) including if they are negative - match[2] = (test[1] + (test[2] || 1)) - 0; - match[3] = test[3] - 0; - } - else if ( match[2] ) { - Sizzle.error( match[0] ); - } - - // TODO: Move to normal caching system - match[0] = done++; - - return match; - }, - - ATTR: function( match, curLoop, inplace, result, not, isXML ) { - var name = match[1] = match[1].replace( rBackslash, "" ); - - if ( !isXML && Expr.attrMap[name] ) { - match[1] = Expr.attrMap[name]; - } - - // Handle if an un-quoted value was used - match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); - - if ( match[2] === "~=" ) { - match[4] = " " + match[4] + " "; - } - - return match; - }, - - PSEUDO: function( match, curLoop, inplace, result, not ) { - if ( match[1] === "not" ) { - // If we're dealing with a complex expression, or a simple one - if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { - match[3] = Sizzle(match[3], null, null, curLoop); - - } else { - var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); - - if ( !inplace ) { - result.push.apply( result, ret ); - } - - return false; - } - - } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { - return true; - } - - return match; - }, - - POS: function( match ) { - match.unshift( true ); - - return match; - } - }, - - filters: { - enabled: function( elem ) { - return elem.disabled === false && elem.type !== "hidden"; - }, - - disabled: function( elem ) { - return elem.disabled === true; - }, - - checked: function( elem ) { - return elem.checked === true; - }, - - selected: function( elem ) { - // Accessing this property makes selected-by-default - // options in Safari work properly - if ( elem.parentNode ) { - elem.parentNode.selectedIndex; - } - - return elem.selected === true; - }, - - parent: function( elem ) { - return !!elem.firstChild; - }, - - empty: function( elem ) { - return !elem.firstChild; - }, - - has: function( elem, i, match ) { - return !!Sizzle( match[3], elem ).length; - }, - - header: function( elem ) { - return (/h\d/i).test( elem.nodeName ); - }, - - text: function( elem ) { - var attr = elem.getAttribute( "type" ), type = elem.type; - // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) - // use getAttribute instead to test this case - return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); - }, - - radio: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; - }, - - checkbox: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; - }, - - file: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; - }, - - password: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; - }, - - submit: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "submit" === elem.type; - }, - - image: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; - }, - - reset: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "reset" === elem.type; - }, - - button: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return name === "input" && "button" === elem.type || name === "button"; - }, - - input: function( elem ) { - return (/input|select|textarea|button/i).test( elem.nodeName ); - }, - - focus: function( elem ) { - return elem === elem.ownerDocument.activeElement; - } - }, - setFilters: { - first: function( elem, i ) { - return i === 0; - }, - - last: function( elem, i, match, array ) { - return i === array.length - 1; - }, - - even: function( elem, i ) { - return i % 2 === 0; - }, - - odd: function( elem, i ) { - return i % 2 === 1; - }, - - lt: function( elem, i, match ) { - return i < match[3] - 0; - }, - - gt: function( elem, i, match ) { - return i > match[3] - 0; - }, - - nth: function( elem, i, match ) { - return match[3] - 0 === i; - }, - - eq: function( elem, i, match ) { - return match[3] - 0 === i; - } - }, - filter: { - PSEUDO: function( elem, match, i, array ) { - var name = match[1], - filter = Expr.filters[ name ]; - - if ( filter ) { - return filter( elem, i, match, array ); - - } else if ( name === "contains" ) { - return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; - - } else if ( name === "not" ) { - var not = match[3]; - - for ( var j = 0, l = not.length; j < l; j++ ) { - if ( not[j] === elem ) { - return false; - } - } - - return true; - - } else { - Sizzle.error( name ); - } - }, - - CHILD: function( elem, match ) { - var type = match[1], - node = elem; - - switch ( type ) { - case "only": - case "first": - while ( (node = node.previousSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } - - if ( type === "first" ) { - return true; - } - - node = elem; - - case "last": - while ( (node = node.nextSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } - - return true; - - case "nth": - var first = match[2], - last = match[3]; - - if ( first === 1 && last === 0 ) { - return true; - } - - var doneName = match[0], - parent = elem.parentNode; - - if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { - var count = 0; - - for ( node = parent.firstChild; node; node = node.nextSibling ) { - if ( node.nodeType === 1 ) { - node.nodeIndex = ++count; - } - } - - parent.sizcache = doneName; - } - - var diff = elem.nodeIndex - last; - - if ( first === 0 ) { - return diff === 0; - - } else { - return ( diff % first === 0 && diff / first >= 0 ); - } - } - }, - - ID: function( elem, match ) { - return elem.nodeType === 1 && elem.getAttribute("id") === match; - }, - - TAG: function( elem, match ) { - return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; - }, - - CLASS: function( elem, match ) { - return (" " + (elem.className || elem.getAttribute("class")) + " ") - .indexOf( match ) > -1; - }, - - ATTR: function( elem, match ) { - var name = match[1], - result = Expr.attrHandle[ name ] ? - Expr.attrHandle[ name ]( elem ) : - elem[ name ] != null ? - elem[ name ] : - elem.getAttribute( name ), - value = result + "", - type = match[2], - check = match[4]; - - return result == null ? - type === "!=" : - type === "=" ? - value === check : - type === "*=" ? - value.indexOf(check) >= 0 : - type === "~=" ? - (" " + value + " ").indexOf(check) >= 0 : - !check ? - value && result !== false : - type === "!=" ? - value !== check : - type === "^=" ? - value.indexOf(check) === 0 : - type === "$=" ? - value.substr(value.length - check.length) === check : - type === "|=" ? - value === check || value.substr(0, check.length + 1) === check + "-" : - false; - }, - - POS: function( elem, match, i, array ) { - var name = match[2], - filter = Expr.setFilters[ name ]; - - if ( filter ) { - return filter( elem, i, match, array ); - } - } - } -}; - -var origPOS = Expr.match.POS, - fescape = function(all, num){ - return "\\" + (num - 0 + 1); - }; - -for ( var type in Expr.match ) { - Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); - Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); -} - -var makeArray = function( array, results ) { - array = Array.prototype.slice.call( array, 0 ); - - if ( results ) { - results.push.apply( results, array ); - return results; - } - - return array; -}; - -// Perform a simple check to determine if the browser is capable of -// converting a NodeList to an array using builtin methods. -// Also verifies that the returned array holds DOM nodes -// (which is not the case in the Blackberry browser) -try { - Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; - -// Provide a fallback method if it does not work -} catch( e ) { - makeArray = function( array, results ) { - var i = 0, - ret = results || []; - - if ( toString.call(array) === "[object Array]" ) { - Array.prototype.push.apply( ret, array ); - - } else { - if ( typeof array.length === "number" ) { - for ( var l = array.length; i < l; i++ ) { - ret.push( array[i] ); - } - - } else { - for ( ; array[i]; i++ ) { - ret.push( array[i] ); - } - } - } - - return ret; - }; -} - -var sortOrder, siblingCheck; - -if ( document.documentElement.compareDocumentPosition ) { - sortOrder = function( a, b ) { - if ( a === b ) { - hasDuplicate = true; - return 0; - } - - if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { - return a.compareDocumentPosition ? -1 : 1; - } - - return a.compareDocumentPosition(b) & 4 ? -1 : 1; - }; - -} else { - sortOrder = function( a, b ) { - // The nodes are identical, we can exit early - if ( a === b ) { - hasDuplicate = true; - return 0; - - // Fallback to using sourceIndex (in IE) if it's available on both nodes - } else if ( a.sourceIndex && b.sourceIndex ) { - return a.sourceIndex - b.sourceIndex; - } - - var al, bl, - ap = [], - bp = [], - aup = a.parentNode, - bup = b.parentNode, - cur = aup; - - // If the nodes are siblings (or identical) we can do a quick check - if ( aup === bup ) { - return siblingCheck( a, b ); - - // If no parents were found then the nodes are disconnected - } else if ( !aup ) { - return -1; - - } else if ( !bup ) { - return 1; - } - - // Otherwise they're somewhere else in the tree so we need - // to build up a full list of the parentNodes for comparison - while ( cur ) { - ap.unshift( cur ); - cur = cur.parentNode; - } - - cur = bup; - - while ( cur ) { - bp.unshift( cur ); - cur = cur.parentNode; - } - - al = ap.length; - bl = bp.length; - - // Start walking down the tree looking for a discrepancy - for ( var i = 0; i < al && i < bl; i++ ) { - if ( ap[i] !== bp[i] ) { - return siblingCheck( ap[i], bp[i] ); - } - } - - // We ended someplace up the tree so do a sibling check - return i === al ? - siblingCheck( a, bp[i], -1 ) : - siblingCheck( ap[i], b, 1 ); - }; - - siblingCheck = function( a, b, ret ) { - if ( a === b ) { - return ret; - } - - var cur = a.nextSibling; - - while ( cur ) { - if ( cur === b ) { - return -1; - } - - cur = cur.nextSibling; - } - - return 1; - }; -} - -// Utility function for retreiving the text value of an array of DOM nodes -Sizzle.getText = function( elems ) { - var ret = "", elem; - - for ( var i = 0; elems[i]; i++ ) { - elem = elems[i]; - - // Get the text from text nodes and CDATA nodes - if ( elem.nodeType === 3 || elem.nodeType === 4 ) { - ret += elem.nodeValue; - - // Traverse everything else, except comment nodes - } else if ( elem.nodeType !== 8 ) { - ret += Sizzle.getText( elem.childNodes ); - } - } - - return ret; -}; - -// Check to see if the browser returns elements by name when -// querying by getElementById (and provide a workaround) -(function(){ - // We're going to inject a fake input element with a specified name - var form = document.createElement("div"), - id = "script" + (new Date()).getTime(), - root = document.documentElement; - - form.innerHTML = ""; - - // Inject it into the root element, check its status, and remove it quickly - root.insertBefore( form, root.firstChild ); - - // The workaround has to do additional checks after a getElementById - // Which slows things down for other browsers (hence the branching) - if ( document.getElementById( id ) ) { - Expr.find.ID = function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); - - return m ? - m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? - [m] : - undefined : - []; - } - }; - - Expr.filter.ID = function( elem, match ) { - var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); - - return elem.nodeType === 1 && node && node.nodeValue === match; - }; - } - - root.removeChild( form ); - - // release memory in IE - root = form = null; -})(); - -(function(){ - // Check to see if the browser returns only elements - // when doing getElementsByTagName("*") - - // Create a fake element - var div = document.createElement("div"); - div.appendChild( document.createComment("") ); - - // Make sure no comments are found - if ( div.getElementsByTagName("*").length > 0 ) { - Expr.find.TAG = function( match, context ) { - var results = context.getElementsByTagName( match[1] ); - - // Filter out possible comments - if ( match[1] === "*" ) { - var tmp = []; - - for ( var i = 0; results[i]; i++ ) { - if ( results[i].nodeType === 1 ) { - tmp.push( results[i] ); - } - } - - results = tmp; - } - - return results; - }; - } - - // Check to see if an attribute returns normalized href attributes - div.innerHTML = ""; - - if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && - div.firstChild.getAttribute("href") !== "#" ) { - - Expr.attrHandle.href = function( elem ) { - return elem.getAttribute( "href", 2 ); - }; - } - - // release memory in IE - div = null; -})(); - -if ( document.querySelectorAll ) { - (function(){ - var oldSizzle = Sizzle, - div = document.createElement("div"), - id = "__sizzle__"; - - div.innerHTML = "

    "; - - // Safari can't handle uppercase or unicode characters when - // in quirks mode. - if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { - return; - } - - Sizzle = function( query, context, extra, seed ) { - context = context || document; - - // Only use querySelectorAll on non-XML documents - // (ID selectors don't work in non-HTML documents) - if ( !seed && !Sizzle.isXML(context) ) { - // See if we find a selector to speed up - var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); - - if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { - // Speed-up: Sizzle("TAG") - if ( match[1] ) { - return makeArray( context.getElementsByTagName( query ), extra ); - - // Speed-up: Sizzle(".CLASS") - } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { - return makeArray( context.getElementsByClassName( match[2] ), extra ); - } - } - - if ( context.nodeType === 9 ) { - // Speed-up: Sizzle("body") - // The body element only exists once, optimize finding it - if ( query === "body" && context.body ) { - return makeArray( [ context.body ], extra ); - - // Speed-up: Sizzle("#ID") - } else if ( match && match[3] ) { - var elem = context.getElementById( match[3] ); - - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - if ( elem && elem.parentNode ) { - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem.id === match[3] ) { - return makeArray( [ elem ], extra ); - } - - } else { - return makeArray( [], extra ); - } - } - - try { - return makeArray( context.querySelectorAll(query), extra ); - } catch(qsaError) {} - - // qSA works strangely on Element-rooted queries - // We can work around this by specifying an extra ID on the root - // and working up from there (Thanks to Andrew Dupont for the technique) - // IE 8 doesn't work on object elements - } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { - var oldContext = context, - old = context.getAttribute( "id" ), - nid = old || id, - hasParent = context.parentNode, - relativeHierarchySelector = /^\s*[+~]/.test( query ); - - if ( !old ) { - context.setAttribute( "id", nid ); - } else { - nid = nid.replace( /'/g, "\\$&" ); - } - if ( relativeHierarchySelector && hasParent ) { - context = context.parentNode; - } - - try { - if ( !relativeHierarchySelector || hasParent ) { - return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); - } - - } catch(pseudoError) { - } finally { - if ( !old ) { - oldContext.removeAttribute( "id" ); - } - } - } - } - - return oldSizzle(query, context, extra, seed); - }; - - for ( var prop in oldSizzle ) { - Sizzle[ prop ] = oldSizzle[ prop ]; - } - - // release memory in IE - div = null; - })(); -} - -(function(){ - var html = document.documentElement, - matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; - - if ( matches ) { - // Check to see if it's possible to do matchesSelector - // on a disconnected node (IE 9 fails this) - var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), - pseudoWorks = false; - - try { - // This should fail with an exception - // Gecko does not error, returns false instead - matches.call( document.documentElement, "[test!='']:sizzle" ); - - } catch( pseudoError ) { - pseudoWorks = true; - } - - Sizzle.matchesSelector = function( node, expr ) { - // Make sure that attribute selectors are quoted - expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); - - if ( !Sizzle.isXML( node ) ) { - try { - if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { - var ret = matches.call( node, expr ); - - // IE 9's matchesSelector returns false on disconnected nodes - if ( ret || !disconnectedMatch || - // As well, disconnected nodes are said to be in a document - // fragment in IE 9, so check for that - node.document && node.document.nodeType !== 11 ) { - return ret; - } - } - } catch(e) {} - } - - return Sizzle(expr, null, null, [node]).length > 0; - }; - } -})(); - -(function(){ - var div = document.createElement("div"); - - div.innerHTML = "
    "; - - // Opera can't find a second classname (in 9.6) - // Also, make sure that getElementsByClassName actually exists - if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { - return; - } - - // Safari caches class attributes, doesn't catch changes (in 3.2) - div.lastChild.className = "e"; - - if ( div.getElementsByClassName("e").length === 1 ) { - return; - } - - Expr.order.splice(1, 0, "CLASS"); - Expr.find.CLASS = function( match, context, isXML ) { - if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { - return context.getElementsByClassName(match[1]); - } - }; - - // release memory in IE - div = null; -})(); - -function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; - - if ( elem ) { - var match = false; - - elem = elem[dir]; - - while ( elem ) { - if ( elem.sizcache === doneName ) { - match = checkSet[elem.sizset]; - break; - } - - if ( elem.nodeType === 1 && !isXML ){ - elem.sizcache = doneName; - elem.sizset = i; - } - - if ( elem.nodeName.toLowerCase() === cur ) { - match = elem; - break; - } - - elem = elem[dir]; - } - - checkSet[i] = match; - } - } -} - -function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; - - if ( elem ) { - var match = false; - - elem = elem[dir]; - - while ( elem ) { - if ( elem.sizcache === doneName ) { - match = checkSet[elem.sizset]; - break; - } - - if ( elem.nodeType === 1 ) { - if ( !isXML ) { - elem.sizcache = doneName; - elem.sizset = i; - } - - if ( typeof cur !== "string" ) { - if ( elem === cur ) { - match = true; - break; - } - - } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { - match = elem; - break; - } - } - - elem = elem[dir]; - } - - checkSet[i] = match; - } - } -} - -if ( document.documentElement.contains ) { - Sizzle.contains = function( a, b ) { - return a !== b && (a.contains ? a.contains(b) : true); - }; - -} else if ( document.documentElement.compareDocumentPosition ) { - Sizzle.contains = function( a, b ) { - return !!(a.compareDocumentPosition(b) & 16); - }; - -} else { - Sizzle.contains = function() { - return false; - }; -} - -Sizzle.isXML = function( elem ) { - // documentElement is verified for cases where it doesn't yet exist - // (such as loading iframes in IE - #4833) - var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; - - return documentElement ? documentElement.nodeName !== "HTML" : false; -}; - -var posProcess = function( selector, context ) { - var match, - tmpSet = [], - later = "", - root = context.nodeType ? [context] : context; - - // Position selectors must be done after the filter - // And so must :not(positional) so we move all PSEUDOs to the end - while ( (match = Expr.match.PSEUDO.exec( selector )) ) { - later += match[0]; - selector = selector.replace( Expr.match.PSEUDO, "" ); - } - - selector = Expr.relative[selector] ? selector + "*" : selector; - - for ( var i = 0, l = root.length; i < l; i++ ) { - Sizzle( selector, root[i], tmpSet ); - } - - return Sizzle.filter( later, tmpSet ); -}; - -// EXPOSE +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var cachedruns, + assertGetIdNotName, + Expr, + getText, + isXML, + contains, + compile, + sortOrder, + hasDuplicate, + outermostContext, + + baseHasDuplicate = true, + strundefined = "undefined", + + expando = ( "sizcache" + Math.random() ).replace( ".", "" ), + + Token = String, + document = window.document, + docElem = document.documentElement, + dirruns = 0, + done = 0, + pop = [].pop, + push = [].push, + slice = [].slice, + // Use a stripped-down indexOf if a native one is unavailable + indexOf = [].indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + // Augment a function for special use by Sizzle + markFunction = function( fn, value ) { + fn[ expando ] = value == null || value; + return fn; + }, + + createCache = function() { + var cache = {}, + keys = []; + + return markFunction(function( key, value ) { + // Only keep the most recent entries + if ( keys.push( key ) > Expr.cacheLength ) { + delete cache[ keys.shift() ]; + } + + // Retrieve with (key + " ") to avoid collision with native Object.prototype properties (see Issue #157) + return (cache[ key + " " ] = value); + }, cache ); + }, + + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // Regex + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors) + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments not in parens/brackets, + // then attribute selectors and non-pseudos (denoted by :), + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:" + attributes + ")|[^:]|\\\\.)*|.*))\\)|)", + + // For matchExpr.POS and matchExpr.needsContext + pos = ":(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/, + + rnot = /^:not/, + rsibling = /[\x20\t\r\n\f]*[+~]/, + rendsWithNot = /:not\($/, + + rheader = /h\d/i, + rinputs = /input|select|textarea|button/i, + + rbackslash = /\\(?!\\)/g, + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "POS": new RegExp( pos, "i" ), + "CHILD": new RegExp( "^:(only|nth|first|last)-child(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + // For use in libraries implementing .is() + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" ) + }, + + // Support + + // Used for testing something on an element + assert = function( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } + }, + + // Check if getElementsByTagName("*") returns only elements + assertTagNameNoComments = assert(function( div ) { + div.appendChild( document.createComment("") ); + return !div.getElementsByTagName("*").length; + }), + + // Check if getAttribute returns normalized href attributes + assertHrefNotNormalized = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }), + + // Check if attributes should be retrieved by attribute nodes + assertAttributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }), + + // Check if getElementsByClassName can be trusted + assertUsableClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }), + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + assertUsableName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
    "; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = document.getElementsByName && + // buggy browsers will return fewer than the correct 2 + document.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + document.getElementsByName( expando + 0 ).length; + assertGetIdNotName = !document.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + +// If slice is not available, provide a backup +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +function Sizzle( selector, context, results, seed ) { + results = results || []; + context = context || document; + var match, elem, xml, m, + nodeType = context.nodeType; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( nodeType !== 1 && nodeType !== 9 ) { + return []; + } + + xml = isXML( context ); + + if ( !xml && !seed ) { + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed, xml ); +} + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + return Sizzle( expr, null, null, [ elem ] ).length > 0; +}; + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + } else { + + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } + return ret; +}; + +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +// Element contains another +contains = Sizzle.contains = docElem.contains ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) ); + } : + docElem.compareDocumentPosition ? + function( a, b ) { + return b && !!( a.compareDocumentPosition( b ) & 16 ); + } : + function( a, b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + return false; + }; + +Sizzle.attr = function( elem, name ) { + var val, + xml = isXML( elem ); + + if ( !xml ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( xml || assertAttributes ) { + return elem.getAttribute( name ); + } + val = elem.getAttributeNode( name ); + return val ? + typeof elem[ name ] === "boolean" ? + elem[ name ] ? name : null : + val.specified ? val.value : null : + null; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + // IE6/7 return a modified href + attrHandle: assertHrefNotNormalized ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }, + + find: { + "ID": assertGetIdNotName ? + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + } : + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }, + + "TAG": assertTagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + var elem, + tmp = [], + i = 0; + + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }, + + "NAME": assertUsableName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }, + + "CLASS": assertUsableClassName && function( className, context, xml ) { + if ( typeof context.getElementsByClassName !== strundefined && !xml ) { + return context.getElementsByClassName( className ); + } + } + }, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( rbackslash, "" ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 3 xn-component of xn+y argument ([+-]?\d*n|) + 4 sign of xn-component + 5 x of xn-component + 6 sign of y-component + 7 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1] === "nth" ) { + // nth-child requires argument + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) ); + match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" ); + + // other types prohibit arguments + } else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var unquoted, excess; + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + if ( match[3] ) { + match[2] = match[3]; + } else if ( (unquoted = match[4]) ) { + // Only check arguments that contain a pseudo + if ( rpseudo.test(unquoted) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + unquoted = unquoted.slice( 0, excess ); + match[0] = match[0].slice( 0, excess ); + } + match[2] = unquoted; + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + "ID": assertGetIdNotName ? + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + return elem.getAttribute("id") === id; + }; + } : + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === id; + }; + }, + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + nodeName = nodeName.replace( rbackslash, "" ).toLowerCase(); + + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ expando ][ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem, context ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.substr( result.length - check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, argument, first, last ) { + + if ( type === "nth" ) { + return function( elem ) { + var node, diff, + parent = elem.parentNode; + + if ( first === 1 && last === 0 ) { + return true; + } + + if ( parent ) { + diff = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + diff++; + if ( elem === node ) { + break; + } + } + } + } + + // Incorporate the offset (or cast to NaN), then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + }; + } + + return function( elem ) { + var node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + /* falls through */ + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + var nodeType; + elem = elem.firstChild; + while ( elem ) { + if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) { + return false; + } + elem = elem.nextSibling; + } + return true; + }, + + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "text": function( elem ) { + var type, attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + (type = elem.type) === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type ); + }, + + // Input types + "radio": createInputPseudo("radio"), + "checkbox": createInputPseudo("checkbox"), + "file": createInputPseudo("file"), + "password": createInputPseudo("password"), + "image": createInputPseudo("image"), + + "submit": createButtonPseudo("submit"), + "reset": createButtonPseudo("reset"), + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "focus": function( elem ) { + var doc = elem.ownerDocument; + return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + "active": function( elem ) { + return elem === elem.ownerDocument.activeElement; + }, + + // Positional types + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + for ( var i = 0; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + for ( var i = 1; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +function siblingCheck( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; +} + +sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + return ( !a.compareDocumentPosition || !b.compareDocumentPosition ? + a.compareDocumentPosition : + a.compareDocumentPosition(b) & 4 + ) ? -1 : 1; + } : + function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + +// Always assume the presence of duplicates if sort doesn't +// pass them to our comparison function (as in Google Chrome). +[0, 0].sort( sortOrder ); +baseHasDuplicate = !hasDuplicate; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + i = 1, + j = 0; + + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + return results; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ expando ][ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + + // Cast descendant combinators to space + matched.type = match[0].replace( rtrim, " " ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + matched.type = type; + matched.matches = match; + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && combinator.dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( !xml ) { + var cache, + dirkey = dirruns + " " + doneName + " ", + cachedkey = dirkey + cachedruns; + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( (cache = elem[ expando ]) === cachedkey ) { + return elem.sizset; + } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) { + if ( elem.sizset ) { + return elem; + } + } else { + elem[ expando ] = cachedkey; + if ( matcher( elem, context, xml ) ) { + elem.sizset = true; + return elem; + } + elem.sizset = false; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( matcher( elem, context, xml ) ) { + return elem; + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && tokens.join("") + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Nested matchers should use non-integer dirruns + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = superMatcher.el; + } + + // Add elements passing elementMatchers directly to results + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + for ( j = 0; (matcher = elementMatchers[j]); j++ ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++superMatcher.el; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + for ( j = 0; (matcher = setMatchers[j]); j++ ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + superMatcher.el = 0; + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ expando ][ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function select( selector, context, results, seed, xml ) { + var i, tokens, token, type, find, + match = tokenize( selector ), + j = match.length; + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !xml && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( rbackslash, "" ), context, xml )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + // Fetch a seed set for right-to-left matching + for ( i = matchExpr["POS"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( rbackslash, "" ), + rsibling.test( tokens[0].type ) && context.parentNode || context, + xml + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && tokens.join(""); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + xml, + results, + rsibling.test( selector ) + ); + return results; +} + +if ( document.querySelectorAll ) { + (function() { + var disconnectedMatch, + oldSelect = select, + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // qSa(:focus) reports false when true (Chrome 21), no need to also add to buggyMatches since matches checks buggyQSA + // A support test would require too much code (would include document ready) + rbuggyQSA = [ ":focus" ], + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + // A support test would require too much code (would include document ready) + // just skip matchesSelector for :active + rbuggyMatches = [ ":active" ], + matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here (do not put tests after this one) + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE9 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = "

    "; + if ( div.querySelectorAll("[test^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here (do not put tests after this one) + div.innerHTML = ""; + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push(":enabled", ":disabled"); + } + }); + + // rbuggyQSA always contains :focus, so no need for a length check + rbuggyQSA = /* rbuggyQSA.length && */ new RegExp( rbuggyQSA.join("|") ); + + select = function( selector, context, results, seed, xml ) { + // Only use querySelectorAll when not filtering, + // when this is not xml, + // and when no QSA bugs apply + if ( !seed && !xml && !rbuggyQSA.test( selector ) ) { + var groups, i, + old = true, + nid = expando, + newContext = context, + newSelector = context.nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + groups[i].join(""); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + + return oldSelect( selector, context, results, seed, xml ); + }; + + if ( matches ) { + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + try { + matches.call( div, "[test!='']:sizzle" ); + rbuggyMatches.push( "!=", pseudos ); + } catch ( e ) {} + }); + + // rbuggyMatches always contains :active and :focus, so no need for a length check + rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") ); + + Sizzle.matchesSelector = function( elem, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyMatches always contains :active, so no need for an existence check + if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && !rbuggyQSA.test( expr ) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, null, null, [ elem ] ).length > 0; + }; + } + })(); +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Back-compat +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; jQuery.find = Sizzle; jQuery.expr = Sizzle.selectors; -jQuery.expr[":"] = jQuery.expr.filters; +jQuery.expr[":"] = jQuery.expr.pseudos; jQuery.unique = Sizzle.uniqueSort; jQuery.text = Sizzle.getText; jQuery.isXMLDoc = Sizzle.isXML; jQuery.contains = Sizzle.contains; - - -})(); - - + + +})( window ); var runtil = /Until$/, - rparentsprev = /^(?:parents|prevUntil|prevAll)/, - // Note: This RegExp should be improved, or likely pulled from Sizzle - rmultiselector = /,/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, isSimple = /^.[^:#\[\.,]*$/, - slice = Array.prototype.slice, - POS = jQuery.expr.match.POS, + rneedsContext = jQuery.expr.match.needsContext, // methods guaranteed to produce a unique set when starting from a unique set guaranteedUnique = { children: true, @@ -5135,8 +5365,8 @@ var runtil = /Until$/, jQuery.fn.extend({ find: function( selector ) { - var self = this, - i, l; + var i, l, length, n, r, ret, + self = this; if ( typeof selector !== "string" ) { return jQuery( selector ).filter(function() { @@ -5148,8 +5378,7 @@ jQuery.fn.extend({ }); } - var ret = this.pushStack( "", "find", selector ), - length, n, r; + ret = this.pushStack( "", "find", selector ); for ( i = 0, l = this.length; i < l; i++ ) { length = ret.length; @@ -5172,9 +5401,12 @@ jQuery.fn.extend({ }, has: function( target ) { - var targets = jQuery( target ); + var i, + targets = jQuery( target, this ), + len = targets.length; + return this.filter(function() { - for ( var i = 0, l = targets.length; i < l; i++ ) { + for ( i = 0; i < len; i++ ) { if ( jQuery.contains( this, targets[i] ) ) { return true; } @@ -5191,67 +5423,34 @@ jQuery.fn.extend({ }, is: function( selector ) { - return !!selector && ( typeof selector === "string" ? - jQuery.filter( selector, this ).length > 0 : - this.filter( selector ).length > 0 ); + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); }, closest: function( selectors, context ) { - var ret = [], i, l, cur = this[0]; - - // Array - if ( jQuery.isArray( selectors ) ) { - var match, selector, - matches = {}, - level = 1; - - if ( cur && selectors.length ) { - for ( i = 0, l = selectors.length; i < l; i++ ) { - selector = selectors[i]; - - if ( !matches[ selector ] ) { - matches[ selector ] = POS.test( selector ) ? - jQuery( selector, context || this.context ) : - selector; - } - } - - while ( cur && cur.ownerDocument && cur !== context ) { - for ( selector in matches ) { - match = matches[ selector ]; - - if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { - ret.push({ selector: selector, elem: cur, level: level }); - } - } - - cur = cur.parentNode; - level++; - } - } - - return ret; - } - - // String - var pos = POS.test( selectors ) || typeof selectors !== "string" ? + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? jQuery( selectors, context || this.context ) : 0; - for ( i = 0, l = this.length; i < l; i++ ) { + for ( ; i < l; i++ ) { cur = this[i]; - while ( cur ) { + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { ret.push( cur ); break; - - } else { - cur = cur.parentNode; - if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { - break; - } } + cur = cur.parentNode; } } @@ -5263,12 +5462,17 @@ jQuery.fn.extend({ // Determine the position of an element within // the matched set of elements index: function( elem ) { - if ( !elem || typeof elem === "string" ) { - return jQuery.inArray( this[0], - // If it receives a string, the selector is used - // If it receives nothing, the siblings are used - elem ? jQuery( elem ) : this.parent().children() ); + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + // Locate the position of the desired element return jQuery.inArray( // If it receives a jQuery object, the first element is used @@ -5286,17 +5490,29 @@ jQuery.fn.extend({ jQuery.unique( all ) ); }, - andSelf: function() { - return this.add( this.prevObject ); + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); } }); +jQuery.fn.andSelf = jQuery.fn.addBack; + // A painfully simple check to see if an element is disconnected // from a document (should be improved, where feasible). function isDisconnected( node ) { return !node || !node.parentNode || node.parentNode.nodeType === 11; } +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + jQuery.each({ parent: function( elem ) { var parent = elem.parentNode; @@ -5309,10 +5525,10 @@ jQuery.each({ return jQuery.dir( elem, "parentNode", until ); }, next: function( elem ) { - return jQuery.nth( elem, 2, "nextSibling" ); + return sibling( elem, "nextSibling" ); }, prev: function( elem ) { - return jQuery.nth( elem, 2, "previousSibling" ); + return sibling( elem, "previousSibling" ); }, nextAll: function( elem ) { return jQuery.dir( elem, "nextSibling" ); @@ -5327,7 +5543,7 @@ jQuery.each({ return jQuery.dir( elem, "previousSibling", until ); }, siblings: function( elem ) { - return jQuery.sibling( elem.parentNode.firstChild, elem ); + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); }, children: function( elem ) { return jQuery.sibling( elem.firstChild ); @@ -5335,16 +5551,11 @@ jQuery.each({ contents: function( elem ) { return jQuery.nodeName( elem, "iframe" ) ? elem.contentDocument || elem.contentWindow.document : - jQuery.makeArray( elem.childNodes ); + jQuery.merge( [], elem.childNodes ); } }, function( name, fn ) { jQuery.fn[ name ] = function( until, selector ) { - var ret = jQuery.map( this, fn, until ), - // The variable 'args' was introduced in - // https://github.com/jquery/jquery/commit/52a0238 - // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. - // http://code.google.com/p/v8/issues/detail?id=1050 - args = slice.call(arguments); + var ret = jQuery.map( this, fn, until ); if ( !runtil.test( name ) ) { selector = until; @@ -5356,11 +5567,11 @@ jQuery.each({ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; - if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + if ( this.length > 1 && rparentsprev.test( name ) ) { ret = ret.reverse(); } - return this.pushStack( ret, name, args.join(",") ); + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); }; }); @@ -5388,19 +5599,6 @@ jQuery.extend({ return matched; }, - nth: function( cur, result, dir, elem ) { - result = result || 1; - var num = 0; - - for ( ; cur; cur = cur[dir] ) { - if ( cur.nodeType === 1 && ++num === result ) { - break; - } - } - - return cur; - }, - sibling: function( n, elem ) { var r = []; @@ -5429,7 +5627,7 @@ function winnow( elements, qualifier, keep ) { } else if ( qualifier.nodeType ) { return jQuery.grep(elements, function( elem, i ) { - return (elem === qualifier) === keep; + return ( elem === qualifier ) === keep; }); } else if ( typeof qualifier === "string" ) { @@ -5445,24 +5643,39 @@ function winnow( elements, qualifier, keep ) { } return jQuery.grep(elements, function( elem, i ) { - return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; }); } +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} - - -var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, rleadingWhitespace = /^\s+/, - rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, rtagName = /<([\w:]+)/, rtbody = /]", "i"), + rcheckableType = /^(?:checkbox|radio)$/, // checked="checked" or checked rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, rscriptType = /\/(java|ecma)script/i, - rcleanScript = /^\s*\s*$/g, wrapMap = { option: [ 1, "" ], legend: [ 1, "
    ", "
    " ], @@ -5472,32 +5685,27 @@ var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, col: [ 2, "", "
    " ], area: [ 1, "", "" ], _default: [ 0, "", "" ] - }; + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); wrapMap.optgroup = wrapMap.option; wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; wrapMap.th = wrapMap.td; -// IE can't serialize and